Quantcast

Merge branch 'inspectui'

Repooc [03-18-14 - 03:25]
Merge branch 'inspectui'
Filename
ElvUI_SLE/modules/characterframe/communication.lua
ElvUI_SLE/modules/characterframe/inspectframe.lua
ElvUI_SLE/modules/characterframe/load_characterframe.xml
ElvUI_SLE/modules/characterframe/notifyinspect.lua
diff --git a/ElvUI_SLE/modules/characterframe/communication.lua b/ElvUI_SLE/modules/characterframe/communication.lua
new file mode 100644
index 0000000..f83acf5
--- /dev/null
+++ b/ElvUI_SLE/modules/characterframe/communication.lua
@@ -0,0 +1,891 @@
+--------------------------------------------------------------------------------
+--<< AISM : Surpport Module for Armory Inspecting							>>--
+--------------------------------------------------------------------------------
+local AISM = _G['Armory_InspectSupportModule']
+
+if not AISM then
+	local ItemSetBonusKey = ITEM_SET_BONUS:gsub('%%s', '(.+)')
+	local ProfessionLearnKey = ERR_LEARN_ABILITY_S:gsub('%%s', '(.+)')
+	local ProfessionLearnKey2 = ERR_LEARN_RECIPE_S:gsub('%%s', '(.+)')
+	local ProfessionUnlearnKey = ERR_SPELL_UNLEARNED_S:gsub('%%s', '(.+)')
+
+	local playerName = UnitName('player')
+	local playerRealm = GetRealmName()
+	local _, playerClass, playerClassID = UnitClass('player')
+	local playerRace, playerRaceID = UnitRace('player')
+	local playerSex = UnitSex('player')
+	local isHelmDisplayed = ShowingHelm() == 1
+	local isCloakDisplayed = ShowingCloak() == 1
+
+	--<< Create Core >>--
+	AISM = CreateFrame('Frame', 'Armory_InspectSupportModule', UIParent)
+	AISM.Version = 1.0
+	AISM.Tooltip = CreateFrame('GameTooltip', 'AISM_Tooltip', nil, 'GameTooltipTemplate')
+	AISM.Tooltip:SetOwner(UIParent, 'ANCHOR_NONE')
+	AISM.Updater = CreateFrame('Frame', 'AISM_Updater', UIParent)
+
+	AISM.SendMessageDelay = 2
+	AISM.SendDataGroupUpdated = AISM.SendMessageDelay
+	AISM.SendDataGuildUpdated = AISM.SendMessageDelay
+
+	AISM.PlayerData = {}
+	AISM.PlayerData_ShortString = {}
+	AISM.GroupMemberData = {}
+	AISM.GuildMemberData = {}
+	AISM.CurrentInspectData = {}
+	AISM.InspectRegistered = {}
+	AISM.RemainMessage = {}
+	AISM.RegisteredFunction = {}
+
+	--<< Define Key Table >>--
+	AISM.ProfessionList = {
+		[GetSpellInfo(110396)] = 'BS', -- BlackSmithing
+		[GetSpellInfo(110400)] = 'EC', -- Enchanting
+		[GetSpellInfo(110403)] = 'EG', -- Engineering
+		[GetSpellInfo(110417)] = 'IS', -- Inscription
+		[GetSpellInfo(110420)] = 'JC', -- JewelCrafting
+		[GetSpellInfo(110423)] = 'LW', -- LeatherWorking
+		[GetSpellInfo(110426)] = 'TL', -- Tailoring
+	}
+	AISM.GearList = {
+		['HeadSlot'] = 'HE',
+		['NeckSlot'] = 'NK',
+		['ShoulderSlot'] = 'SD',
+		['BackSlot'] = 'BK',
+		['ChestSlot'] = 'CH',
+		['ShirtSlot'] = 'ST',
+		['TabardSlot'] = 'TB',
+		['WristSlot'] = 'WR',
+		['HandsSlot'] = 'HD',
+		['WaistSlot'] = 'WA',
+		['LegsSlot'] = 'LE',
+		['FeetSlot'] = 'FE',
+		['Finger0Slot'] = 'FG0',
+		['Finger1Slot'] = 'FG1',
+		['Trinket0Slot'] = 'TR0',
+		['Trinket1Slot'] = 'TR1',
+		['MainHandSlot'] = 'MH',
+		['SecondaryHandSlot'] = 'SH',
+	}
+	AISM.CanTransmogrifySlot = {
+		['HeadSlot'] = true,
+		['ShoulderSlot'] = true,
+		['BackSlot'] = true,
+		['ChestSlot'] = true,
+		['WristSlot'] = true,
+		['HandsSlot'] = true,
+		['WaistSlot'] = true,
+		['LegsSlot'] = true,
+		['FeetSlot'] = true,
+		['MainHandSlot'] = true,
+		['SecondaryHandSlot'] = true,
+	}
+	AISM.DataTypeTable = {
+		['PLI'] = 'PlayerInfo',
+		['GLD'] = 'GuildInfo',
+		['PF1'] = 'Profession',
+		['PF2'] = 'Profession',
+		['ASP'] = 'ActiveSpec',
+		['SID'] = 'SetItemData',
+	}
+
+	for groupNum = 1, MAX_TALENT_GROUPS do
+		AISM.DataTypeTable['SP'..groupNum] = 'Specialization'
+		AISM.DataTypeTable['GL'..groupNum] = 'Glyph'
+	end
+
+	for _, keyName in pairs(AISM.GearList) do
+		AISM.DataTypeTable[keyName] = 'Gear'
+	end
+
+	--<< Player Data Updater Core >>--
+	local needUpdate, SystemMessage, isPlayer
+	AISM.Updater:SetScript('OnUpdate', function(self)
+		AISM.UpdatedData = needUpdate and AISM.UpdatedData or {}
+		needUpdate = nil
+
+		if not self.ProfessionUpdated then
+			needUpdate = AISM:GetPlayerProfessionSetting() or needUpdate
+		end
+
+		if not self.SpecUpdated then
+			needUpdate = AISM:GetPlayerSpecSetting() or needUpdate
+		end
+
+		if not self.GlyphUpdated then
+			needUpdate = AISM:GetPlayerGlyphString() or needUpdate
+		end
+
+		if not self.GearUpdated then
+			needUpdate = AISM:GetPlayerGearString() or needUpdate
+		end
+
+		if not needUpdate then
+			self:Hide()
+
+			if self.Initialize then
+				for _ in pairs(AISM.UpdatedData) do
+					if AISM.CurrentGroupMode and AISM.CurrentGroupMode ~= 'NoGroup' and AISM.CurrentGroupType then
+						AISM:SendData(AISM.UpdatedData)
+					end
+					break
+				end
+			end
+		end
+	end)
+
+	AISM.Updater:SetScript('OnEvent', function(self, EventTag, ...)
+		if Event == 'COMBAT_LOG_EVENT_UNFILTERED' then
+			_, SystemMessage, _, _, _, _, _, _, isPlayer = ...
+
+			if SystemMessage == 'ENCHANT_APPLIED' and isPlayer == playerName then
+				self.GearUpdated = nil
+				self:Show()
+			end
+		elseif Event == 'UNIT_INVENTORY_CHANGED' then
+			isPlayer = ...
+
+			if isPlayer == 'player' then
+				self.GearUpdated = nil
+				self:Show()
+			end
+		elseif Event == 'CHAT_MSG_SYSTEM' then
+			SystemMessage = ...
+
+			if SystemMessage:find(ProfessionLearnKey) or SystemMessage:find(ProfessionLearnKey2) or SystemMessage:find(ProfessionUnlearnKey) then
+				self.ProfessionUpdated = nil
+				self:Show()
+			end
+		elseif Event == 'ACTIVE_TALENT_GROUP_CHANGED' or Event == 'CHARACTER_POINTS_CHANGED' then
+			self.SpecUpdated = nil
+			self:Show()
+		elseif Event == 'GLYPH_ADDED' or Event == 'GLYPH_REMOVED' or Event == 'GLYPH_UPDATED' then
+			self.GlyphUpdated = nil
+			self:Show()
+		elseif Event == 'SOCKET_INFO_SUCCESS' or Event == 'PLAYER_EQUIPMENT_CHANGED' or Event == 'EQUIPMENT_SWAP_FINISHED' or Event == 'ITEM_UPGRADE_MASTER_UPDATE' or Event == 'TRANSMOGRIFY_UPDATE' then
+			self.GearUpdated = nil
+			self:Show()
+		end
+	end)
+
+	AISM.UpdateHelmDisplaying = function(value)
+		isHelmDisplayed = value == '1'
+		AISM.Updater.GearUpdated = nil
+		AISM.Updater:Show()
+	end
+	hooksecurefunc('ShowHelm', AISM.UpdateHelmDisplaying)
+
+	AISM.UpdateCloakDisplaying = function(value)
+		isCloakDisplayed = value == '1'
+		AISM.Updater.GearUpdated = nil
+		AISM.Updater:Show()
+	end
+	hooksecurefunc('ShowCloak', AISM.UpdateCloakDisplaying)
+
+	--<< Profession String >>--
+	function AISM:GetPlayerProfessionSetting()
+		local Profession1, Profession2 = GetProfessions()
+		local Profession1_Level, Profession2_Level = 0, 0
+
+		if Profession1 then
+			Profession1, _, Profession1_Level = GetProfessionInfo(Profession1)
+
+			if self.ProfessionList[Profession1] then
+				Profession1 = self.ProfessionList[Profession1]..'/'..Profession1_Level
+			else
+				Profession1 = 'F'
+			end
+		end
+
+		if Profession2 then
+			Profession2, _, Profession2_Level = GetProfessionInfo(Profession2)
+
+			if self.ProfessionList[Profession2] then
+				Profession2 = self.ProfessionList[Profession2]..'/'..Profession2_Level
+			else
+				Profession2 = 'F'
+			end
+		end
+
+		if self.PlayerData.Profession1 ~= Profession1 then
+			self.PlayerData.Profession1 = Profession1
+		end
+
+		if self.PlayerData.Profession2 ~= Profession2 then
+			self.PlayerData.Profession2 = Profession2
+		end
+
+		self.Updater.ProfessionUpdated = true
+	end
+
+	AISM.Updater:RegisterEvent('CHAT_MSG_SYSTEM')
+
+	--<< Specialization String >>--
+	function AISM:GetPlayerSpecSetting()
+		local DataString, isSelected, selectedSlot
+		local ActiveSpec = GetActiveSpecGroup()
+
+		for groupNum = 1, MAX_TALENT_GROUPS do
+			DataString = GetSpecialization(nil, nil, groupNum)
+
+			if DataString then
+				DataString = GetSpecializationInfo(DataString)
+			else
+				DataString = '0'
+			end
+
+			for i = 1, MAX_NUM_TALENT_TIERS do
+				selectedSlot = '0'
+
+				for k = 1, NUM_TALENT_COLUMNS do
+					_, _, _, _, isSelected = GetTalentInfo((i - 1) * NUM_TALENT_COLUMNS + k, nil, groupNum)
+
+					if isSelected then
+						selectedSlot = k
+						break
+					end
+				end
+
+				DataString = DataString..'/'..selectedSlot
+			end
+
+			if self.PlayerData['Spec'..groupNum] ~= DataString then
+				self.PlayerData['Spec'..groupNum] = DataString
+			end
+
+			if groupNum == ActiveSpec and self.PlayerData_ShortString.Spec1 ~= DataString then
+				self.PlayerData_ShortString.Spec1 = DataString
+				self.UpdatedData.Spec1 = DataString
+			end
+		end
+
+		isSelected = GetActiveSpecGroup()
+
+		if self.PlayerData.ActiveSpec ~= ActiveSpec then
+			self.PlayerData.ActiveSpec = ActiveSpec
+		end
+
+		self.Updater.SpecUpdated = true
+	end
+	AISM.Updater:RegisterEvent('ACTIVE_TALENT_GROUP_CHANGED')
+	AISM.Updater:RegisterEvent('CHARACTER_POINTS_CHANGED')
+
+	--<< Glyph String >>--
+	function AISM:GetPlayerGlyphString()
+		local ShortString, FullString
+		local ActiveSpec = GetActiveSpecGroup()
+
+		local SpellID, GlyphID
+		for groupNum = 1, MAX_TALENT_GROUPS do
+			ShortString, FullString = '', ''
+
+			for slotNum = 1, NUM_GLYPH_SLOTS do
+				_, _, _, SpellID, _, GlyphID = GetGlyphSocketInfo(slotNum, groupNum)
+
+				ShortString = ShortString..(SpellID or '0')..(slotNum ~= NUM_GLYPH_SLOTS and '/' or '')
+				FullString = FullString..(SpellID or '0')..'_'..(GlyphID or '0')..(slotNum ~= NUM_GLYPH_SLOTS and '/' or '')
+			end
+
+			if self.PlayerData['Glyph'..groupNum] ~= FullString then
+				self.PlayerData['Glyph'..groupNum] = FullString
+			end
+
+			if groupNum == ActiveSpec and self.PlayerData_ShortString.Glyph1 ~= ShortString then
+				self.PlayerData_ShortString.Glyph1 = ShortString
+				self.UpdatedData.Glyph1 = ShortString
+			end
+		end
+
+		self.Updater.GlyphUpdated = true
+	end
+
+	AISM.Updater:RegisterEvent('GLYPH_ADDED')
+	AISM.Updater:RegisterEvent('GLYPH_REMOVED')
+	AISM.Updater:RegisterEvent('GLYPH_UPDATED')
+
+	--<< Gear String >>--
+	function AISM:GetPlayerGearString()
+		local ShortString, FullString
+		local CurrentSetItem = {}
+
+		local slotID, slotLink, isTransmogrified, transmogrifiedItemID, SetName, GeatSetCount, SetItemMax, colorR, colorG, colorB, checkSpace, SetItemOptionNum, tooltipText
+		for slotName in pairs(self.GearList) do
+			slotID = GetInventorySlotInfo(slotName)
+			slotLink = GetInventoryItemLink('player', slotID)
+
+			if slotLink and slotLink:find('%[%]') then -- sometimes itemLink is malformed so we need to update when crashed
+				self.Updater.GearUpdated = nil
+
+				return true
+			end
+
+			if slotLink and self.CanTransmogrifySlot[slotName] then
+				isTransmogrified, _, _, _, _, transmogrifiedItemID = GetTransmogrifySlotInfo(slotID)
+			else
+				isTransmogrified = nil
+			end
+
+			if slotName == 'HeadSlot' or slotName == 'BackSlot' then
+				print(slotName..' : '..(slotName == 'HeadSlot' and not isHelmDisplayed and 'NotDisplayed' or slotName == 'BackSlot' and not isCloakDisplayed and 'NotDisplayed' or 'Displayed'))
+			end
+
+			ShortString = slotLink and select(2, strsplit(':', slotLink)) or 'F'
+			FullString = (slotLink or 'F')..'/'..(slotName == 'HeadSlot' and not isHelmDisplayed and 'ND' or slotName == 'BackSlot' and not isCloakDisplayed and 'ND' or isTransmogrified and transmogrifiedItemID or '0')
+
+			for i = 1, MAX_NUM_SOCKETS do
+				FullString = FullString..'/'..(select(i, GetInventoryItemGems(slotID)) or 0)
+			end
+
+			if self.PlayerData[slotName] ~= FullString then
+				self.PlayerData[slotName] = FullString
+			end
+
+			if self.PlayerData_ShortString[slotName] ~= ShortString then
+				self.PlayerData_ShortString[slotName] = ShortString
+				self.UpdatedData[slotName] = ShortString
+			end
+
+			if slotLink then
+				self.Tooltip:ClearLines()
+				self.Tooltip:SetInventoryItem('player', slotID)
+
+				checkSpace = 2
+
+				for i = 1, self.Tooltip:NumLines() do
+					SetName, SetItemCount, SetItemMax = _G['AISM_TooltipTextLeft'..i]:GetText():match('^(.+) %((%d)/(%d)%)$') -- find string likes 'SetName (0/5)'
+
+					if SetName then
+						SetItemCount = tonumber(SetItemCount)
+						SetItemMax = tonumber(SetItemMax)
+
+						if SetItemCount > SetItemMax or SetItemMax == 1 then
+							self.Updater.GearUpdated = nil
+
+							return true
+						elseif CurrentSetItem[SetName] then
+							break
+						else
+							CurrentSetItem[SetName] = true
+							ShortString = 0
+							FullString = ''
+
+							for k = 1, self.Tooltip:NumLines() do
+								tooltipText = _G['AISM_TooltipTextLeft'..(i+k)]:GetText()
+
+								if tooltipText == ' ' then
+									checkSpace = checkSpace - 1
+
+									if checkSpace == 0 then break end
+								elseif checkSpace == 2 then
+									colorR, colorG, colorB = _G['AISM_TooltipTextLeft'..(i+k)]:GetTextColor()
+
+									if colorR > LIGHTYELLOW_FONT_COLOR.r - .01 and colorR < LIGHTYELLOW_FONT_COLOR.r + .01 and colorG > LIGHTYELLOW_FONT_COLOR.g - .01 and colorG < LIGHTYELLOW_FONT_COLOR.g + .01 and colorB > LIGHTYELLOW_FONT_COLOR.b - .01 and colorB < LIGHTYELLOW_FONT_COLOR.b + .01 then
+										ShortString = ShortString + 1
+										tooltipText = LIGHTYELLOW_FONT_COLOR_CODE..tooltipText
+									else
+										tooltipText = GRAY_FONT_COLOR_CODE..tooltipText
+									end
+								--print(tooltipText..' / '..SetItemCount..' / '..SetItemMax)
+
+									FullString = FullString..'/'..tooltipText
+								elseif tooltipText:find(ItemSetBonusKey) then
+									FullString = FullString..'/'..(tooltipText:match("^%((%d)%)%s.+:%s.+$") or 'T')
+								end
+							end
+
+							self.PlayerData.SetItem = self.PlayerData.SetItem or {}
+							if self.PlayerData.SetItem[SetName] ~= FullString then
+								self.PlayerData.SetItem[SetName] = FullString
+							end
+
+							self.PlayerData_ShortString.SetItem = self.PlayerData_ShortString.SetItem or {}
+							if self.PlayerData_ShortString.SetItem[SetName] ~= ShortString then
+								self.PlayerData_ShortString.SetItem[SetName] = ShortString
+
+								self.UpdatedData.SetItem = self.UpdatedData.SetItem or {}
+								self.UpdatedData.SetItem[SetName] = ShortString
+							end
+
+							break
+						end
+					end
+
+					if checkSpace == 0 then break end
+				end
+			end
+		end
+
+		-- Clear cache when there's no gear set
+		if self.PlayerData.SetItem then
+			for SetName in pairs(self.PlayerData.SetItem) do
+				if not CurrentSetItem[SetName] then
+					self.PlayerData.SetItem[SetName] = nil
+
+					self.PlayerData_ShortString.SetItem[SetName] = nil
+					self.UpdatedData.SetItem = self.UpdatedData.SetItem or {}
+					self.UpdatedData.SetItem[SetName] = 'F'
+				end
+			end
+		end
+
+		self.Updater.GearUpdated = true
+
+		return nil
+	end
+
+	AISM.Updater:RegisterEvent('SOCKET_INFO_SUCCESS')
+	AISM.Updater:RegisterEvent('PLAYER_EQUIPMENT_CHANGED')
+	--AISM.Updater:RegisterEvent('UNIT_INVENTORY_CHANGED')
+	--AISM.Updater:RegisterEvent('EQUIPMENT_SWAP_FINISHED')
+	AISM.Updater:RegisterEvent('ITEM_UPGRADE_MASTER_UPDATE')
+	AISM.Updater:RegisterEvent('TRANSMOGRIFY_UPDATE')
+	AISM.Updater:RegisterEvent('COMBAT_LOG_EVENT_UNFILTERED')
+
+	--<< Player Info >>--
+	function AISM:SettingInspectData(TableToSave)
+		local guildName, guildRankName = GetGuildInfo('player')
+
+		TableToSave.PlayerInfo = playerName..'_'..UnitPVPName('player')..'/'..playerRealm..'/'..UnitLevel('player')..'/'..playerClass..'/'..playerClassID..'/'..playerRace..'/'..playerRaceID..'/'..playerSex..(guildName and '/'..guildName..'/'..guildRankName or '')
+
+		if IsInGuild() then
+			TableToSave.GuildInfo = GetGuildLevel()..'/'..GetNumGuildMembers()
+
+			for _, DataString in ipairs({ GetGuildLogoInfo('player') }) do
+				TableToSave.GuildInfo = TableToSave.GuildInfo..'/'..DataString
+			end
+		end
+	end
+
+
+	function AISM:SendData(InputData, Prefix, Channel, WhisperTarget)
+		Channel = Channel or IsInGroup(LE_PARTY_CATEGORY_INSTANCE) and 'INSTANCE_CHAT' or string.upper(self.CurrentGroupMode)
+		Prefix = Prefix or 'AISM'
+
+		if not InputData or type(InputData) ~= 'table' or Channel == 'NOGROUP' then return end
+
+		local Data = {}
+
+		if InputData.Profession1 then
+			Data[#Data + 1] = 'PF1:'..InputData.Profession1
+		end
+
+		if InputData.Profession2 then
+			Data[#Data + 1] = 'PF2:'..InputData.Profession2
+		end
+
+		for groupNum = 1, MAX_TALENT_GROUPS do
+			if InputData['Spec'..groupNum] then
+				Data[#Data + 1] = 'SP'..groupNum..':'..InputData['Spec'..groupNum]
+			end
+		end
+
+		if InputData.ActiveSpec then
+			Data[#Data + 1] = 'ASP:'..InputData.ActiveSpec
+		end
+
+		for groupNum = 1, MAX_TALENT_GROUPS do
+			if InputData['Glyph'..groupNum] then
+				Data[#Data + 1] = 'GL'..groupNum..':'..InputData['Glyph'..groupNum]
+			end
+		end
+
+		for slotName, keyName in pairs(self.GearList) do
+			if InputData[slotName] then
+				Data[#Data + 1] = keyName..':'..InputData[slotName]
+			end
+		end
+
+		if InputData.SetItem then
+			for SetName, DataString in pairs(InputData.SetItem) do
+				Data[#Data + 1] = 'SID:'..SetName..(type(DataString) == 'number' and '/' or '')..DataString
+			end
+		end
+
+		if InputData.PlayerInfo then
+			Data[#Data + 1] = 'PLI:'..InputData.PlayerInfo
+		end
+
+		if InputData.GuildInfo then
+			Data[#Data + 1] = 'GLD:'..InputData.GuildInfo
+		end
+
+		local DataString = ''
+		local stringLength = 0
+		local dataLength
+
+		for dataTag, dataText in pairs(Data) do
+			DataString = DataString..'{'..dataText..'}'
+			dataLength = strlen(dataText) + 2
+
+			if stringLength + dataLength <= 255 then
+				stringLength = stringLength + dataLength
+			else
+				while strlen(DataString) > 255 do
+					SendAddonMessage(Prefix, strsub(DataString, 1, 255), Channel, WhisperTarget)
+
+					DataString = strsub(DataString, 256)
+					stringLength = strlen(DataString)
+				end
+			end
+		end
+
+		if DataString ~= '' then
+			SendAddonMessage(Prefix, DataString, Channel, WhisperTarget)
+		end
+	end
+
+	function AISM:GetPlayerCurrentGroupMode()
+		if not (IsInGroup() or IsInRaid()) or GetNumGroupMembers() == 1 then
+			self.CurrentGroupMode = 'NoGroup'
+			self.GroupMemberData = {}
+		else
+			if IsInRaid() then
+				self.CurrentGroupMode = 'raid'
+			else
+				self.CurrentGroupMode = 'party'
+			end
+
+			for userName in pairs(self.GroupMemberData) do
+				if not UnitExists(userName) or not UnitIsConnected(userName) then
+					self.GroupMemberData[userName] = nil
+				end
+			end
+		end
+
+		return self.CurrentGroupMode
+	end
+
+	function AISM:GetCurrentInstanceType()
+		local _, instanceType, difficultyID = GetInstanceInfo()
+
+		if difficultyID == 8 then
+			self.InstanceType = 'challenge'
+		else
+			self.InstanceType = instanceType == 'none' and 'field' or instanceType
+		end
+	end
+
+	local LastSendGroupType = 'NoGroup'
+	local LastSendInstanceType = 'field'
+	AISM:SetScript('OnUpdate', function(self, elapsed)
+		if not self.Initialize then
+			SendAddonMessage('AISM', 'AISM_Initialize', 'WHISPER', playerName)
+		else
+			if self.CurrentGroupMode and self.InstanceType then
+				if LastSendGroupType ~= self.CurrentGroupMode or LastSendInstanceType ~= self.InstanceType or self.needSendDataGroup ~= nil then
+					LastSendGroupType = self.CurrentGroupMode
+					LastSendInstanceType = self.InstanceType
+
+					if self.CurrentGroupMode ~= 'NoGroup' then
+						local Name, TableIndex
+
+						for i = 1, MAX_RAID_MEMBERS do
+							Name = UnitName(self.CurrentGroupMode..i)
+							TableIndex = GetUnitName(self.CurrentGroupMode..i, true)
+
+							if Name and not UnitIsUnit('player', self.CurrentGroupMode..i) then
+								if Name == UNKNOWNOBJECT or Name == COMBATLOG_UNKNOWN_UNIT then
+									if self.needSendDataGroup == nil then
+										self.needSendDataGroup = false
+									end
+								elseif not UnitIsConnected(self.CurrentGroupMode..i) then
+									self.GroupMemberData[TableIndex] = nil
+								elseif not self.GroupMemberData[TableIndex] then
+									self.needSendDataGroup = true
+
+									self.GroupMemberData[TableIndex] = true
+								end
+							end
+						end
+					else
+						self.needSendDataGroup = nil
+						self.SendDataGroupUpdated = self.SendMessageDelay
+					end
+				end
+
+				if self.needSendDataGroup and self.Updater.SpecUpdated and self.Updater.GlyphUpdated and self.Updater.GearUpdated then
+					self.SendDataGroupUpdated = self.SendDataGroupUpdated - elapsed
+
+					if self.SendDataGroupUpdated < 0 then
+						self.SendDataGroupUpdated = self.SendMessageDelay
+
+						self:SendData(self.PlayerData_ShortString)
+						self.needSendDataGroup = nil
+					end
+				end
+			end
+
+			if self.needSendDataGuild then
+				self.SendDataGuildUpdated = self.SendDataGuildUpdated - elapsed
+
+				if self.SendDataGuildUpdated < 0 then
+					self.SendDataGuildUpdated = self.SendMessageDelay
+
+					SendAddonMessage('AISM', 'AISM_GUILD_RegistME', 'GUILD')
+					print('길드? AISM_GUILD_RegistME 전송')
+					self.needSendDataGuild = nil
+				end
+			end
+
+			if self.needSendDataGroup == nil and self.needSendDataGuild == nil then
+				self:Hide() -- close function
+			end
+		end
+	end)
+
+	function AISM:PrepareTableSetting(Prefix, Sender)
+		if Prefix == 'AISM' then
+			local NeedResponse
+
+			if type(self.GroupMemberData[Sender]) ~= 'table' then
+				self.GroupMemberData[Sender] = {}
+
+				NeedResponse = true
+			end
+
+			return self.GroupMemberData[Sender], NeedResponse
+		else
+			return self.CurrentInspectData[Sender]
+		end
+	end
+
+	local SenderRealm
+	function AISM:Receiver(Prefix, Message, Channel, Sender)
+		Sender, SenderRealm = strsplit('-', Sender)
+		Sender = Sender..(SenderRealm and SenderRealm ~= '' and SenderRealm ~= playerRealm and '-'..SenderRealm or '')
+
+		print('|cffceff00['..Channel..']|r|cff2eb7e4['..Prefix..']|r '..Sender..' : ')
+		print(Message)
+
+		if Message == 'AISM_GUILD_RegistME' then
+			self.GuildMemberData[Sender] = true
+			SendAddonMessage('AISM', 'AISM_GUILD_RegistResponse', SenderRealm == playerRealm and 'WHISPER' or 'GUILD', Sender)
+		elseif Message == 'AISM_GUILD_RegistResponse' then
+			self.GuildMemberData[Sender] = true
+		elseif Message == 'AISM_GUILD_UnregistME' then
+			self.GuildMemberData[Sender] = nil
+			self.CurrentInspectData[Sender] = nil
+		elseif Message:find('AISM_DataRequestForInspecting:') then
+			local needplayerName, needplayerRealm = Message:match('^.+:(.+)-(.+)$')
+
+			if needplayerName == playerName and needplayerRealm == playerRealm then
+				--local DataToSend = E:CopyTable({}, self.PlayerData)
+				local TableToSend = {}
+
+				for Index, Data in pairs(self.PlayerData) do
+					TableToSend[Index] = Data
+				end
+
+				self:SettingInspectData(DataToSend)
+
+				self:SendData(DataToSend, Prefix, Channel, Sender)
+			end
+		else
+			local TableToSave, NeedResponse, Group, stringTable
+
+			TableToSave, NeedResponse = self:PrepareTableSetting(Prefix, Sender)
+
+			if not TableToSave then
+				self.RemainMessage[Sender] = nil
+
+				return
+			else
+				Message = (self.RemainMessage[Sender] or '')..Message
+
+				for DataType, DataString in Message:gmatch('%{(.-):(.-)%}') do
+					if self.DataTypeTable[DataType] then
+						Message = string.gsub(Message, '%{'..DataType..':.-%}', '')
+						Group = DataType:match('^.+(%d)$')
+						stringTable = { strsplit('/', DataString) }
+
+						for Index, Data in pairs(stringTable) do
+							if tonumber(Data) then
+								stringTable[Index] = tonumber(Data)
+							end
+						end
+
+						if Group and self.DataTypeTable[DataType] ~= 'Gear' then -- Prepare group setting
+							Group = tonumber(Group)
+							TableToSave[(self.DataTypeTable[DataType])] = TableToSave[(self.DataTypeTable[DataType])] or {}
+							TableToSave[(self.DataTypeTable[DataType])][Group] = TableToSave[(self.DataTypeTable[DataType])][Group] or {}
+						end
+
+						if self.DataTypeTable[DataType] == 'Profession' then
+							if stringTable[1] == 'F' then
+								--TableToSave.Profession[Group] = {}
+								TableToSave.Profession[Group].Name = EMPTY
+								TableToSave.Profession[Group].Level = 0
+							else
+								for localeName, Key in pairs(self.ProfessionList) do
+									if Key == stringTable[1] then
+										TableToSave.Profession[Group].Name = localeName
+										break
+									end
+								end
+								TableToSave.Profession[Group].Level = stringTable[2]
+							end
+						elseif self.DataTypeTable[DataType] == 'Specialization' then
+							TableToSave.Specialization[Group].SpecializationID = stringTable[1]
+
+							for i = 1, MAX_NUM_TALENT_TIERS do
+								for k = 1, NUM_TALENT_COLUMNS do
+									TableToSave.Specialization[Group]['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)] = k == stringTable[i + 1] and true or false
+								end
+							end
+						elseif self.DataTypeTable[DataType] == 'ActiveSpec' then
+							TableToSave.Specialization = TableToSave.Specialization or {}
+							TableToSave.Specialization.ActiveSpec = tonumber(DataString)
+						elseif self.DataTypeTable[DataType] == 'Glyph' then
+							local SpellID, GlyphID
+							for i = 1, #stringTable do
+								SpellID, GlyphID = strsplit('_', stringTable[i])
+
+								TableToSave.Glyph[Group]['Glyph'..i..'SpellID'] = tonumber(SpellID)
+								TableToSave.Glyph[Group]['Glyph'..i..'ID'] = tonumber(GlyphID)
+							end
+						elseif self.DataTypeTable[DataType] == 'Gear' then
+							TableToSave.Gear = TableToSave.Gear or {}
+
+							for slotName, keyName in pairs(self.GearList) do
+								if keyName == DataType then
+									DataType = slotName
+									break
+								end
+							end
+
+							TableToSave.Gear[DataType] = {
+								['ItemLink'] = stringTable[1] ~= 'F' and stringTable[1],
+								['Transmogrify'] = stringTable[2] == 'ND' and 'NotDisplayed' or stringTable[2] ~= 0 and stringTable[2],
+								['Gem1'] = stringTable[3] ~= 0 and stringTable[3],
+								['Gem2'] = stringTable[4] ~= 0 and stringTable[4],
+								['Gem3'] = stringTable[5] ~= 0 and stringTable[5],
+							}
+						elseif self.DataTypeTable[DataType] == 'SetItemData' then
+							TableToSave.SetItem = TableToSave.SetItem or {}
+
+							if stringTable[2] ~= 'F' then
+								if type(stringTable[2]) == 'number' then
+									TableToSave.SetItem[(stringTable[1])] = stringTable[2]
+								else
+									TableToSave.SetItem[(stringTable[1])] = {}
+
+									for i = 2, #stringTable do
+										if strlen(stringTable[i]) > 2 then
+											TableToSave.SetItem[(stringTable[1])][i - 1] = stringTable[i]
+										else
+											for k = 1, #stringTable - i + 1 do
+												TableToSave.SetItem[(stringTable[1])]['SetOption'..k] = stringTable[i + k - 1] == 'T' or stringTable[i + k - 1]
+											end
+											break
+										end
+									end
+								end
+							else
+								TableToSave.SetItem[(stringTable[1])] = nil
+							end
+						elseif self.DataTypeTable[DataType] == 'PlayerInfo' then
+							TableToSave.Name, TableToSave.Title = strsplit('_', stringTable[1])
+							TableToSave.Realm = stringTable[2] ~= '' and stringTable[2] ~= E.myrealm and stringTable[2] or nil
+							TableToSave.Level = stringTable[3]
+							TableToSave.Class = stringTable[4]
+							TableToSave.ClassID = stringTable[5]
+							TableToSave.Race = stringTable[6]
+							TableToSave.RaceID = stringTable[7]
+							TableToSave.GenderID = stringTable[8]
+							TableToSave.guildName = stringTable[9]
+							TableToSave.guildRankName = stringTable[10]
+						elseif self.DataTypeTable[DataType] == 'GuildInfo' then
+							TableToSave.guildLevel = stringTable[1]
+							TableToSave.guildNumMembers = stringTable[2]
+
+							for i = 3, #stringTable do
+								TableToSave.guildEmblem = TableToSave.guildEmblem or {}
+								TableToSave.guildEmblem[i - 2] = stringTable[i]
+							end
+						end
+					end
+				end
+
+				if Message == '' then
+					for funcName, func in pairs(self.RegisteredFunction) do
+						func(Sender, TableToSave)
+					end
+
+					Message = nil
+				end
+
+				self.RemainMessage[Sender] = Message
+
+				if NeedResponse then
+					self:SendData(self.PlayerData_ShortString, 'AISM', SenderRealm == playerRealm and 'WHISPER' or nil, Sender)
+				end
+			end
+		end
+	end
+
+	local prefix, message, channel, sender, needUpdate, updateData
+	AISM:SetScript('OnEvent', function(self, Event, ...)
+		if Event == 'PLAYER_LOGIN' then
+			self:GetPlayerCurrentGroupMode()
+			self:GetCurrentInstanceType()
+			isHelmDisplayed = ShowingHelm() == 1
+			isCloakDisplayed = ShowingCloak() == 1
+		elseif Event == 'PLAYER_GUILD_UPDATE' then
+			if IsInGuild() then
+				self.needSendDataGuild = true
+				self:Show()
+				self:UnregisterEvent('PLAYER_GUILD_UPDATE')
+			end
+		elseif Event == 'CHAT_MSG_ADDON' then
+			Prefix, Message, Channel, Sender = ...
+
+			if (Prefix == 'AISM' or Prefix == 'AISM_Inspect') and Sender ~= playerName..'-'..playerRealm then
+				self:Receiver(Prefix, Message, Channel, Sender)
+			elseif not self.Initialize and Prefix == 'AISM' and Message == 'AISM_Initialize' and Sender == playerName..'-'..playerRealm then
+				self.Initialize = true
+
+				if IsInGuild() then
+					self.needSendDataGuild = true
+					self:Show()
+				else
+					self:RegisterEvent('PLAYER_GUILD_UPDATE')
+				end
+
+			end
+		elseif Event == 'PLAYER_LOGOUT' then
+			if IsInGuild() then
+				SendAddonMessage('AISM', 'AISM_GUILD_UnregistME', 'GUILD')
+			end
+
+		elseif Event == 'GROUP_ROSTER_UPDATE' then
+			self:GetPlayerCurrentGroupMode()
+			self:Show()
+		elseif Event == 'PLAYER_ENTERING_WORLD' or Event == 'ZONE_CHANGED_NEW_AREA' then
+			self:GetCurrentInstanceType()
+			self:Show()
+		end
+	end)
+	AISM:RegisterEvent('PLAYER_LOGIN')
+	AISM:RegisterEvent('PLAYER_LOGOUT')
+	AISM:RegisterEvent('CHAT_MSG_ADDON')
+	AISM:RegisterEvent('GROUP_ROSTER_UPDATE')
+	AISM:RegisterEvent('PLAYER_ENTERING_WORLD')
+	AISM:RegisterEvent('ZONE_CHANGED_NEW_AREA')
+
+	function AISM:RegisterInspectDataRequest(Func, funcName, PreserveFunction)
+		if type(Func) == 'function' then
+			funcName = funcName or #self.RegisteredFunction + 1
+
+			self.RegisteredFunction[funcName] = function(User, UserData)
+				if Func(User, UserData) then
+					if not PreserveFunction then
+						self.RegisteredFunction[funcName] = nil
+					end
+				end
+			end
+		end
+	end
+
+	RegisterAddonMessagePrefix('AISM')
+	RegisterAddonMessagePrefix('AISM_Inspect')
+end
\ No newline at end of file
diff --git a/ElvUI_SLE/modules/characterframe/inspectframe.lua b/ElvUI_SLE/modules/characterframe/inspectframe.lua
new file mode 100644
index 0000000..69178d8
--- /dev/null
+++ b/ElvUI_SLE/modules/characterframe/inspectframe.lua
@@ -0,0 +1,1914 @@
+local E, L, V, P, G, _  = unpack(ElvUI)
+local AISM = _G['Armory_InspectSupportModule']
+local IFO = E:NewModule('InspectFrameOptions', 'AceEvent-3.0')
+
+--------------------------------------------------------------------------------
+--<< KnightFrame : Upgrade Inspect Frame like Wow-Armory					>>--
+--------------------------------------------------------------------------------
+local KI = CreateFrame('Frame', 'KnightInspect', E.UIParent)
+local ENI = _G['EnhancedNotifyInspectFrame'] or { ['CancelInspect'] = function() end, }
+local C = SLArmoryConstants
+
+local CoreFrameLevel = 10
+local SLOT_SIZE = 37
+local PANEL_HEIGHT = 22
+local SIDE_BUTTON_WIDTH = 16
+local SPACING = 3
+local INFO_TAB_SIZE = 22
+local TALENT_SLOT_SIZE = 26
+local GLYPH_SLOT_HEIGHT = 22
+
+local HeadSlotItem = 1020
+local BackSlotItem = 102246
+local Default_NotifyInspect
+local Default_InspectUnit
+
+--<< Key Table >>--
+KI.PageList = { ['Character'] = 'CHARACTER', ['Info'] = 'INFO', ['Spec'] = 'TALENTS' }
+KI.InfoPageCategoryList = { 'Profession', 'PvP', 'Guild' }
+KI.ModelList = {
+	['Human'] = { ['RaceID'] = 1, [2] = { ['x'] = 0.02, ['y'] = -0.025, ['z'] = -0.6 }, [3] = { ['x'] = -0.01, ['y'] = -0.08, ['z'] = -0.6 } },
+	['Dwarf'] = { ['RaceID'] = 3, [2] = { ['x'] = -0.01, ['y'] = -0.23, ['z'] = -0.9 }, [3] = { ['x'] = -0.03, ['y'] = -0.15, ['z'] = -0.8 } },
+	['NightElf'] = { ['RaceID'] = 4, [2] = { ['z'] = -0.7 }, [3] = { ['x'] = -0.02, ['y'] = -0.04, ['z'] = -0.7 }},
+	['Gnome'] = { ['RaceID'] = 7, [2] = { ['y'] = -0.2, ['z'] = -1 }, [3] = { ['x'] = -0.01, ['y'] = -0.19, ['z'] = -0.9 } },
+	['Draenei'] = { ['RaceID'] = 11, [2] = { ['x'] = -0.04, ['y'] = -0.08, ['z'] = -0.7 }, [3] = { ['x'] = -0.02, ['y'] = -0.01, ['z'] = -0.6 }},
+	['Worgen'] = { ['RaceID'] = 22, [2] = { ['x'] = -0.09, ['y'] = -0.1, ['z'] = -0.4 }, [3] = { ['x'] = -0.01, ['y'] = 0.01, ['z'] = 0.06 }},
+	['Orc'] = { ['RaceID'] = 2, [2] = { ['y'] = -0.06, ['z'] = -1 }, [3] = { ['x'] = -0.01, ['y'] = -0.05, ['z'] = -0.7 }},
+	['Scourge'] = { ['RaceID'] = 5, [2] = { ['y'] = -0.08, ['z'] = -0.7 }, [3] = { ['y'] = -0.05, ['z'] = -0.6 }},
+	['Tauren'] = { ['RaceID'] = 6, [2] = { ['y'] = -0.09, ['z'] = -0.7 }, [3] = { ['y'] = -0.16, ['z'] = -0.6 } },
+	['Troll'] = { ['RaceID'] = 8, [2] = { ['y'] = -0.14, ['z'] = -1.1 }, [3] = { ['y'] = -0.11, ['z'] = -0.8 }},
+	['BloodElf'] = { ['RaceID'] = 10, [2] = { ['x'] = 0.02, ['y'] = -0.01, ['z'] = -0.5 }, [3] = { ['x'] = 0.04, ['y'] = -0.01, ['z'] = -0.6 }},
+	['Goblin'] = { ['RaceID'] = 9, [2] = { ['y'] = -0.23, ['z'] = -1.3 }, [3] = { ['x'] = -0.01, ['y'] = -0.25, ['z'] = -1.3 } },
+	['Pandaren'] = { ['RaceID'] = 24, [2] = { ['x'] = 0.02, ['y'] = 0.02, ['z'] = -0.6 }, [3] = { ['x'] = 0, ['y'] = -0.05, ['z'] = -1 } },
+}
+KI.CurrentInspectData = {}
+KI.Default_CurrentInspectData = {
+	['Gear'] = {
+		['HeadSlot'] = {}, ['NeckSlot'] = {}, ['ShoulderSlot'] = {}, ['BackSlot'] = {}, ['ChestSlot'] = {},
+		['ShirtSlot'] = {}, ['TabardSlot'] = {}, ['WristSlot'] = {}, ['MainHandSlot'] = {},
+
+		['HandsSlot'] = {}, ['WaistSlot'] = {}, ['LegsSlot'] = {}, ['FeetSlot'] = {}, ['Finger0Slot'] = {},
+		['Finger1Slot'] = {}, ['Trinket0Slot'] = {}, ['Trinket1Slot'] = {}, ['SecondaryHandSlot'] = {}
+	},
+	['SetItem'] = {},
+	['Specialization'] = { [1] = {}, [2] = {} },
+	['Glyph'] = { [1] = {}, [2] = {} },
+	['Profession'] = { [1] = {}, [2] = {} }
+}
+
+local function Button_OnEnter(self)
+	self:SetBackdropBorderColor(unpack(E.media.rgbvaluecolor))
+	self.text:SetText(C.Toolkit.Color_Value(self.buttonString))
+end
+
+local function Button_OnLeave(self)
+	self:SetBackdropBorderColor(unpack(E.media.bordercolor))
+	self.text:SetText(self.buttonString)
+end
+
+function KI:ChangePage(buttonName)
+	for pageType in pairs(self.PageList) do
+		if self[pageType] then
+			if buttonName == pageType..'Button' then
+				self[pageType]:Show()
+			else
+				self[pageType]:Hide()
+			end
+		end
+	end
+
+	self.MainHandSlot:ClearAllPoints()
+	self.SecondaryHandSlot:ClearAllPoints()
+	if buttonName == 'CharacterButton' then
+		for _, slotName in pairs(C.GearList) do
+			self[slotName].ItemLevel:Hide()
+		end
+		self.Model:Point('TOPRIGHT', self.HandsSlot)
+		self.MainHandSlot:Point('BOTTOMRIGHT', self.BP, 'TOP', -2, SPACING)
+		self.SecondaryHandSlot:Point('BOTTOMLEFT', self.BP, 'TOP', 2, SPACING)
+	else
+		for _, slotName in pairs(C.GearList) do
+			self[slotName].ItemLevel:Show()
+		end
+		self.Model:Point('TOPRIGHT', UIParent, 'BOTTOMLEFT')
+		self.MainHandSlot:Point('BOTTOMLEFT', self.BP, 'TOPLEFT', 1, SPACING)
+		self.SecondaryHandSlot:Point('BOTTOMRIGHT', self.BP, 'TOPRIGHT', -1, SPACING)
+	end
+end
+
+KI.EquipmentSlot_OnEnter = function(self)
+	if self.Link then
+		GameTooltip:SetOwner(self, 'ANCHOR_RIGHT')
+		GameTooltip:SetHyperlink(self.Link)
+
+		--ITEM_SOULBOUND
+
+		local CurrentLineText, SetName
+		for i = 1, GameTooltip:NumLines() do
+			CurrentLineText = _G['GameTooltipTextLeft'..i]:GetText()
+
+			SetName = CurrentLineText:match('^(.+) %((%d)/(%d)%)$')
+
+			if SetName then
+				local SetCount = 0
+
+				if type(KI.SetItem[SetName]) == 'table' then
+					for dataType, Data in pairs(KI.SetItem[SetName]) do
+						if type(dataType) == 'string' then -- Means SetOption Data
+							local CurrentLineNum = i + #KI.SetItem[SetName] + 1 + dataType:match('^.+(%d)$')
+							local CurrentText = _G['GameTooltipTextLeft'..CurrentLineNum]:GetText()
+							local CurrentTextType = CurrentText:match("^%((%d)%)%s.+:%s.+$") or true
+
+							if Data ~= CurrentTextType then
+								if Data == true and CurrentTextType ~= true then
+									_G['GameTooltipTextLeft'..CurrentLineNum]:SetText(GREEN_FONT_COLOR_CODE..(strsub(CurrentText, (strlen(CurrentTextType) + 4))))
+								else
+									_G['GameTooltipTextLeft'..CurrentLineNum]:SetText(GRAY_FONT_COLOR_CODE..'('..Data..') '..CurrentText)
+								end
+							end
+						else
+							if Data:find(LIGHTYELLOW_FONT_COLOR_CODE) then
+								SetCount = SetCount + 1
+							end
+
+							_G['GameTooltipTextLeft'..(i + dataType)]:SetText(Data)
+						end
+					end
+
+					_G['GameTooltipTextLeft'..i]:SetText(string.gsub(CurrentLineText, ' %(%d/', ' %('..SetCount..'/', 1))
+				end
+
+				break
+			end
+		end
+
+		GameTooltip:Show()
+	end
+end
+
+KI.ScrollFrame_OnMouseWheel = function(self, spinning)
+	local Page = self:GetScrollChild()
+	local PageHeight = Page:GetHeight()
+	local WindowHeight = self:GetHeight()
+
+	self.Offset = self.Offset or 0
+
+	if PageHeight > WindowHeight then
+		self.Offset = self.Offset - spinning * 5
+
+		Page:ClearAllPoints()
+		if self.Offset > PageHeight - WindowHeight then
+			self.Offset = PageHeight - WindowHeight
+
+			Page:Point('BOTTOMLEFT', self)
+			Page:Point('BOTTOMRIGHT', self)
+			return
+		elseif self.Offset < 0 then
+			self.Offset = 0
+		end
+	else
+		self.Offset = 0
+	end
+
+	Page:Point('TOPLEFT', self, 0, self.Offset)
+	Page:Point('TOPRIGHT', self, 0, self.Offset)
+end
+
+KI.Category_OnClick = function(self)
+	self = self:GetParent()
+	self.Closed = not self.Closed
+
+	KI:ReArrangeCategory()
+end
+
+KI.GemSocket_OnEnter = function(self)
+	GameTooltip:SetOwner(self, 'ANCHOR_RIGHT')
+
+	self = self:GetParent()
+
+	if self.GemItemID then
+		if type(self.GemItemID) == 'number' then
+			GameTooltip:SetHyperlink(select(2, GetItemInfo(self.GemItemID)))
+		else
+			GameTooltip:ClearLines()
+			GameTooltip:AddLine(self.GemItemID)
+		end
+	elseif self.GemType then
+		GameTooltip:ClearLines()
+		GameTooltip:AddLine(_G['EMPTY_SOCKET_'..self.GemType])
+	end
+
+	GameTooltip:Show()
+end
+
+KI.GemSocket_OnClick = function(self, button)
+	self = self:GetParent()
+
+	if self.GemItemID and type(self.GemItemID) == 'number' then
+		local itemName, itemLink = GetItemInfo(self.GemItemID)
+
+		if not IsShiftKeyDown() then
+			SetItemRef(itemLink, itemLink, 'LeftButton')
+		else
+			if HandleModifiedItemClick(itemLink) then
+			elseif BrowseName and BrowseName:IsVisible() then
+				AuctionFrameBrowse_Reset(BrowseResetButton)
+				BrowseName:SetText(itemName)
+				BrowseName:SetFocus()
+			end
+		end
+	end
+end
+
+KI.OnClick = function(self)
+	if self.Link then
+		if HandleModifiedItemClick(self.Link) then
+		elseif self.EnableAuctionSearch and BrowseName and BrowseName:IsVisible() then
+			AuctionFrameBrowse_Reset(BrowseResetButton)
+			BrowseName:SetText(self:GetParent().text:GetText())
+			BrowseName:SetFocus()
+		end
+	end
+end
+
+function KI:CreateInspectFrame()
+	do --<< Core >>--
+		self:Size(450, 480)
+		self:CreateBackdrop('Transparent')
+		self:SetFrameStrata('DIALOG')
+		self:SetFrameLevel(CoreFrameLevel)
+		self:SetMovable(true)
+		self:SetClampedToScreen(true)
+		self:SetScript('OnHide', function()
+			PlaySound('igCharacterInfoClose')
+
+			if self.CurrentInspectData.Name then
+				local TableIndex = self.CurrentInspectData.Name..(KI.CurrentInspectData.Realm and '-'..KI.CurrentInspectData.Realm or '')
+				if AISM then
+					if self.LastDataSetting then
+						AISM.RegisteredFunction[TableIndex] = nil
+					end
+				end
+
+				ENI.CancelInspect(TableIndex)
+				KI:UnregisterEvent('INSPECT_READY', 'KnightInspect')
+			end
+
+			self.LastDataSetting = nil
+			self.Model:Point('TOPRIGHT', UIParent, 'BOTTOMLEFT')
+		end)
+		self:SetScript('OnShow', function() self.Model:Point('TOPRIGHT', self.HandsSlot) end)
+		self:SetScript('OnEvent', function(self, Event, ...) if self[Event] then self[Event](...) end end)
+		UIPanelWindows['KnightInspect'] = { area = 'left', pushable = 1, }
+	end
+
+	do --<< Tab >>--
+		self.Tab = CreateFrame('Frame', nil, self)
+		self.Tab:Point('TOPLEFT', self, SPACING, -SPACING)
+		self.Tab:Point('BOTTOMRIGHT', self, 'TOPRIGHT', -SPACING, -(SPACING + PANEL_HEIGHT))
+		self.Tab:SetBackdrop({
+			bgFile = E.media.normTex,
+			edgeFile = E.media.blankTex,
+			tile = false, tileSize = 0, edgeSize = E.mult,
+			insets = { left = 0, right = 0, top = 0, bottom = 0}
+		})
+		self.Tab:SetBackdropBorderColor(unpack(E.media.bordercolor))
+		C.Toolkit.TextSetting(self.Tab, ' |cff2eb7e4Knight Inspect', { ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE', }, 'LEFT', 6, 1)
+		self.Tab:SetScript('OnMouseDown', function() self:StartMoving() end)
+		self.Tab:SetScript('OnMouseUp', function() self:StopMovingOrSizing() end)
+	end
+
+	do --<< Close Button >>--
+		self.Close = CreateFrame('Button', nil, self.Tab)
+		self.Close:Size(PANEL_HEIGHT - 8)
+		self.Close:SetTemplate()
+		self.Close.backdropTexture:SetVertexColor(0.1, 0.1, 0.1)
+		self.Close:Point('RIGHT', -4, 0)
+		C.Toolkit.TextSetting(self.Close, 'X', { ['FontSize'] = 13, }, 'CENTER', 1, 0)
+		self.Close:SetScript('OnEnter', Button_OnEnter)
+		self.Close:SetScript('OnLeave', Button_OnLeave)
+		self.Close:SetScript('OnClick', function() HideUIPanel(self) end)
+		self.Close.buttonString = 'X'
+	end
+
+	do --<< Bottom Panel >>--
+		self.BP = CreateFrame('Frame', nil, self)
+		self.BP:Point('TOPLEFT', self, 'BOTTOMLEFT', SPACING, SPACING + PANEL_HEIGHT)
+		self.BP:Point('BOTTOMRIGHT', self, -SPACING, SPACING)
+		self.BP:SetBackdrop({
+			bgFile = E.media.normTex,
+			edgeFile = E.media.blankTex,
+			tile = false, tileSize = 0, edgeSize = E.mult,
+			insets = { left = 0, right = 0, top = 0, bottom = 0}
+		})
+		self.BP:SetBackdropColor(0.09, 0.3, 0.45)
+		self.BP:SetBackdropBorderColor(unpack(E.media.bordercolor))
+		self.BP:SetFrameLevel(CoreFrameLevel + 2)
+		C.Toolkit.TextSetting(self.BP, '', { ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE', }, 'LEFT', 4, 1)
+		self.Message = self.BP.text
+	end
+
+	do --<< Background >>--
+		self.BG = self:CreateTexture(nil, 'OVERLAY')
+		self.BG:Point('TOPLEFT', self.Tab, 'BOTTOMLEFT', 0, -38)
+		self.BG:Point('BOTTOMRIGHT', self.BP, 'TOPRIGHT')
+		self.BG:SetTexture('Interface\\AddOns\\ElvUI_SLE\\Media\\textures\\Space')
+	end
+
+	do --<< Buttons >>--
+		for buttonName, buttonString in pairs(self.PageList) do
+			buttonName = buttonName..'Button'
+
+			self[buttonName] = CreateFrame('Button', nil, self.BP)
+			self[buttonName]:Size(70, 20)
+			self[buttonName]:SetBackdrop({
+				bgFile = E.media.normTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self[buttonName]:SetBackdropBorderColor(unpack(E.media.bordercolor))
+			self[buttonName]:SetFrameLevel(CoreFrameLevel + 1)
+			C.Toolkit.TextSetting(self[buttonName], _G[buttonString], { ['FontSize'] = 9, ['FontOutline'] = 'OUTLINE' })
+			self[buttonName]:SetScript('OnEnter', Button_OnEnter)
+			self[buttonName]:SetScript('OnLeave', Button_OnLeave)
+			self[buttonName]:SetScript('OnClick', function() KI:ChangePage(buttonName) end)
+			self[buttonName]['buttonString'] = _G[buttonString]
+		end
+		self.CharacterButton:Point('TOPLEFT', self.BP, 'BOTTOMLEFT', SPACING + 1, 2)
+		self.InfoButton:Point('TOPLEFT', self.CharacterButton, 'TOPRIGHT', SPACING, 0)
+		self.SpecButton:Point('TOPLEFT', self.InfoButton, 'TOPRIGHT', SPACING, 0)
+	end
+
+	do --<< Bookmark Star >>--
+		self.Bookmark = CreateFrame('CheckButton', nil, self)
+		self.Bookmark:Size(24)
+		self.Bookmark:EnableMouse(true)
+		self.Bookmark.NormalTexture = self.Bookmark:CreateTexture(nil, 'OVERLAY')
+		self.Bookmark.NormalTexture:SetTexCoord(0.5, 1, 0, 0.5)
+		self.Bookmark.NormalTexture:SetTexture('Interface\\Common\\ReputationStar.tga')
+		self.Bookmark.NormalTexture:SetInside()
+		self.Bookmark:SetNormalTexture(self.Bookmark.NormalTexture)
+		self.Bookmark.HighlightTexture = self.Bookmark:CreateTexture(nil, 'OVERLAY')
+		self.Bookmark.HighlightTexture:SetTexCoord(0, 0.5, 0.5, 1)
+		self.Bookmark.HighlightTexture:SetTexture('Interface\\Common\\ReputationStar.tga')
+		self.Bookmark.HighlightTexture:SetInside()
+		self.Bookmark:SetHighlightTexture(self.Bookmark.HighlightTexture)
+		self.Bookmark.CheckedTexture = self.Bookmark:CreateTexture(nil, 'OVERLAY')
+		self.Bookmark.CheckedTexture:SetTexCoord(0, 0.5, 0, 0.5)
+		self.Bookmark.CheckedTexture:SetTexture('Interface\\Common\\ReputationStar.tga')
+		self.Bookmark.CheckedTexture:SetInside()
+		self.Bookmark:SetCheckedTexture(self.Bookmark.CheckedTexture)
+		self.Bookmark:Point('LEFT', self.Tab, 'BOTTOMLEFT', 7, -35)
+	end
+
+	do --<< Texts >>--
+		C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'Name', ['FontSize'] = 22, ['FontOutline'] = 'OUTLINE', }, 'LEFT', self.Bookmark, 'RIGHT', 9, 0)
+		C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'Title', ['FontSize'] = 9, ['FontOutline'] = 'OUTLINE', }, 'BOTTOMLEFT', self.Name, 'TOPLEFT', 2, 5)
+		C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'LevelRace', ['FontSize'] = 10, ['directionH'] = 'LEFT', }, 'BOTTOMLEFT', self.Name, 'BOTTOMRIGHT', 5, 2)
+		C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'Guild', ['FontSize'] = 10, ['directionH'] = 'LEFT', }, 'TOPLEFT', self.Name, 'BOTTOMLEFT', 4, -5)
+		self.Guild:Point('RIGHT', self, -44, 0)
+	end
+
+	do --<< Class, Specialization Icon >>--
+		for _, frameName in pairs({ 'SpecIcon', 'ClassIcon', }) do
+			self[frameName..'Slot'] = CreateFrame('Frame', nil, self)
+			self[frameName..'Slot']:Size(24)
+			self[frameName..'Slot']:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self[frameName] = self[frameName..'Slot']:CreateTexture(nil, 'OVERLAY')
+			self[frameName]:SetTexCoord(unpack(E.TexCoords))
+			self[frameName]:SetInside()
+		end
+		self.ClassIconSlot:Point('RIGHT', self.Tab, 'BOTTOMRIGHT', -44, -35)
+		self.SpecIconSlot:Point('RIGHT', self.ClassIconSlot, 'LEFT', -SPACING, 0)
+	end
+
+	do --<< Player Model >>--
+		self.Model = CreateFrame('DressUpModel', nil, UIParent)
+		self.Model:SetFrameStrata('DIALOG')
+		self.Model:SetFrameLevel(CoreFrameLevel + 1)
+		self.Model:EnableMouse(1)
+		self.Model:EnableMouseWheel(1)
+		self.Model:SetUnit('player')
+		self.Model:TryOn(HeadSlotItem)
+		self.Model:TryOn(BackSlotItem)
+		self.Model:Undress()
+		self.Model:SetScript('OnMouseDown', function(self, button)
+			self.startx, self.starty = GetCursorPosition()
+
+			local endx, endy, z, x, y
+			if button == 'LeftButton' then
+				KI.Model:SetScript('OnUpdate', function(self)
+					endx, endy = GetCursorPosition()
+
+					self.rotation = (endx - self.startx) / 34 + self:GetFacing()
+					self:SetFacing(self.rotation)
+					self.startx, self.starty = GetCursorPosition()
+				end)
+			elseif button == 'RightButton' then
+				KI.Model:SetScript('OnUpdate', function(self)
+					endx, endy = GetCursorPosition()
+
+					z, x, y = self:GetPosition(z, x, y)
+					x = (endx - self.startx) / 45 + x
+					y = (endy - self.starty) / 45 + y
+
+					self:SetPosition(z, x, y)
+					self.startx, self.starty = GetCursorPosition()
+				end)
+			end
+		end)
+		self.Model:SetScript('OnMouseUp', function(self)
+			self:SetScript('OnUpdate', nil)
+		end)
+		self.Model:SetScript('OnMouseWheel', function(self, spining)
+			local z, x, y = self:GetPosition()
+
+			z = (spining > 0 and z + 0.1 or z - 0.1)
+
+			self:SetPosition(z, x, y)
+		end)
+	end
+
+	do --<< Equipment Slots >>--
+		self.Character = CreateFrame('Frame', nil, self)
+
+		local Slot
+		for i, slotName in pairs(C.GearList) do
+			-- Slot
+			Slot = CreateFrame('Button', nil, self)
+			Slot:Size(SLOT_SIZE)
+			Slot:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			Slot:SetFrameLevel(CoreFrameLevel + 3)
+			Slot:SetScript('OnEnter', self.EquipmentSlot_OnEnter)
+			Slot:SetScript('OnLeave', C.CommonScript.OnLeave)
+			Slot:SetScript('OnClick', self.OnClick)
+			C.Toolkit.TextSetting(Slot, '', { ['FontSize'] = 12, ['FontOutline'] = 'OUTLINE' })
+
+			Slot.SlotName = slotName
+			Slot.Direction = i%2 == 1 and 'LEFT' or 'RIGHT'
+			Slot.ID, Slot.EmptyTexture = GetInventorySlotInfo(slotName)
+
+			Slot.Texture = Slot:CreateTexture(nil, 'OVERLAY')
+			Slot.Texture:SetTexCoord(unpack(E.TexCoords))
+			Slot.Texture:SetInside()
+			Slot.Texture:SetTexture(Slot.EmptyTexture)
+
+			Slot.Highlight = Slot:CreateTexture('Frame', nil, self)
+			Slot.Highlight:SetInside()
+			Slot.Highlight:SetTexture(1, 1, 1, 0.3)
+			Slot:SetHighlightTexture(Slot.Highlight)
+
+			C.Toolkit.TextSetting(Slot, nil, { ['Tag'] = 'ItemLevel', ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE', }, 'TOP', Slot, 0, -3)
+
+			-- Gradation
+			Slot.Gradation = CreateFrame('Frame', nil, self.Character)
+			Slot.Gradation:Size(130, SLOT_SIZE + 4)
+			Slot.Gradation:Point(Slot.Direction, Slot, Slot.Direction == 'LEFT' and -1 or 1, 0)
+			Slot.Gradation:SetFrameLevel(CoreFrameLevel + 2)
+			Slot.Gradation.Texture = Slot.Gradation:CreateTexture(nil, 'OVERLAY')
+			Slot.Gradation.Texture:SetInside()
+			Slot.Gradation.Texture:SetTexture('Interface\\AddOns\\ElvUI_SLE\\media\\textures\\Gradation')
+			if Slot.Direction == 'LEFT' then
+				Slot.Gradation.Texture:SetTexCoord(0, .5, 0, .5)
+			else
+				Slot.Gradation.Texture:SetTexCoord(.5, 1, 0, .5)
+			end
+
+			if not (slotName == 'ShirtSlot' or slotName == 'TabardSlot') then
+				-- Item Level
+				C.Toolkit.TextSetting(Slot.Gradation, nil, { ['Tag'] = 'ItemLevel', ['FontSize'] = 10, ['directionH'] = Slot.Direction, }, 'TOP'..Slot.Direction, Slot, 'TOP'..(Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT'), Slot.Direction == 'LEFT' and 2 or -2, -1)
+
+				-- Enchantment
+				C.Toolkit.TextSetting(Slot.Gradation, nil, { ['Tag'] = 'ItemEnchant', ['FontSize'] = 8, ['directionH'] = Slot.Direction, }, Slot.Direction, Slot, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 2 or -2, 2)
+				Slot.EnchantWarning = CreateFrame('Button', nil, Slot.Gradation)
+				Slot.EnchantWarning:Size(12)
+				Slot.EnchantWarning.Texture = Slot.EnchantWarning:CreateTexture(nil, 'OVERLAY')
+				Slot.EnchantWarning.Texture:SetInside()
+				Slot.EnchantWarning.Texture:SetTexture('Interface\\AddOns\\ElvUI_SLE\\media\\textures\\Warning-Small')
+				Slot.EnchantWarning:Point(Slot.Direction, Slot.Gradation.ItemEnchant, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 3 or -3, 0)
+				Slot.EnchantWarning:SetScript('OnEnter', C.CommonScript.OnEnter)
+				Slot.EnchantWarning:SetScript('OnLeave', C.CommonScript.OnLeave)
+
+				-- Gem Socket
+				for i = 1, MAX_NUM_SOCKETS do
+					Slot['Socket'..i] = CreateFrame('Frame', nil, Slot.Gradation)
+					Slot['Socket'..i]:Size(12)
+					Slot['Socket'..i]:SetBackdrop({
+						bgFile = E.media.blankTex,
+						edgeFile = E.media.blankTex,
+						tile = false, tileSize = 0, edgeSize = E.mult,
+						insets = { left = 0, right = 0, top = 0, bottom = 0}
+					})
+					Slot['Socket'..i]:SetBackdropColor(0, 0, 0, 1)
+					Slot['Socket'..i]:SetBackdropBorderColor(0, 0, 0)
+					Slot['Socket'..i]:SetFrameLevel(CoreFrameLevel + 3)
+
+					Slot['Socket'..i].Socket = CreateFrame('Button', nil, Slot['Socket'..i])
+					Slot['Socket'..i].Socket:SetBackdrop({
+						bgFile = E.media.blankTex,
+						edgeFile = E.media.blankTex,
+						tile = false, tileSize = 0, edgeSize = E.mult,
+						insets = { left = 0, right = 0, top = 0, bottom = 0}
+					})
+					Slot['Socket'..i].Socket:SetInside()
+					Slot['Socket'..i].Socket:SetFrameLevel(CoreFrameLevel + 4)
+					Slot['Socket'..i].Socket:SetScript('OnEnter', C.CommonScript.GemSocket_OnEnter)
+					Slot['Socket'..i].Socket:SetScript('OnLeave', C.CommonScript.OnLeave)
+					Slot['Socket'..i].Socket:SetScript('OnClick', self.GemSocket_OnClick)
+
+					Slot['Socket'..i].Texture = Slot['Socket'..i].Socket:CreateTexture(nil, 'OVERLAY')
+					Slot['Socket'..i].Texture:SetTexCoord(.1, .9, .1, .9)
+					Slot['Socket'..i].Texture:SetInside()
+				end
+				Slot.Socket1:Point('BOTTOM'..Slot.Direction, Slot, 'BOTTOM'..(Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT'), Slot.Direction == 'LEFT' and 3 or -3, 2)
+				Slot.Socket2:Point(Slot.Direction, Slot.Socket1, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 1 or -1, 0)
+				Slot.Socket3:Point(Slot.Direction, Slot.Socket2, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 1 or -1, 0)
+
+				Slot.SocketWarning = CreateFrame('Button', nil, Slot.Gradation)
+				Slot.SocketWarning:Size(12)
+				Slot.SocketWarning.Texture = Slot.SocketWarning:CreateTexture(nil, 'OVERLAY')
+				Slot.SocketWarning.Texture:SetInside()
+				Slot.SocketWarning.Texture:SetTexture('Interface\\AddOns\\ElvUI_SLE\\media\\textures\\Warning-Small')
+				Slot.SocketWarning:SetScript('OnEnter', C.CommonScript.OnEnter)
+				Slot.SocketWarning:SetScript('OnLeave', C.CommonScript.OnLeave)
+			end
+
+			self[slotName] = Slot
+		end
+
+		-- Slot Location : Left
+		self.HeadSlot:Point('BOTTOMLEFT', self.NeckSlot, 'TOPLEFT', 0, SPACING)
+		self.NeckSlot:Point('BOTTOMLEFT', self.ShoulderSlot, 'TOPLEFT', 0, SPACING)
+		self.ShoulderSlot:Point('BOTTOMLEFT', self.BackSlot, 'TOPLEFT', 0, SPACING)
+		self.BackSlot:Point('BOTTOMLEFT', self.ChestSlot, 'TOPLEFT', 0, SPACING)
+		self.ChestSlot:Point('BOTTOMLEFT', self.ShirtSlot, 'TOPLEFT', 0, SPACING)
+		self.ShirtSlot:Point('BOTTOMLEFT', self.TabardSlot, 'TOPLEFT', 0, SPACING)
+		self.TabardSlot:Point('BOTTOMLEFT', self.WristSlot, 'TOPLEFT', 0, SPACING)
+		self.WristSlot:Point('LEFT', self.BP, 1, 0)
+		self.WristSlot:Point('BOTTOM', self.MainHandSlot, 'TOP', 0, SPACING)
+
+		-- Slot Location : Right
+		self.HandsSlot:Point('BOTTOMRIGHT', self.WaistSlot, 'TOPRIGHT', 0, SPACING)
+		self.WaistSlot:Point('BOTTOMRIGHT', self.LegsSlot, 'TOPRIGHT', 0, SPACING)
+		self.LegsSlot:Point('BOTTOMRIGHT', self.FeetSlot, 'TOPRIGHT', 0, SPACING)
+		self.FeetSlot:Point('BOTTOMRIGHT', self.Finger0Slot, 'TOPRIGHT', 0, SPACING)
+		self.Finger0Slot:Point('BOTTOMRIGHT', self.Finger1Slot, 'TOPRIGHT', 0, SPACING)
+		self.Finger1Slot:Point('BOTTOMRIGHT', self.Trinket0Slot, 'TOPRIGHT', 0, SPACING)
+		self.Trinket0Slot:Point('BOTTOMRIGHT', self.Trinket1Slot, 'TOPRIGHT', 0, SPACING)
+		self.Trinket1Slot:Point('RIGHT', self.BP, -1, 0)
+		self.Trinket1Slot:Point('BOTTOM', self.SecondaryHandSlot, 'TOP', 0, SPACING)
+
+		-- ItemLevel
+		C.Toolkit.TextSetting(self.Character, nil, { ['Tag'] = 'AverageItemLevel', ['FontSize'] = 12, }, 'TOP', self.Model)
+	end
+
+	self.Model:Point('TOPLEFT', self.HeadSlot)
+	self.Model:Point('BOTTOM', self.BP, 'TOP', 0, SPACING)
+
+	do --<< Information Page >>--
+		self.Info = CreateFrame('ScrollFrame', nil, self)
+		self.Info:SetFrameLevel(CoreFrameLevel + 4)
+		self.Info:EnableMouseWheel(1)
+		self.Info:SetScript('OnMouseWheel', self.ScrollFrame_OnMouseWheel)
+
+		self.Info.BG = CreateFrame('Frame', nil, self.Info)
+		self.Info.BG:SetFrameLevel(CoreFrameLevel + 1)
+		self.Info.BG:Point('TOPLEFT', self.HeadSlot, 'TOPRIGHT', SPACING, 0)
+		self.Info.BG:Point('RIGHT', self.Trinket1Slot, 'BOTTOMLEFT', -SPACING, 0)
+		self.Info.BG:Point('BOTTOM', self.BP, 'TOP', 0, SPACING)
+		self.Info.BG:SetBackdrop({
+			bgFile = E.media.blankTex,
+			edgeFile = E.media.blankTex,
+			tile = false, tileSize = 0, edgeSize = E.mult,
+			insets = { left = 0, right = 0, top = 0, bottom = 0}
+		})
+		self.Info.BG:SetBackdropColor(0, 0, 0, .7)
+
+		self.Info:Point('TOPLEFT', self.Info.BG, 4, -7)
+		self.Info:Point('BOTTOMRIGHT', self.Info.BG, -4, 7)
+
+		self.Info.Page = CreateFrame('Frame', nil, self.Info)
+		self.Info:SetScrollChild(self.Info.Page)
+		self.Info.Page:SetFrameLevel(CoreFrameLevel + 2)
+		self.Info.Page:Point('TOPLEFT', self.Info)
+		self.Info.Page:Point('TOPRIGHT', self.Info, -1, 0)
+
+		for _, CategoryType in pairs(KI.InfoPageCategoryList) do
+			self.Info[CategoryType] = CreateFrame('ScrollFrame', nil, self.Info.Page)
+			self.Info[CategoryType]:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self.Info[CategoryType]:SetBackdropColor(.08, .08, .08, .8)
+			self.Info[CategoryType]:SetBackdropBorderColor(0, 0, 0)
+			self.Info[CategoryType]:Point('LEFT', self.Info.Page)
+			self.Info[CategoryType]:Point('RIGHT', self.Info.Page)
+			self.Info[CategoryType]:Height(INFO_TAB_SIZE + SPACING * 2)
+
+			self.Info[CategoryType].IconSlot = CreateFrame('Frame', nil, self.Info[CategoryType])
+			self.Info[CategoryType].IconSlot:Size(INFO_TAB_SIZE)
+			self.Info[CategoryType].IconSlot:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self.Info[CategoryType].IconSlot:Point('TOPLEFT', self.Info[CategoryType], SPACING, -SPACING)
+			self.Info[CategoryType].Icon = self.Info[CategoryType].IconSlot:CreateTexture(nil, 'OVERLAY')
+			self.Info[CategoryType].Icon:SetTexCoord(unpack(E.TexCoords))
+			self.Info[CategoryType].Icon:SetInside()
+
+			self.Info[CategoryType].Tab = CreateFrame('Frame', nil, self.Info[CategoryType])
+			self.Info[CategoryType].Tab:Point('TOPLEFT', self.Info[CategoryType].IconSlot, 'TOPRIGHT', 1, 0)
+			self.Info[CategoryType].Tab:Point('BOTTOMRIGHT', self.Info[CategoryType], 'TOPRIGHT', -SPACING, -(SPACING + INFO_TAB_SIZE))
+			self.Info[CategoryType].Tab:SetBackdrop({
+				bgFile = E.media.normTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+
+			self.Info[CategoryType].Tooltip = CreateFrame('Button', nil, self.Info[CategoryType])
+			self.Info[CategoryType].Tooltip:Point('TOPLEFT', self.Info[CategoryType].Icon)
+			self.Info[CategoryType].Tooltip:Point('BOTTOMRIGHT', self.Info[CategoryType].Tab)
+			self.Info[CategoryType].Tooltip:SetFrameLevel(CoreFrameLevel + 4)
+			self.Info[CategoryType].Tooltip:SetScript('OnClick', KI.Category_OnClick)
+
+			C.Toolkit.TextSetting(self.Info[CategoryType].Tab, CategoryType, { ['FontSize'] = 10 }, 'LEFT', 6, 1)
+
+			self.Info[CategoryType].Page = CreateFrame('Frame', nil, self.Info[CategoryType])
+			self.Info[CategoryType]:SetScrollChild(self.Info[CategoryType].Page)
+			self.Info[CategoryType].Page:SetFrameLevel(CoreFrameLevel + 2)
+			self.Info[CategoryType].Page:Point('TOPLEFT', self.Info[CategoryType].Icon, 'BOTTOMLEFT', 0, -SPACING)
+			self.Info[CategoryType].Page:Point('BOTTOMRIGHT', self.Info[CategoryType], -SPACING, SPACING)
+		end
+
+		do -- Profession Part
+			self.Info.Profession.CategoryHeight = INFO_TAB_SIZE + 34 + SPACING * 3
+			self.Info.Profession.Icon:SetTexture(GetSpellTexture(110396))
+
+			for i = 1, 2 do
+				self.Info.Profession['Prof'..i] = CreateFrame('Frame', nil, self.Info.Profession.Page)
+				self.Info.Profession['Prof'..i]:Size(20)
+				self.Info.Profession['Prof'..i]:SetBackdrop({
+					bgFile = E.media.blankTex,
+					edgeFile = E.media.blankTex,
+					tile = false, tileSize = 0, edgeSize = E.mult,
+					insets = { left = 0, right = 0, top = 0, bottom = 0}
+				})
+				self.Info.Profession['Prof'..i]:SetBackdropBorderColor(0, 0, 0)
+
+				self.Info.Profession['Prof'..i].Icon = self.Info.Profession['Prof'..i]:CreateTexture(nil, 'OVERLAY')
+				self.Info.Profession['Prof'..i].Icon:SetTexCoord(unpack(E.TexCoords))
+				self.Info.Profession['Prof'..i].Icon:SetInside()
+				self.Info.Profession['Prof'..i].Icon:SetTexture(GetSpellTexture(110396))
+
+				self.Info.Profession['Prof'..i].BarFrame = CreateFrame('Frame', nil, self.Info.Profession['Prof'..i])
+				self.Info.Profession['Prof'..i].BarFrame:Size(136, 5)
+				self.Info.Profession['Prof'..i].BarFrame:SetBackdrop({
+					bgFile = E.media.blankTex,
+					edgeFile = E.media.blankTex,
+					tile = false, tileSize = 0, edgeSize = E.mult,
+					insets = { left = 0, right = 0, top = 0, bottom = 0}
+				})
+				self.Info.Profession['Prof'..i].BarFrame:SetBackdropColor(0, 0, 0)
+				self.Info.Profession['Prof'..i].BarFrame:SetBackdropBorderColor(0, 0, 0)
+				self.Info.Profession['Prof'..i].BarFrame:Point('BOTTOMLEFT', self.Info.Profession['Prof'..i], 'BOTTOMRIGHT', SPACING, 0)
+
+				self.Info.Profession['Prof'..i].Bar = CreateFrame('StatusBar', nil, self.Info.Profession['Prof'..i].BarFrame)
+				self.Info.Profession['Prof'..i].Bar:SetInside()
+				self.Info.Profession['Prof'..i].Bar:SetStatusBarTexture(E.media.normTex)
+				self.Info.Profession['Prof'..i].Bar:SetMinMaxValues(0, 600)
+
+				C.Toolkit.TextSetting(self.Info.Profession['Prof'..i], '257', { ['Tag'] = 'Level', ['FontSize'] = 10 }, 'TOP', self.Info.Profession['Prof'..i].Icon)
+				self.Info.Profession['Prof'..i].Level:Point('RIGHT', self.Info.Profession['Prof'..i].Bar)
+
+				C.Toolkit.TextSetting(self.Info.Profession['Prof'..i], 'JewelCrafting', { ['Tag'] = 'Name', ['FontSize'] = 10, ['directionH'] = 'LEFT' }, 'TOP', self.Info.Profession['Prof'..i].Icon)
+				self.Info.Profession['Prof'..i].Name:Point('LEFT', self.Info.Profession['Prof'..i].Bar)
+				self.Info.Profession['Prof'..i].Name:Point('RIGHT', self.Info.Profession['Prof'..i].Level, 'LEFT', -SPACING, 0)
+			end
+
+			self.Info.Profession.Prof1:Point('TOPLEFT', self.Info.Profession.Page, 6, -8)
+			self.Info.Profession.Prof2:Point('TOPLEFT', self.Info.Profession.Page, 'TOP', 6, -8)
+		end
+
+		do -- PvP Category
+			self.Info.PvP.CategoryHeight = 100
+			self.Info.PvP.Icon:SetTexture('Interface\\Icons\\achievement_bg_killxenemies_generalsroom')
+		end
+
+		do -- Guild Category
+			self.Info.Guild.CategoryHeight = INFO_TAB_SIZE + 66 + SPACING * 3
+			self.Info.Guild.Icon:SetTexture(GetSpellTexture(83968))
+
+			self.Info.Guild.Banner = CreateFrame('Frame', nil, self.Info.Guild.Page)
+			self.Info.Guild.Banner:SetInside()
+			self.Info.Guild.Banner:SetFrameLevel(CoreFrameLevel + 3)
+
+			self.Info.Guild.BG = self.Info.Guild.Banner:CreateTexture(nil, 'BACKGROUND')
+			self.Info.Guild.BG:Size(33, 44)
+			self.Info.Guild.BG:SetTexCoord(.00781250, .32812500, .01562500, .84375000)
+			self.Info.Guild.BG:SetTexture('Interface\\GuildFrame\\GuildDifficulty')
+			self.Info.Guild.BG:Point('TOP', self.Info.Guild.Page, 0, -1)
+
+			self.Info.Guild.Border = self.Info.Guild.Banner:CreateTexture(nil, 'ARTWORK')
+			self.Info.Guild.Border:Size(33, 44)
+			self.Info.Guild.Border:SetTexCoord(.34375000, .66406250, .01562500, .84375000)
+			self.Info.Guild.Border:SetTexture('Interface\\GuildFrame\\GuildDifficulty')
+			self.Info.Guild.Border:Point('CENTER', self.Info.Guild.BG)
+
+			self.Info.Guild.Emblem = self.Info.Guild.Banner:CreateTexture(nil, 'OVERLAY')
+			self.Info.Guild.Emblem:Size(16)
+			self.Info.Guild.Emblem:SetTexture('Interface\\GuildFrame\\GuildEmblems_01')
+			self.Info.Guild.Emblem:Point('CENTER', self.Info.Guild.BG, 0, 2)
+
+			C.Toolkit.TextSetting(self.Info.Guild.Banner, nil, { ['Tag'] = 'Name', ['FontSize'] = 14 }, 'TOP', self.Info.Guild.BG, 'BOTTOM', 0, 7)
+			C.Toolkit.TextSetting(self.Info.Guild.Banner, nil, { ['Tag'] = 'LevelMembers', ['FontSize'] = 9 }, 'TOP', self.Info.Guild.Banner.Name, 'BOTTOM', 0, -2)
+		end
+	end
+
+	do --<< Specialization Page >>--
+		self.Spec = CreateFrame('ScrollFrame', nil, self)
+		self.Spec:SetFrameLevel(CoreFrameLevel + 5)
+		self.Spec:EnableMouseWheel(1)
+		self.Spec:SetScript('OnMouseWheel', self.ScrollFrame_OnMouseWheel)
+
+		self.Spec.BGFrame = CreateFrame('Frame', nil, self.Spec)
+		self.Spec.BGFrame:SetFrameLevel(CoreFrameLevel + 1)
+		self.Spec.BG = self.Spec.BGFrame:CreateTexture(nil, 'BACKGROUND')
+		self.Spec.BG:Point('TOP', self.HeadSlot, 'TOPRIGHT', 0, -30)
+		self.Spec.BG:Point('LEFT', self.WristSlot, 'TOPRIGHT', SPACING, 0)
+		self.Spec.BG:Point('RIGHT', self.Trinket1Slot, 'BOTTOMLEFT', -SPACING, 0)
+		self.Spec.BG:Point('BOTTOM', self.BP, 'TOP', 0, SPACING)
+		self.Spec.BG:SetTexture(0, 0, 0, .7)
+
+		self.Spec:Point('TOPLEFT', self.Spec.BG, 4, -7)
+		self.Spec:Point('BOTTOMRIGHT', self.Spec.BG, -4, 7)
+
+		self.Spec.Page = CreateFrame('Frame', nil, self.Spec)
+		self.Spec:SetScrollChild(self.Spec.Page)
+		self.Spec.Page:SetFrameLevel(CoreFrameLevel + 2)
+		self.Spec.Page:Point('TOPLEFT', self.Spec)
+		self.Spec.Page:Point('TOPRIGHT', self.Spec)
+		self.Spec.Page:Height((TALENT_SLOT_SIZE + SPACING * 3) * MAX_NUM_TALENT_TIERS + (SPACING + GLYPH_SLOT_HEIGHT) * 3 + 22)
+
+		self.Spec.BottomBorder = self.Spec:CreateTexture(nil, 'OVERLAY')
+		self.Spec.BottomBorder:Point('TOPLEFT', self.Spec.BG, 'BOTTOMLEFT', 0, E.mult)
+		self.Spec.BottomBorder:Point('BOTTOMRIGHT', self.Spec.BG)
+		self.Spec.LeftBorder = self.Spec:CreateTexture(nil, 'OVERLAY')
+		self.Spec.LeftBorder:Point('TOPLEFT', self.Spec.BG)
+		self.Spec.LeftBorder:Point('BOTTOMLEFT', self.Spec.BottomBorder, 'TOPLEFT')
+		self.Spec.LeftBorder:Width(E.mult)
+		self.Spec.RightBorder = self.Spec:CreateTexture(nil, 'OVERLAY')
+		self.Spec.RightBorder:Point('TOPRIGHT', self.Spec.BG)
+		self.Spec.RightBorder:Point('BOTTOMRIGHT', self.Spec.BottomBorder, 'TOPRIGHT')
+		self.Spec.RightBorder:Width(E.mult)
+
+		do -- Specialization Tab
+			for i = 1, MAX_TALENT_GROUPS do
+				self.Spec['Spec'..i] = CreateFrame('Button', nil, self.Spec)
+				self.Spec['Spec'..i]:Size(150, 30)
+				self.Spec['Spec'..i]:SetScript('OnClick', function() self:ToggleSpecializationTab(i, self.CurrentInspectData) end)
+
+				self.Spec['Spec'..i].Tab = CreateFrame('Frame', nil, self.Spec['Spec'..i])
+				self.Spec['Spec'..i].Tab:Size(120, 30)
+				self.Spec['Spec'..i].Tab:SetBackdrop({
+					bgFile = E.media.blankTex,
+					edgeFile = E.media.blankTex,
+					tile = false, tileSize = 0, edgeSize = 0,
+					insets = { left = 0, right = 0, top = 0, bottom = 0}
+				})
+				self.Spec['Spec'..i].Tab:SetBackdropColor(0, 0, 0, .7)
+				self.Spec['Spec'..i].Tab:SetBackdropBorderColor(0, 0, 0, 0)
+				self.Spec['Spec'..i].Tab:Point('TOPRIGHT', self.Spec['Spec'..i])
+				C.Toolkit.TextSetting(self.Spec['Spec'..i].Tab, nil, { ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE' }, 'TOPLEFT', 0, 0)
+				self.Spec['Spec'..i].Tab.text:Point('BOTTOMRIGHT', 0, -4)
+
+				self.Spec['Spec'..i].Icon = CreateFrame('Frame', nil, self.Spec['Spec'..i].Tab)
+				self.Spec['Spec'..i].Icon:Size(27, 26)
+				self.Spec['Spec'..i].Icon:SetBackdrop({
+					bgFile = E.media.blankTex,
+					edgeFile = E.media.blankTex,
+					tile = false, tileSize = 0, edgeSize = E.mult,
+					insets = { left = 0, right = 0, top = 0, bottom = 0}
+				})
+				self.Spec['Spec'..i].Icon:SetBackdropColor(0, 0, 0, .7)
+				self.Spec['Spec'..i].Icon:Point('TOPLEFT', self.Spec['Spec'..i])
+
+				self.Spec['Spec'..i].Texture = self.Spec['Spec'..i].Icon:CreateTexture(nil, 'OVERLAY')
+				self.Spec['Spec'..i].Texture:SetTexCoord(unpack(E.TexCoords))
+				self.Spec['Spec'..i].Texture:SetInside()
+
+				self.Spec['Spec'..i].TopBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY')
+				self.Spec['Spec'..i].TopBorder:Point('TOPLEFT', self.Spec['Spec'..i].Tab)
+				self.Spec['Spec'..i].TopBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].Tab, 'TOPRIGHT', 0, -E.mult)
+
+				self.Spec['Spec'..i].LeftBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY')
+				self.Spec['Spec'..i].LeftBorder:Point('TOPLEFT', self.Spec['Spec'..i].TopBorder, 'BOTTOMLEFT')
+				self.Spec['Spec'..i].LeftBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].Tab, 'BOTTOMLEFT', E.mult, 0)
+
+				self.Spec['Spec'..i].RightBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY')
+				self.Spec['Spec'..i].RightBorder:Point('TOPLEFT', self.Spec['Spec'..i].TopBorder, 'BOTTOMRIGHT', -E.mult, 0)
+				self.Spec['Spec'..i].RightBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].Tab)
+
+				self.Spec['Spec'..i].BottomLeftBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY')
+				self.Spec['Spec'..i].BottomLeftBorder:Point('TOPLEFT', self.Spec.BG, 0, E.mult)
+				self.Spec['Spec'..i].BottomLeftBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].LeftBorder, 'BOTTOMLEFT')
+
+				self.Spec['Spec'..i].BottomRightBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY')
+				self.Spec['Spec'..i].BottomRightBorder:Point('TOPRIGHT', self.Spec.BG, 0, E.mult)
+				self.Spec['Spec'..i].BottomRightBorder:Point('BOTTOMLEFT', self.Spec['Spec'..i].RightBorder, 'BOTTOMRIGHT')
+			end
+			self.Spec.Spec1:Point('BOTTOMLEFT', self.Spec.BG, 'TOPLEFT', 20, 0)
+			self.Spec.Spec2:Point('BOTTOMRIGHT', self.Spec.BG, 'TOPRIGHT', -20, 0)
+		end
+
+		for i = 1, MAX_NUM_TALENT_TIERS do
+			self.Spec['TalentTier'..i] = CreateFrame('Frame', nil, self.Spec.Page)
+			self.Spec['TalentTier'..i]:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self.Spec['TalentTier'..i]:SetBackdropColor(.08, .08, .08)
+			self.Spec['TalentTier'..i]:SetBackdropBorderColor(0, 0, 0)
+			self.Spec['TalentTier'..i]:SetFrameLevel(CoreFrameLevel + 2)
+			self.Spec['TalentTier'..i]:Size(352, TALENT_SLOT_SIZE + SPACING * 2)
+
+			for k = 1, NUM_TALENT_COLUMNS do
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)] = CreateFrame('Frame', nil, self.Spec['TalentTier'..i])
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdrop({
+					bgFile = E.media.blankTex,
+					edgeFile = E.media.blankTex,
+					tile = false, tileSize = 0, edgeSize = E.mult,
+					insets = { left = 0, right = 0, top = 0, bottom = 0}
+				})
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetFrameLevel(CoreFrameLevel + 3)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:Size(114, TALENT_SLOT_SIZE)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon = CreateFrame('Frame', nil, self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)])
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:Size(20)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:SetBackdrop({
+					bgFile = E.media.blankTex,
+					edgeFile = E.media.blankTex,
+					tile = false, tileSize = 0, edgeSize = E.mult,
+					insets = { left = 0, right = 0, top = 0, bottom = 0}
+				})
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture = self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:CreateTexture(nil, 'OVERLAY')
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetTexCoord(unpack(E.TexCoords))
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetInside()
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:Point('LEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)], SPACING, 0)
+				C.Toolkit.TextSetting(self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)], nil, { ['FontSize'] = 9, ['directionH'] = 'LEFT' }, 'TOPLEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon, 'TOPRIGHT', SPACING, SPACING)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:Point('BOTTOMLEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon, 'BOTTOMRIGHT', SPACING, -SPACING)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:Point('RIGHT', -SPACING, 0)
+
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip = CreateFrame('Button', nil, self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)])
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetFrameLevel(CoreFrameLevel + 4)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetInside()
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetScript('OnClick', self.OnClick)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetScript('OnEnter', C.CommonScript.OnEnter)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetScript('OnLeave', C.CommonScript.OnLeave)
+			end
+
+			self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 1)]:Point('RIGHT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 2)], 'LEFT', -2, 0)
+			self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 2)]:Point('CENTER', self.Spec['TalentTier'..i])
+			self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 3)]:Point('LEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 2)], 'RIGHT', 2, 0)
+		end
+
+		self.Spec.TalentTier1:Point('TOP', self.Spec.Page, 0, -2)
+		self.Spec.TalentTier2:Point('TOP', self.Spec.TalentTier1, 'BOTTOM', 0, -SPACING)
+		self.Spec.TalentTier3:Point('TOP', self.Spec.TalentTier2, 'BOTTOM', 0, -SPACING)
+		self.Spec.TalentTier4:Point('TOP', self.Spec.TalentTier3, 'BOTTOM', 0, -SPACING)
+		self.Spec.TalentTier5:Point('TOP', self.Spec.TalentTier4, 'BOTTOM', 0, -SPACING)
+		self.Spec.TalentTier6:Point('TOP', self.Spec.TalentTier5, 'BOTTOM', 0, -SPACING)
+
+		for _, groupName in pairs({ 'MAJOR_GLYPH', 'MINOR_GLYPH' }) do
+			self.Spec['GLYPH_'..groupName] = CreateFrame('Frame', nil, self.Spec.Page)
+			self.Spec['GLYPH_'..groupName]:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self.Spec['GLYPH_'..groupName]:SetBackdropColor(.08, .08, .08)
+			self.Spec['GLYPH_'..groupName]:SetBackdropBorderColor(0, 0, 0)
+			self.Spec['GLYPH_'..groupName]:Height(GLYPH_SLOT_HEIGHT * 3 + SPACING * 3 + 22)
+			C.Toolkit.TextSetting(self.Spec['GLYPH_'..groupName], '|cffceff00<|r '.._G[groupName]..' |cffceff00>|r', { ['FontSize'] = 10 }, 'TOP', self.Spec['GLYPH_'..groupName], 0, -5)
+		end
+
+		for i = 1, NUM_GLYPH_SLOTS do
+			self.Spec['Glyph'..i] = CreateFrame('Button', nil, self.Spec.Page)
+			self.Spec['Glyph'..i]:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self.Spec['Glyph'..i]:SetFrameLevel(CoreFrameLevel + 2)
+			self.Spec['Glyph'..i]:Height(GLYPH_SLOT_HEIGHT)
+
+			self.Spec['Glyph'..i].NeedLevel = (i == 1 or i == 2) and 25 or (i == 3 or i == 4) and 50 or 75
+
+			self.Spec['Glyph'..i].Icon = CreateFrame('Frame', nil, self.Spec['Glyph'..i])
+			self.Spec['Glyph'..i].Icon:Size(16)
+			self.Spec['Glyph'..i].Icon:SetBackdrop({
+				bgFile = E.media.blankTex,
+				edgeFile = E.media.blankTex,
+				tile = false, tileSize = 0, edgeSize = E.mult,
+				insets = { left = 0, right = 0, top = 0, bottom = 0}
+			})
+			self.Spec['Glyph'..i].Icon:SetBackdropColor(.15, .15, .15)
+			self.Spec['Glyph'..i].Icon:SetFrameLevel(CoreFrameLevel + 3)
+			self.Spec['Glyph'..i].Icon.Texture = self.Spec['Glyph'..i].Icon:CreateTexture(nil, 'OVERLAY')
+			self.Spec['Glyph'..i].Icon.Texture:SetTexCoord(unpack(E.TexCoords))
+			self.Spec['Glyph'..i].Icon.Texture:SetInside()
+			self.Spec['Glyph'..i].Icon:Point('LEFT', self.Spec['Glyph'..i], SPACING, 0)
+
+			self.Spec['Glyph'..i].Tooltip = CreateFrame('Button', nil, self.Spec['Glyph'..i])
+			self.Spec['Glyph'..i].Tooltip:SetFrameLevel(CoreFrameLevel + 4)
+			self.Spec['Glyph'..i].Tooltip:SetInside()
+			self.Spec['Glyph'..i].Tooltip:SetScript('OnClick', self.OnClick)
+			self.Spec['Glyph'..i].Tooltip:SetScript('OnEnter', C.CommonScript.OnEnter)
+			self.Spec['Glyph'..i].Tooltip:SetScript('OnLeave', C.CommonScript.OnLeave)
+			self.Spec['Glyph'..i].Tooltip.EnableAuctionSearch = true
+
+			C.Toolkit.TextSetting(self.Spec['Glyph'..i], nil, { ['FontSize'] = 9, ['directionH'] = 'LEFT' }, 'LEFT', self.Spec['Glyph'..i].Icon, 'RIGHT', SPACING, 0)
+			self.Spec['Glyph'..i].text:Point('RIGHT', self.Spec['Glyph'..i], -SPACING, 0)
+		end
+
+		self.Spec.Glyph2:Point('TOP', self.Spec.GLYPH_MAJOR_GLYPH.text, 'BOTTOM', 0, -7)
+		self.Spec.Glyph2:Point('LEFT', self.Spec.GLYPH_MAJOR_GLYPH, SPACING, 0)
+		self.Spec.Glyph2:Point('RIGHT', self.Spec.GLYPH_MAJOR_GLYPH, -SPACING, 0)
+		self.Spec.Glyph4:Point('TOPLEFT', self.Spec.Glyph2, 'BOTTOMLEFT', 0, -SPACING)
+		self.Spec.Glyph4:Point('TOPRIGHT', self.Spec.Glyph2, 'BOTTOMRIGHT', 0, -SPACING)
+		self.Spec.Glyph6:Point('TOPLEFT', self.Spec.Glyph4, 'BOTTOMLEFT', 0, -SPACING)
+		self.Spec.Glyph6:Point('TOPRIGHT', self.Spec.Glyph4, 'BOTTOMRIGHT', 0, -SPACING)
+
+		self.Spec.Glyph1:Point('TOP', self.Spec.GLYPH_MINOR_GLYPH.text, 'BOTTOM', 0, -7)
+		self.Spec.Glyph1:Point('LEFT', self.Spec.GLYPH_MINOR_GLYPH, SPACING, 0)
+		self.Spec.Glyph1:Point('RIGHT', self.Spec.GLYPH_MINOR_GLYPH, -SPACING, 0)
+		self.Spec.Glyph3:Point('TOPLEFT', self.Spec.Glyph1, 'BOTTOMLEFT', 0, -SPACING)
+		self.Spec.Glyph3:Point('TOPRIGHT', self.Spec.Glyph1, 'BOTTOMRIGHT', 0, -SPACING)
+		self.Spec.Glyph5:Point('TOPLEFT', self.Spec.Glyph3, 'BOTTOMLEFT', 0, -SPACING)
+		self.Spec.Glyph5:Point('TOPRIGHT', self.Spec.Glyph3, 'BOTTOMRIGHT', 0, -SPACING)
+
+		self.Spec.GLYPH_MAJOR_GLYPH:Point('TOPLEFT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOMLEFT', 0, -SPACING)
+		self.Spec.GLYPH_MAJOR_GLYPH:Point('TOPRIGHT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOM', -2, -SPACING)
+		self.Spec.GLYPH_MINOR_GLYPH:Point('TOPLEFT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOM', 2, -SPACING)
+		self.Spec.GLYPH_MINOR_GLYPH:Point('TOPRIGHT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOMRIGHT', 0, -SPACING)
+	end
+
+	do --<< Scanning Tooltip >>--
+		self.ScanTTForInspecting = CreateFrame('GameTooltip', 'KnightInspectScanTT_I', nil, 'GameTooltipTemplate')
+		self.ScanTTForInspecting:SetOwner(UIParent, 'ANCHOR_NONE')
+		self.ScanTT = CreateFrame('GameTooltip', 'KnightInspectScanTT', nil, 'GameTooltipTemplate')
+		self.ScanTT:SetOwner(UIParent, 'ANCHOR_NONE')
+	end
+
+	do --<< UnitPopup Setting >>--
+		hooksecurefunc('UnitPopup_HideButtons', function()
+			if KI.Activate then
+				local Unit = UIDROPDOWNMENU_INIT_MENU.unit
+				local Name = UIDROPDOWNMENU_INIT_MENU.name
+
+				if Name then
+					Name = Name..(UIDROPDOWNMENU_INIT_MENU.server and UIDROPDOWNMENU_INIT_MENU.server ~= '' and UIDROPDOWNMENU_INIT_MENU.server ~= E.myrealm and '-'..UIDROPDOWNMENU_INIT_MENU.server or '')
+					Unit = UnitExists(Name) and Name or Unit
+
+					for index, value in ipairs(UnitPopupMenus[UIDROPDOWNMENU_MENU_VALUE] or UnitPopupMenus[UIDROPDOWNMENU_INIT_MENU.which]) do
+						if value == 'KnightInspect' then
+							if not (Unit and not UnitCanAttack('player', Unit) and UnitIsConnected(Unit)) then
+								if AISM then
+									AISM.GroupMemberData[Name] = nil
+								end
+
+								UnitPopupShown[UIDROPDOWNMENU_MENU_LEVEL][index] = 0
+							end
+
+							if AISM and (AISM.GroupMemberData[Name] or AISM.GuildMemberData[Name]) then
+								UnitPopupShown[UIDROPDOWNMENU_MENU_LEVEL][index] = 1
+							end
+
+							return
+						end
+					end
+				end
+			end
+		end)
+
+		local Count, tempCount
+		hooksecurefunc('UnitPopup_OnUpdate', function()
+			if not DropDownList1:IsShown() or not KI.Activate then return end
+
+			for level, dropdownFrame in pairs(OPEN_DROPDOWNMENUS) do
+				if dropdownFrame then
+					Count = 0
+
+					for index, value in ipairs(UnitPopupMenus[dropdownFrame.which]) do
+						if UnitPopupShown[level][index] == 1 then
+							Count = Count + 1
+
+							if level > 1 then
+								tempCount = Count
+							else
+								tempCount = Count + 1
+							end
+
+							if value == 'KnightInspect' then
+								--local Type = dropdownFrame.which
+								local Unit = UIDROPDOWNMENU_INIT_MENU.unit
+								local Name = UIDROPDOWNMENU_INIT_MENU.name
+
+								Name = Name..(UIDROPDOWNMENU_INIT_MENU.server and UIDROPDOWNMENU_INIT_MENU.server ~= '' and UIDROPDOWNMENU_INIT_MENU.server ~= E.myrealm and '-'..UIDROPDOWNMENU_INIT_MENU.server or '')
+								Unit = UnitExists(Name) and Name or Unit
+
+								if AISM and (type(AISM.GroupMemberData[Name]) == 'table' or AISM.GuildMemberData[Name]) or Unit and UnitIsVisible(Unit) then
+									UIDropDownMenu_EnableButton(level, tempCount)
+								else
+									UIDropDownMenu_DisableButton(level, tempCount)
+								end
+							end
+						end
+					end
+				end
+			end
+		end)
+
+		hooksecurefunc('UnitPopup_OnClick', function(self)
+			if KI.Activate and self.value == 'KnightInspect' then
+				--local Type = UIDROPDOWNMENU_INIT_MENU.which
+				local Name = UIDROPDOWNMENU_INIT_MENU.name
+				local Realm = UIDROPDOWNMENU_INIT_MENU.server
+				Realm = Realm ~= '' and Realm or E.myrealm
+
+				local TableIndex = Name..(Realm ~= E.myrealm and '-'..Realm or '')
+				local Unit = UnitExists(TableIndex) and TableIndex or UIDROPDOWNMENU_INIT_MENU.unit
+
+				local SendChannel
+
+				if AISM and AISM.GuildMemberData[TableIndex] then
+					if Realm == E.myrealm then
+						SendChannel = 'WHISPER'
+					else
+						SendChannel = 'GUILD'
+					end
+				elseif KI.CurrentGroupMode ~= 'NoGroup' and AISM and type(AISM.GroupMemberData[TableIndex]) == 'table' then
+					if Realm == E.myrealm then
+						SendChannel = 'WHISPER'
+					else
+						SendChannel = KI.InstanceType == 'pvp' and 'BATTLEGROUND' or IsInGroup(LE_PARTY_CATEGORY_INSTANCE) and 'INSTANCE_CHAT' or string.upper(KI.CurrentGroupMode)
+					end
+				end
+
+				if AISM and SendChannel then
+					AISM.CurrentInspectData[TableIndex] = {
+						['UnitID'] = Unit,
+					}
+					AISM:RegisterInspectDataRequest(function(User, UserData)
+						if User == TableIndex then
+							KI.CurrentInspectData = E:CopyTable({}, KI.Default_CurrentInspectData)
+							E:CopyTable(KI.CurrentInspectData, UserData)
+							KI:ShowFrame(KI.CurrentInspectData)
+
+							return true
+						end
+					end, TableIndex, true)
+					SendAddonMessage('AISM_Inspect', 'AISM_DataRequestForInspecting:'..Name..'-'..Realm, SendChannel, TableIndex)
+				elseif Unit then
+					KI.InspectUnit(Unit)
+				end
+			end
+		end)
+	end
+
+	do --<< Updater >>--
+		self.Updater = CreateFrame('Frame')
+		self.Updater:Hide()
+	end
+
+	HideUIPanel(self)
+
+	self.CreateInspectFrame = nil
+end
+
+KI.INSPECT_READY = function(InspectedUnitGUID)
+	local UnitID = KI.CurrentInspectData.Name..(KI.CurrentInspectData.Realm and '-'..KI.CurrentInspectData.Realm or '')
+	local GUIDByUnitName = UnitGUID(UnitID)
+	local Name, Realm = UnitFullName(UnitID)
+
+	if not GUIDByUnitName then
+		UnitID = KI.CurrentInspectData.UnitID
+		GUIDByUnitName = UnitGUID(UnitID)
+		Name, Realm = UnitFullName(UnitID)
+	end
+
+	if not Name then
+		_, _, _, _, _, Name, Realm = GetPlayerInfoByGUID(InspectedUnitGUID)
+	end
+
+	local TableIndex = Name..(Realm and Realm ~= '' and Realm ~= E.myrealm and '-'..E.myrealm or '')
+
+	if InspectedUnitGUID ~= GUIDByUnitName then
+		if GUIDByUnitName and KI.CurrentInspectData.Name == Name and KI.CurrentInspectData.Realm == Realm then
+			KI.CurrentInspectData.UnitGUID = GUIDByUnitName
+			return
+		else
+			ENI.CancelInspect(TableIndex)
+			KI:UnregisterEvent('INSPECT_READY', 'KnightInspect')
+
+			return
+		end
+	end
+
+	_, _, KI.CurrentInspectData.Race, KI.CurrentInspectData.RaceID, KI.CurrentInspectData.GenderID = GetPlayerInfoByGUID(InspectedUnitGUID)
+
+	local needReinspect
+	local CurrentSetItem = {}
+	local Slot, SlotTexture, SlotLink, CheckSpace, colorR, colorG, colorB, tooltipText, TransmogrifiedItem, SetName, SetItemCount, SetItemMax, SetOptionCount
+	for _, SlotName in pairs(C.GearList) do
+		Slot = KI[SlotName]
+		KI.CurrentInspectData.Gear[SlotName] = {}
+
+		SlotTexture = GetInventoryItemTexture(UnitID, Slot.ID)
+
+		if SlotTexture and SlotTexture..'.blp' ~= Slot.EmptyTexture then
+			SlotLink = GetInventoryItemLink(UnitID, Slot.ID)
+
+			if not SlotLink then
+				needReinspect = true
+			else
+				KI.CurrentInspectData.Gear[SlotName].ItemLink = SlotLink
+
+				KI.ScanTTForInspecting:ClearLines()
+				for i = 1, 10 do
+					_G['KnightInspectScanTT_ITexture'..i]:SetTexture(nil)
+				end
+				KI.ScanTTForInspecting:SetInventoryItem(UnitID, Slot.ID)
+
+				TransmogrifiedItem = nil
+				checkSpace = 2
+				SetOptionCount = 1
+
+				for i = 1, KI.ScanTTForInspecting:NumLines() do
+					tooltipText = _G['KnightInspectScanTT_ITextLeft'..i]:GetText()
+
+					if not TransmogrifiedItem and tooltipText:match(C.TransmogrifiedKey) then
+						if type(KI.CurrentInspectData.Gear[SlotName].Transmogrify) ~= 'number' then
+							KI.CurrentInspectData.Gear[SlotName].Transmogrify = tooltipText:match(C.TransmogrifiedKey)
+						end
+
+						TransmogrifiedItem = true
+					end
+
+					SetName, SetItemCount, SetItemMax = tooltipText:match('^(.+) %((%d)/(%d)%)$') -- find string likes 'SetName (0/5)'
+					if SetName then
+						SetItemCount = tonumber(SetItemCount)
+						SetItemMax = tonumber(SetItemMax)
+
+						if SetItemCount > SetItemMax or SetItemMax == 1 then
+							needReinspect = true
+							break
+						elseif CurrentSetItem[SetName] then
+							break
+						else
+							CurrentSetItem[SetName] = {}
+
+							for k = 1, KI.ScanTTForInspecting:NumLines() do
+								tooltipText = _G['KnightInspectScanTT_ITextLeft'..(i+k)]:GetText()
+
+								if tooltipText == ' ' then
+									checkSpace = checkSpace - 1
+
+									if checkSpace == 0 then break end
+								elseif checkSpace == 2 then
+									colorR, colorG, colorB = _G['KnightInspectScanTT_ITextLeft'..(i+k)]:GetTextColor()
+
+									if colorR > LIGHTYELLOW_FONT_COLOR.r - 0.01 and colorR < LIGHTYELLOW_FONT_COLOR.r + 0.01 and colorG > LIGHTYELLOW_FONT_COLOR.g - 0.01 and colorG < LIGHTYELLOW_FONT_COLOR.g + 0.01 and colorB > LIGHTYELLOW_FONT_COLOR.b - 0.01 and colorB < LIGHTYELLOW_FONT_COLOR.b + 0.01 then
+										CurrentSetItem[SetName][#CurrentSetItem[SetName] + 1] = LIGHTYELLOW_FONT_COLOR_CODE..tooltipText
+									else
+										CurrentSetItem[SetName][#CurrentSetItem[SetName] + 1] = GRAY_FONT_COLOR_CODE..tooltipText
+									end
+								elseif tooltipText:find(C.ItemSetBonusKey) then
+									CurrentSetItem[SetName]['SetOption'..SetOptionCount] = tooltipText:match("^%((%d)%)%s.+:%s.+$") or true
+
+									SetOptionCount = SetOptionCount + 1
+								end
+							end
+
+							KI.CurrentInspectData.SetItem[SetName] = CurrentSetItem[SetName]
+
+							break
+						end
+					end
+
+					if checkSpace == 0 then break end
+				end
+			end
+		end
+	end
+
+	if KI.CurrentInspectData.SetItem then
+		for SetName in pairs(KI.CurrentInspectData.SetItem) do
+			if not CurrentSetItem[SetName] then
+				KI.CurrentInspectData.SetItem[SetName] = nil
+			end
+		end
+	end
+
+	-- Specialization
+	KI.CurrentInspectData.Specialization[1].SpecializationID = GetInspectSpecialization(UnitID)
+	for i = 1, NUM_TALENT_COLUMNS * MAX_NUM_TALENT_TIERS do
+		KI.CurrentInspectData.Specialization[1]['Talent'..i] = select(5, GetTalentInfo(i, true, nil, UnitID, KI.CurrentInspectData.ClassID))
+	end
+
+	-- Glyph
+	local SpellID, GlyphID
+	for i = 1, NUM_GLYPH_SLOTS do
+		_, _, _, SpellID, _, GlyphID = GetGlyphSocketInfo(i, nil, true, UnitID)
+
+		KI.CurrentInspectData.Glyph[1]['Glyph'..i..'SpellID'] = SpellID or 0
+		KI.CurrentInspectData.Glyph[1]['Glyph'..i..'ID'] = GlyphID or 0
+	end
+
+	-- Guild
+	KI.CurrentInspectData.guildLevel, _, KI.CurrentInspectData.guildNumMembers = GetInspectGuildInfo(UnitID)
+	KI.CurrentInspectData.guildEmblem = { GetGuildLogoInfo(UnitID) }
+
+	if needReinspect then
+		return
+	end
+
+	ENI.CancelInspect(TableIndex)
+	KI:ShowFrame(KI.CurrentInspectData)
+	KI:UnregisterEvent('INSPECT_READY')
+end
+
+KI.InspectUnit = function(UnitID)
+	if not UnitExists('mouseover') and UnitExists('target') then
+		UnitID = 'target'
+	end
+
+	if not UnitIsPlayer(UnitID) then
+		return
+	elseif UnitIsDeadOrGhost('player') then
+		print('|cff2eb7e4[S&L]|r : '..L["You can't inspect while dead."])
+
+		return
+	elseif not UnitIsVisible(UnitID) then
+
+		return
+	else
+		UnitID = NotifyInspect(UnitID, true) or UnitID
+
+		KI.CurrentInspectData = E:CopyTable({}, KI.Default_CurrentInspectData)
+
+		KI.CurrentInspectData.UnitID = UnitID
+		KI.CurrentInspectData.UnitGUID = UnitGUID(UnitID)
+		KI.CurrentInspectData.Title = UnitPVPName(UnitID)
+		KI.CurrentInspectData.Level = UnitLevel(UnitID)
+		KI.CurrentInspectData.Name, KI.CurrentInspectData.Realm = UnitFullName(UnitID)
+		_, KI.CurrentInspectData.Class, KI.CurrentInspectData.ClassID = UnitClass(UnitID)
+		KI.CurrentInspectData.guildName, KI.CurrentInspectData.guildRankName = GetGuildInfo(UnitID)
+
+		KI.CurrentInspectData.Realm = KI.CurrentInspectData.Realm ~= '' and KI.CurrentInspectData.Realm ~= E.myrealm and KI.CurrentInspectData.Realm or nil
+
+		KI:RegisterEvent('INSPECT_READY')
+	end
+end
+
+function KI:ShowFrame(DataTable)
+	local needUpdate, CheckItemInfoReceived
+
+	for _, slotName in pairs(C.GearList) do
+		if DataTable.Gear[slotName] and DataTable.Gear[slotName].ItemLink then
+			_, CheckItemInfoReceived = GetItemInfo(DataTable.Gear[slotName].ItemLink)
+
+			if not CheckItemInfoReceived then
+				needUpdate = true
+
+				if not self.GET_ITEM_INFO_RECEIVED then
+					self.GET_ITEM_INFO_RECEIVED = function()
+						self:ShowFrame(DataTable)
+					end
+					self:RegisterEvent('GET_ITEM_INFO_RECEIVED')
+				end
+			end
+		end
+	end
+
+	if needUpdate then
+		return
+	end
+
+	self.GET_ITEM_INFO_RECEIVED = nil
+	self:UnregisterEvent('GET_ITEM_INFO_RECEIVED')
+
+	self.Updater:Show()
+	self.Updater:SetScript('OnUpdate', function()
+		if not self:InspectFrame_DataSetting(DataTable) then
+			self.Updater:SetScript('OnUpdate', nil)
+			self.Updater:Hide()
+
+			ShowUIPanel(KnightInspect)
+		end
+	end)
+end
+
+function KI:InspectFrame_DataSetting(DataTable)
+	local needUpdate
+	local r, g, b
+
+	do --<< Equipment Slot and Enchant, Gem Setting >>--
+		local ErrorDetected
+		local ItemCount, ItemTotal = 0, 0
+		local Slot, ItemRarity, BasicItemLevel, TrueItemLevel, ItemUpgradeID, ItemTexture, IsEnchanted, CurrentLineText, GemCount_Default, GemCount_Enable, GemCount_Now, GemCount
+		local arg1, itemID, enchantID, _, _, _, _, arg2, arg3, arg4, arg5, arg6
+
+		-- Setting except shirt and tabard
+		for _, slotName in pairs(self.GearUpdated or C.GearList) do
+			if slotName ~= 'ShirtSlot' and slotName ~= 'TabardSlot' then
+				Slot = self[slotName]
+
+				do --<< Clear Setting >>--
+					ErrorDetected, TrueItemLevel, IsEnchanted, ItemUpgradeID, ItemTexture, r, g, b = nil, nil, nil, nil, nil, 0, 0, 0
+
+					Slot.Link = nil
+					Slot.ItemLevel:SetText(nil)
+					Slot.Gradation.ItemLevel:SetText(nil)
+					Slot.Gradation.ItemEnchant:SetText(nil)
+					for i = 1, MAX_NUM_SOCKETS do
+						Slot['Socket'..i].Texture:SetTexture(nil)
+						Slot['Socket'..i].GemItemID = nil
+						Slot['Socket'..i].GemType = nil
+						Slot['Socket'..i]:Hide()
+					end
+					Slot.EnchantWarning:Hide()
+					Slot.EnchantWarning.Message = nil
+					Slot.SocketWarning:Point(Slot.Direction, Slot.Socket1)
+					Slot.SocketWarning:Hide()
+					Slot.SocketWarning.Link = nil
+					Slot.SocketWarning.Message = nil
+				end
+
+				if DataTable.Gear[slotName].ItemLink then
+					_, Slot.Link = GetItemInfo(DataTable.Gear[slotName].ItemLink)
+
+					do --<< Gem Parts >>--
+						arg1, itemID, enchantID, _, _, _, _, arg2, arg3, arg4, arg5, arg6 = strsplit(':', Slot.Link)
+
+						self.ScanTT:ClearLines()
+						for i = 1, 10 do
+							_G['KnightInspectScanTTTexture'..i]:SetTexture(nil)
+						end
+						self.ScanTT:SetHyperlink(format('%s:%s:%d:0:0:0:0:%s:%s:%s:%s:%s', arg1, itemID, enchantID, arg2, arg3, arg4, arg5, arg6))
+
+						GemCount_Default, GemCount_Now, GemCount = 0, 0, 0
+
+						-- First, Counting default gem sockets
+						for i = 1, MAX_NUM_SOCKETS do
+							ItemTexture = _G['KnightInspectScanTTTexture'..i]:GetTexture()
+
+							if ItemTexture and ItemTexture:find('Interface\\ItemSocketingFrame\\') then
+								GemCount_Default = GemCount_Default + 1
+								Slot['Socket'..GemCount_Default].GemType = strupper(gsub(ItemTexture, 'Interface\\ItemSocketingFrame\\UI--EmptySocket--', ''))
+							end
+						end
+
+						-- Second, Check if slot's item enable to adding a socket
+						GemCount_Enable = GemCount_Default
+						if (slotName == 'WaistSlot' and DataTable.Level >= 70) or -- buckle
+							((slotName == 'WristSlot' or slotName == 'HandsSlot') and (DataTable.Profession[1].Name == GetSpellInfo(110396) and DataTable.Profession[1].Level >= 550 or DataTable.Profession[2].Name == GetSpellInfo(110396) and DataTable.Profession[2].Level >= 550)) then -- BlackSmith
+
+							GemCount_Enable = GemCount_Enable + 1
+							Slot['Socket'..GemCount_Enable].GemType = 'PRISMATIC'
+						end
+
+						self.ScanTT:ClearLines()
+						for i = 1, 10 do
+							_G['KnightInspectScanTTTexture'..i]:SetTexture(nil)
+						end
+						self.ScanTT:SetHyperlink(Slot.Link)
+
+						-- Apply current item's gem setting
+						for i = 1, MAX_NUM_SOCKETS do
+							ItemTexture = _G['KnightInspectScanTTTexture'..i]:GetTexture()
+
+							if Slot['Socket'..i].GemType and C.GemColor[Slot['Socket'..i].GemType] then
+								r, g, b = unpack(C.GemColor[Slot['Socket'..i].GemType])
+								Slot['Socket'..i].Socket:SetBackdropColor(r, g, b, 0.5)
+								Slot['Socket'..i].Socket:SetBackdropBorderColor(r, g, b)
+							else
+								Slot['Socket'..i].Socket:SetBackdropColor(1, 1, 1, 0.5)
+								Slot['Socket'..i].Socket:SetBackdropBorderColor(1, 1, 1)
+							end
+
+							if ItemTexture then
+								Slot['Socket'..i]:Show()
+								GemCount_Now = GemCount_Now + 1
+								Slot.SocketWarning:Point(Slot.Direction, Slot['Socket'..i], (Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT'), Slot.Direction == 'LEFT' and 3 or -3, 0)
+
+								if DataTable.Gear[slotName]['Gem'..i] then
+									GemCount = GemCount + 1
+									Slot['Socket'..i].Texture:SetTexture(ItemTexture)
+									Slot['Socket'..i].GemItemID = DataTable.Gear[slotName]['Gem'..i]
+								else
+									CurrentLineText = select(2, _G['KnightInspectScanTTTexture'..i]:GetPoint()):GetText()
+
+									if not C.EmptySocketString[CurrentLineText] then
+										GemCount = GemCount + 1
+										Slot['Socket'..i].Texture:SetTexture(ItemTexture)
+										Slot['Socket'..i].GemItemID = CurrentLineText
+									end
+								end
+							end
+						end
+
+						if GemCount_Now < GemCount_Default then -- ItemInfo not loaded
+							needUpdate = needUpdate or {}
+							needUpdate[#needUpdate + 1] = slotName
+						end
+					end
+
+					_, _, ItemRarity, BasicItemLevel, _, _, _, _, _, ItemTexture = GetItemInfo(Slot.Link)
+					r, g, b = GetItemQualityColor(ItemRarity)
+
+					ItemUpgradeID = Slot.Link:match(':(%d+)\124h%[')
+
+					--<< Enchant Parts >>--
+					for i = 1, self.ScanTT:NumLines() do
+						CurrentLineText = _G['KnightInspectScanTTTextLeft'..i]:GetText()
+
+						if CurrentLineText:find(C.ItemLevelKey_Alt) then
+							TrueItemLevel = tonumber(CurrentLineText:match(C.ItemLevelKey_Alt))
+						elseif CurrentLineText:find(C.ItemLevelKey) then
+							TrueItemLevel = tonumber(CurrentLineText:match(C.ItemLevelKey))
+						elseif CurrentLineText:find(C.EnchantKey) then
+							CurrentLineText = CurrentLineText:match(C.EnchantKey) -- Get enchant string
+							CurrentLineText = gsub(CurrentLineText, ITEM_MOD_AGILITY_SHORT, AGI)
+							CurrentLineText = gsub(CurrentLineText, ITEM_MOD_SPIRIT_SHORT, SPI)
+							CurrentLineText = gsub(CurrentLineText, ITEM_MOD_STAMINA_SHORT, STA)
+							CurrentLineText = gsub(CurrentLineText, ITEM_MOD_STRENGTH_SHORT, STR)
+							CurrentLineText = gsub(CurrentLineText, ITEM_MOD_INTELLECT_SHORT, INT)
+							CurrentLineText = gsub(CurrentLineText, ITEM_MOD_CRIT_RATING_SHORT, CRIT_ABBR) -- Critical is too long
+							CurrentLineText = gsub(CurrentLineText, ' + ', '+') -- Remove space
+
+							Slot.Gradation.ItemEnchant:SetText('|cffceff00'..CurrentLineText)
+
+							IsEnchanted = true
+						end
+					end
+
+					--<< ItemLevel Parts >>--
+					if BasicItemLevel then
+						ItemCount = ItemCount + 1
+
+						if ItemUpgradeID then
+							if ItemUpgradeID == '0' then
+								ItemUpgradeID = nil
+							else
+								ItemUpgradeID = TrueItemLevel - BasicItemLevel
+							end
+						end
+
+						ItemTotal = ItemTotal + TrueItemLevel
+
+						Slot.ItemLevel:SetText((ItemUpgradeID and (C.UpgradeColor[ItemUpgradeID] or '|cffffffff') or '')..TrueItemLevel)
+						Slot.Gradation.ItemLevel:SetText((Slot.Direction == 'LEFT' and TrueItemLevel or '')..(ItemUpgradeID and (Slot.Direction == 'LEFT' and ' ' or '')..(C.UpgradeColor[ItemUpgradeID] or '|cffaaaaaa')..'(+'..ItemUpgradeID..')|r'..(Slot.Direction == 'RIGHT' and ' ' or '') or '')..(Slot.Direction == 'RIGHT' and TrueItemLevel or ''))
+					end
+
+					-- Check Error
+					if (not IsEnchanted and C.EnchantableSlots[slotName]) or ((slotName == 'Finger0Slot' or slotName == 'Finger1Slot') and (DataTable.Profession[1].Name == GetSpellInfo(110400) and DataTable.Profession[1].Level >= 550 or DataTable.Profession[2].Name == GetSpellInfo(110400) and DataTable.Profession[2].Level >= 550) and not IsEnchanted) then
+						ErrorDetected = true
+						Slot.EnchantWarning:Show()
+						Slot.Gradation.ItemEnchant:SetText('|cffff0000'..L['Not Enchanted'])
+					elseif slotName == 'ShoulderSlot' and C.ItemEnchant_Profession_Inscription and (DataTable.Profession[1].Name == GetSpellInfo(110417) and DataTable.Profession[1].Level >= C.ItemEnchant_Profession_Inscription.NeedLevel or DataTable.Profession[2].Name == GetSpellInfo(110417) and DataTable.Profession[2].Level >= C.ItemEnchant_Profession_Inscription.NeedLevel) and not C.ItemEnchant_Profession_Inscription[enchantID] then
+						ErrorDetected = true
+						Slot.EnchantWarning:Show()
+						Slot.EnchantWarning.Message = '|cff71d5ff'..GetSpellInfo(110400)..'|r : '..L['This is not profession only.']
+					elseif slotName == 'WristSlot' and C.ItemEnchant_Profession_LeatherWorking and (DataTable.Profession[1].Name == GetSpellInfo(110423) and DataTable.Profession[1].Level >= C.ItemEnchant_Profession_LeatherWorking.NeedLevel or DataTable.Profession[2].Name == GetSpellInfo(110423) and DataTable.Profession[2].Level >= C.ItemEnchant_Profession_LeatherWorking.NeedLevel) and not C.ItemEnchant_Profession_LeatherWorking[enchantID] then
+						ErrorDetected = true
+						Slot.EnchantWarning:Show()
+						Slot.EnchantWarning.Message = '|cff71d5ff'..GetSpellInfo(110423)..'|r : '..L['This is not profession only.']
+					elseif slotName == 'BackSlot' and C.ItemEnchant_Profession_Tailoring and (DataTable.Profession[1].Name == GetSpellInfo(110426) and DataTable.Profession[1].Level >= C.ItemEnchant_Profession_Tailoring.NeedLevel or DataTable.Profession[2].Name == GetSpellInfo(110426) and DataTable.Profession[2].Level >= C.ItemEnchant_Profession_Tailoring.NeedLevel) and not C.ItemEnchant_Profession_Tailoring[enchantID] then
+						ErrorDetected = true
+						Slot.EnchantWarning:Show()
+						Slot.EnchantWarning.Message = '|cff71d5ff'..GetSpellInfo(110426)..'|r : '..L['This is not profession only.']
+					end
+
+					if GemCount_Enable > GemCount_Now or GemCount_Enable > GemCount or GemCount_Now > GemCount then
+						ErrorDetected = true
+
+						Slot.SocketWarning:Show()
+
+						if GemCount_Enable > GemCount_Now then
+							if slotName == 'WaistSlot' then
+								if TrueItemLevel < 300 then
+									_, Slot.SocketWarning.Link = GetItemInfo(41611)
+								elseif TrueItemLevel < 417 then
+									_, Slot.SocketWarning.Link = GetItemInfo(55054)
+								else
+									_, Slot.SocketWarning.Link = GetItemInfo(90046)
+								end
+
+								Slot.SocketWarning.Message = L['Missing Buckle']
+
+								Slot.SocketWarning:SetScript('OnClick', function(self)
+									local itemName, itemLink
+
+									if TrueItemLevel < 300 then
+										itemName, itemLink = GetItemInfo(41611)
+									elseif TrueItemLevel < 417 then
+										itemName, itemLink = GetItemInfo(55054)
+									else
+										itemName, itemLink = GetItemInfo(90046)
+									end
+
+									if HandleModifiedItemClick(itemLink) then
+									elseif IsShiftKeyDown() and BrowseName and BrowseName:IsVisible() then
+										AuctionFrameBrowse_Reset(BrowseResetButton)
+										BrowseName:SetText(itemName)
+										BrowseName:SetFocus()
+									end
+								end)
+							elseif slotName == 'HandsSlot' then
+								Slot.SocketWarning.Link = GetSpellLink(114112)
+								Slot.SocketWarning.Message = '|cff71d5ff'..GetSpellInfo(110396)..'|r : '..L['Missing Socket']
+							elseif slotName == 'WristSlot' then
+								Slot.SocketWarning.Link = GetSpellLink(113263)
+								Slot.SocketWarning.Message = '|cff71d5ff'..GetSpellInfo(110396)..'|r : '..L['Missing Socket']
+							end
+						else
+							Slot.SocketWarning.Message = '|cffff5678'..(GemCount_Now - GemCount)..'|r '..L['Empty Socket']
+						end
+					end
+				end
+
+				-- Change Gradation
+				if ErrorDetected then
+					if Slot.Direction == 'LEFT' then
+						Slot.Gradation.Texture:SetTexCoord(0, .5, .5, 1)
+					else
+						Slot.Gradation.Texture:SetTexCoord(.5, 1, .5, 1)
+					end
+				else
+					if Slot.Direction == 'LEFT' then
+						Slot.Gradation.Texture:SetTexCoord(0, .5, 0, .5)
+					else
+						Slot.Gradation.Texture:SetTexCoord(.5, 1, 0, .5)
+					end
+				end
+
+				Slot.Texture:SetTexture(ItemTexture or Slot.EmptyTexture)
+				Slot:SetBackdropBorderColor(r, g, b)
+			end
+		end
+
+		for _, slotName in pairs({ 'ShirtSlot', 'TabardSlot' }) do
+			Slot = self[slotName]
+			ItemRarity, ItemTexture, r, g, b = nil, nil, 0, 0, 0
+
+			Slot.Link = DataTable.Gear[slotName].ItemLink
+
+			if Slot.Link then
+				_, _, ItemRarity, _, _, _, _, _, _, ItemTexture = GetItemInfo(Slot.Link)
+				r, g, b = GetItemQualityColor(ItemRarity)
+			end
+
+			Slot.Texture:SetTexture(ItemTexture or self[slotName].EmptyTexture)
+			Slot:SetBackdropBorderColor(r, g, b)
+		end
+
+		self.SetItem = E:CopyTable({}, KI.CurrentInspectData.SetItem)
+		self.Character.AverageItemLevel:SetText(C.Toolkit.Color_Value(STAT_AVERAGE_ITEM_LEVEL)..' : '..format('%.2f', ItemTotal / ItemCount))
+	end
+
+	if needUpdate then
+		self.GearUpdated = needUpdate
+
+		return true
+	end
+	self.GearUpdated = nil
+
+	r, g, b = RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b
+
+	do --<< Basic Information >>--
+		self.Name:SetText('|c'..RAID_CLASS_COLORS[DataTable.Class].colorStr..DataTable.Name)
+		self.Title:SetText((DataTable.Realm and DataTable.Realm ~= E.myrealm and DataTable.Realm..L[" Server's "] or '')..'|cff93daff'..(DataTable.Title and string.gsub(DataTable.Title, DataTable.Name, '') or ''))
+		self.LevelRace:SetText(format('|cff%02x%02x%02x%s|r '..LEVEL..'|n%s', GetQuestDifficultyColor(DataTable.Level).r * 255, GetQuestDifficultyColor(DataTable.Level).g * 255, GetQuestDifficultyColor(DataTable.Level).b * 255, DataTable.Level, DataTable.Race))
+		self.Guild:SetText(DataTable.guildName and '<|cff2eb7e4'..DataTable.guildName..'|r>  [|cff2eb7e4'..DataTable.guildRankName..'|r]' or '')
+		self.ClassIcon:SetTexture('Interface\\ICONS\\ClassIcon_'..DataTable.Class..'.blp')
+	end
+
+	do --<< Color Setting >>--
+		self.Info.BG:SetBackdropBorderColor(r, g, b)
+
+		self.Info.Profession.IconSlot:SetBackdropBorderColor(r, g, b)
+		self.Info.Profession.Tab:SetBackdropColor(r, g, b, .3)
+		self.Info.Profession.Tab:SetBackdropBorderColor(r, g, b)
+		self.Info.Profession.Prof1.Bar:SetStatusBarColor(r, g, b)
+		self.Info.Profession.Prof2.Bar:SetStatusBarColor(r, g, b)
+
+		self.Info.Guild.IconSlot:SetBackdropBorderColor(r, g, b)
+		self.Info.Guild.Tab:SetBackdropColor(r, g, b, .3)
+		self.Info.Guild.Tab:SetBackdropBorderColor(r, g, b)
+
+		self.Info.PvP.IconSlot:SetBackdropBorderColor(r, g, b)
+		self.Info.PvP.Tab:SetBackdropColor(r, g, b, .3)
+		self.Info.PvP.Tab:SetBackdropBorderColor(r, g, b)
+	end
+
+	do --<< Information Page Setting >>--
+		do -- Profession
+			for i = 1, 2 do
+				if DataTable.Profession[i].Name then
+					self.Info.Profession:Show()
+					self.Info.Profession['Prof'..i].Name:SetText(DataTable.Profession[i].Name)
+					self.Info.Profession['Prof'..i].Level:SetText(DataTable.Profession[i].Level)
+					self.Info.Profession['Prof'..i].Bar:SetValue(DataTable.Profession[i].Level)
+				else
+					self.Info.Profession:Hide()
+					break
+				end
+			end
+		end
+
+		do -- Guild
+			if DataTable.guildName and DataTable.guildLevel and DataTable.guildNumMembers then
+				self.Info.Guild:Show()
+				self.Info.Guild.Banner.Name:SetText('|cff2eb7e4'..DataTable.guildName)
+				self.Info.Guild.Banner.LevelMembers:SetText('|cff77c0ff'..DataTable.guildLevel..'|r '..LEVEL..(DataTable.guildNumMembers > 0 and ' / '..format(INSPECT_GUILD_NUM_MEMBERS:gsub('%%d', '%%s'), '|cff77c0ff'..DataTable.guildNumMembers..'|r ') or ''))
+				SetSmallGuildTabardTextures('player', self.Info.Guild.Emblem, self.Info.Guild.BG, self.Info.Guild.Border, DataTable.guildEmblem)
+			else
+				self.Info.Guild:Hide()
+			end
+		end
+
+		KI:ReArrangeCategory()
+	end
+
+	do --<< Specialization Page Setting >>--
+		local SpecGroup, Name, Color, Texture, SpecRole
+
+		if DataTable.Specialization.ActiveSpec then
+			SpecGroup = DataTable.Specialization.ActiveSpec
+
+			for i = 2, MAX_TALENT_GROUPS do
+				self.Spec['Spec'..i]:Show()
+			end
+		else
+			SpecGroup = 1
+
+			for i = 2, MAX_TALENT_GROUPS do
+				self.Spec['Spec'..i]:Hide()
+			end
+		end
+
+		self.SpecIcon:SetTexture('Interface\\ICONS\\INV_Misc_QuestionMark.blp')
+		for i = 1, MAX_TALENT_GROUPS do
+			Color = '|cff808080'
+
+			Name = nil
+
+			if DataTable.Specialization[i].SpecializationID then
+				_, Name, _, Texture = GetSpecializationInfoByID(DataTable.Specialization[i].SpecializationID)
+
+				if Name then
+					SpecRole = C.ClassRole[DataTable.Class][Name].Role
+
+					if i == SpecGroup then
+						Color = C.ClassRole[DataTable.Class][Name].Color
+						self.SpecIcon:SetTexture(Texture)
+					end
+
+					Name = (SpecRole == 'Tank' and '|TInterface\\AddOns\\ElvUI\\media\\textures\\tank.tga:16:16:-3:0|t' or SpecRole == 'Healer' and '|TInterface\\AddOns\\ElvUI\\media\\textures\\healer.tga:16:16:-3:-1|t' or '|TInterface\\AddOns\\ElvUI\\media\\textures\\dps.tga:16:16:-2:-1|t')..Name
+				end
+			end
+
+			if not Name then
+				Texture, SpecRole = 'Interface\\ICONS\\INV_Misc_QuestionMark.blp', nil
+				Name = '|cff808080'..L['No Specialization']
+			end
+
+			self.Spec['Spec'..i].Tab.text:SetText(Color..Name)
+			self.Spec['Spec'..i].Texture:SetTexture(Texture)
+			self.Spec['Spec'..i].Texture:SetDesaturated(i ~= SpecGroup)
+		end
+
+		-- Talents
+		for i = 1, NUM_TALENT_COLUMNS * MAX_NUM_TALENT_TIERS do
+			Name, Texture = GetTalentInfo(i, true, nil, nil, DataTable.ClassID)
+
+			self.Spec['Talent'..i].Icon.Texture:SetTexture(Texture)
+			self.Spec['Talent'..i].text:SetText(Name)
+			self.Spec['Talent'..i].Tooltip.Link = GetTalentLink(i, true, DataTable.ClassID)
+		end
+	end
+
+	do --<< Model and Frame Setting When InspectUnit Changed >>--
+		if DataTable.UnitID and UnitIsVisible(DataTable.UnitID) then
+			self.Model:SetUnit(DataTable.UnitID)
+		else
+			self.Model:SetCustomRace(self.ModelList[DataTable.RaceID].RaceID, DataTable.GenderID - 2)
+			self.Model:TryOn(HeadSlotItem)
+			self.Model:TryOn(BackSlotItem)
+			self.Model:UndressSlot(self.HeadSlot.ID)
+			self.Model:UndressSlot(self.BackSlot.ID)
+			self.Model:Undress()
+
+			for _, slotName in pairs(C.GearList) do
+				if DataTable.Gear[slotName].ItemLink then
+					if type(DataTable.Gear[slotName].Transmogrify) == 'number' then
+						self.Model:TryOn(DataTable.Gear[slotName].Transmogrify)
+					elseif not (DataTable.Gear[slotName].Transmogrify and DataTable.Gear[slotName].Transmogrify == 'NotDisplayed') then
+						self.Model:TryOn(DataTable.Gear[slotName].ItemLink)
+					end
+				end
+			end
+		end
+
+		if not (self.LastDataSetting and self.LastDataSetting == DataTable.Name..(DataTable.Realm and '-'..DataTable.Realm or '')) then
+			self.Model:SetPosition(self.ModelList[DataTable.RaceID][DataTable.GenderID] and self.ModelList[DataTable.RaceID][DataTable.GenderID].z or 0, self.ModelList[DataTable.RaceID][DataTable.GenderID] and self.ModelList[DataTable.RaceID][DataTable.GenderID].x or 0, self.ModelList[DataTable.RaceID][DataTable.GenderID] and self.ModelList[DataTable.RaceID][DataTable.GenderID].y or 0)
+			self.Model:SetFacing(-5.67)
+			self.Model:SetPortraitZoom(1)
+			self.Model:SetPortraitZoom(0)
+
+			self:ChangePage('CharacterButton')
+			self.ClassIconSlot:SetBackdropBorderColor(RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b)
+			self.SpecIconSlot:SetBackdropBorderColor(RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b)
+
+			self:ToggleSpecializationTab(DataTable.Specialization.ActiveSpec or 1, DataTable)
+		elseif not (self.LastActiveSpec and self.LastActiveSpec == (DataTable.Specialization.ActiveSpec or 1)) then
+			self:ToggleSpecializationTab(DataTable.Specialization.ActiveSpec or 1, DataTable)
+		end
+	end
+
+	self.LastDataSetting = DataTable.Name..(DataTable.Realm and '-'..DataTable.Realm or '')
+end
+
+function KI:ReArrangeCategory()
+	local InfoPage_Height = 0
+	local PrevCategory
+
+	for _, CategoryType in pairs(self.InfoPageCategoryList) do
+		if self.Info[CategoryType]:IsShown() then
+			if self.Info[CategoryType].Closed then
+				InfoPage_Height = InfoPage_Height + INFO_TAB_SIZE + SPACING * 2
+				self.Info[CategoryType]:Height(INFO_TAB_SIZE + SPACING * 2)
+			else
+				InfoPage_Height = InfoPage_Height + self.Info[CategoryType].CategoryHeight
+				self.Info[CategoryType]:Height(self.Info[CategoryType].CategoryHeight)
+			end
+
+			if PrevCategory then
+				InfoPage_Height = InfoPage_Height + SPACING * 2
+				self.Info[CategoryType]:Point('TOP', PrevCategory, 'BOTTOM', 0, -SPACING * 2)
+			else
+				self.Info[CategoryType]:Point('TOP', self.Info.Page)
+			end
+
+			PrevCategory = self.Info[CategoryType]
+		end
+	end
+
+	self.Info.Page:Height(InfoPage_Height)
+	self.ScrollFrame_OnMouseWheel(self.Info, 0)
+end
+
+
+function KI:ToggleSpecializationTab(Group, DataTable)
+	local r, g, b
+	self.LastActiveSpec = DataTable.Specialization.ActiveSpec or 1
+
+	for i = 1, MAX_TALENT_GROUPS do
+		if i == Group then
+			self.Spec['Spec'..i].BottomLeftBorder:Show()
+			self.Spec['Spec'..i].BottomRightBorder:Show()
+			self.Spec['Spec'..i].Tab:SetFrameLevel(CoreFrameLevel + 3)
+			self.Spec['Spec'..i].Tab.text:Point('BOTTOMRIGHT', 0, -10)
+		else
+			self.Spec['Spec'..i].BottomLeftBorder:Hide()
+			self.Spec['Spec'..i].BottomRightBorder:Hide()
+			self.Spec['Spec'..i].Tab:SetFrameLevel(CoreFrameLevel + 2)
+			self.Spec['Spec'..i].Tab.text:Point('BOTTOMRIGHT', 0, 0)
+		end
+	end
+
+	if Group == self.LastActiveSpec then
+		r, g, b = RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b
+	else
+		r, g, b = .4, .4, .4
+	end
+
+	self.Spec.BottomBorder:SetTexture(r, g, b)
+	self.Spec.LeftBorder:SetTexture(r, g, b)
+	self.Spec.RightBorder:SetTexture(r, g, b)
+
+	local LevelTable = CLASS_TALENT_LEVELS[DataTable.Class] or CLASS_TALENT_LEVELS.DEFAULT
+	for i = 1, MAX_NUM_TALENT_TIERS do
+		for k = 1, NUM_TALENT_COLUMNS do
+			if DataTable.Specialization[Group]['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)] then
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropColor(r, g, b, .3)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropBorderColor(r, g, b)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:SetBackdropBorderColor(r, g, b)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetDesaturated(0)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:SetTextColor(1, 1, 1)
+			else
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropColor(.1, .1, .1)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropBorderColor(0, 0, 0)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:SetBackdropBorderColor(0, 0, 0)
+				self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetDesaturated(1)
+
+				if DataTable.Level < LevelTable[i] then
+					self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:SetTextColor(.7, .3, .3)
+				else
+					self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:SetTextColor(.5, .5, .5)
+				end
+			end
+		end
+	end
+
+	local Name, Texture
+	for i = 1, NUM_GLYPH_SLOTS do
+		Name, _, Texture = GetSpellInfo(DataTable.Glyph[Group]['Glyph'..i..'SpellID'])
+
+		self.Spec['Glyph'..i].text:SetJustifyH('LEFT')
+		self.Spec['Glyph'..i].text:SetText(Name)
+		self.Spec['Glyph'..i].Icon.Texture:SetTexture(Texture)
+		self.Spec['Glyph'..i].Tooltip.Link = DataTable.Glyph[Group]['Glyph'..i..'ID'] ~= 0 and GetGlyphLinkByID(DataTable.Glyph[Group]['Glyph'..i..'ID'])
+
+		if DataTable.Glyph[Group]['Glyph'..i..'SpellID'] ~= 0 then
+			self.Spec['Glyph'..i]:SetBackdropColor(r, g, b, .3)
+			self.Spec['Glyph'..i]:SetBackdropBorderColor(r, g, b)
+			self.Spec['Glyph'..i].Icon:SetBackdropBorderColor(r, g, b)
+		else
+			self.Spec['Glyph'..i]:SetBackdropColor(.1, .1, .1)
+			self.Spec['Glyph'..i]:SetBackdropBorderColor(0, 0, 0)
+			self.Spec['Glyph'..i].Icon:SetBackdropBorderColor(0, 0, 0)
+
+			if self.Spec['Glyph'..i].NeedLevel > DataTable.Level then
+				self.Spec['Glyph'..i].text:SetJustifyH('CENTER')
+				self.Spec['Glyph'..i].text:SetText(E:RGBToHex(.7, .3, .3)..self.Spec['Glyph'..i].NeedLevel..' '..LEVEL)
+			end
+		end
+	end
+
+	for i = 1, MAX_TALENT_GROUPS do
+		if i == self.LastActiveSpec then
+			r, g, b = RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b
+		else
+			r, g, b = .3, .3, .3
+		end
+
+		self.Spec['Spec'..i].TopBorder:SetTexture(r, g, b)
+		self.Spec['Spec'..i].LeftBorder:SetTexture(r, g, b)
+		self.Spec['Spec'..i].RightBorder:SetTexture(r, g, b)
+		self.Spec['Spec'..i].BottomLeftBorder:SetTexture(r, g, b)
+		self.Spec['Spec'..i].BottomRightBorder:SetTexture(r, g, b)
+		self.Spec['Spec'..i].Icon:SetBackdropBorderColor(r, g, b)
+	end
+end
+
+UnitPopupButtons.KnightInspect = { ['text'] = L['KnightInspect'], ['dist'] = 0, }
+
+function IFO:Initialize()
+	-- if not E.private.sle.Armory.Inspect.Enable then return end
+
+	Default_NotifyInspect = _G['NotifyInspect']
+	Default_InspectUnit = _G['InspectUnit']
+
+	if KI.CreateInspectFrame then
+		KI:CreateInspectFrame()
+	end
+
+	_G['NotifyInspect'] = ENI.NotifyInspect or _G['NotifyInspect']
+	_G['InspectUnit'] = KI.InspectUnit
+
+	tinsert(UnitPopupMenus.FRIEND, 5, 'KnightInspect')
+	tinsert(UnitPopupMenus.GUILD, 5, 'KnightInspect')
+	tinsert(UnitPopupMenus.RAID, 12, 'KnightInspect')
+	tinsert(UnitPopupMenus.FOCUS, 5, 'KnightInspect')
+	for _, GroupType in pairs({ 'PLAYER', 'PARTY' }) do
+		for Index, MenuType in pairs(UnitPopupMenus[GroupType]) do
+			if MenuType == 'INSPECT' then
+				UnitPopupMenus[GroupType][Index] = 'KnightInspect'
+				break
+			end
+		end
+	end
+
+	KI.Activate = true
+end
+E:RegisterModule(IFO:GetName())
\ No newline at end of file
diff --git a/ElvUI_SLE/modules/characterframe/load_characterframe.xml b/ElvUI_SLE/modules/characterframe/load_characterframe.xml
index b0a0edd..1d836d4 100755
--- a/ElvUI_SLE/modules/characterframe/load_characterframe.xml
+++ b/ElvUI_SLE/modules/characterframe/load_characterframe.xml
@@ -1,8 +1,8 @@
 <Ui xmlns="http://www.blizzard.com/wow/ui/">
 	<Script file='core.lua'/>
+	<Script file='communication.lua'/>
+	<Script file='notifyinspect.lua'/>
 	<Script file='characterframe.lua'/>
-	<Script file='durability.lua'/>
-	<Script file='itemlevel.lua'/>
-	<Script file='enchant.lua'/>
+	<Script file='inspectframe.lua'/>
 	<Script file='options.lua'/>
 </Ui>
\ No newline at end of file
diff --git a/ElvUI_SLE/modules/characterframe/notifyinspect.lua b/ElvUI_SLE/modules/characterframe/notifyinspect.lua
new file mode 100644
index 0000000..3b1d1d7
--- /dev/null
+++ b/ElvUI_SLE/modules/characterframe/notifyinspect.lua
@@ -0,0 +1,121 @@
+local type, tinsert = type, tinsert
+local ENI = _G['EnhancedNotifyInspectFrame']
+
+if not ENI then
+	local BlizzardNotifyInspect = _G['NotifyInspect']
+	local playerRealm = GetRealmName()
+
+	ENI = CreateFrame('Frame', 'EnhancedNotifyInspectFrame', UIParent)
+	ENI.UpdatedTime = 0
+	ENI.UpdateInterval = 1
+	ENI.InspectList = {}
+	ENI:SetScript('OnEvent', function(self, Event, ...)
+		if self[Event] then
+			self[Event](...)
+		end
+	end)
+	ENI:Hide()
+
+	ENI.TryInspect = function()
+		if ENI.InspectList[1] and ENI.InspectList[(ENI.InspectList[1])] then
+			local CurrentUnitGUID = UnitGUID(ENI.InspectList[(ENI.InspectList[1])].UnitID)
+
+			if CurrentUnitGUID and not (ENI.CurrentInspectUnitGUID and CurrentUnitGUID ~= ENI.CurrentInspectUnitGUID) then
+				ENI.CurrentInspectUnitGUID = CurrentUnitGUID
+				BlizzardNotifyInspect(ENI.InspectList[(ENI.InspectList[1])].UnitID)
+			else
+				ENI.CancelInspect(ENI.InspectList[1])
+			end
+			return
+		end
+
+		ENI.UpdatedTime = 0
+		ENI:Hide()
+	end
+
+	ENI.NotifyInspect = function(Unit, InspectFirst)
+		if Unit ~= 'target' and UnitIsUnit(Unit, 'target') then
+			Unit = 'target'
+		end
+
+		if Unit ~= 'focus' and UnitIsUnit(Unit, 'focus') then
+			Unit = 'focus'
+		end
+
+		if UnitInParty(Unit) or UnitInRaid(Unit) then
+			Unit = GetUnitName(Unit, true)
+		end
+
+		if UnitIsPlayer(Unit) and CanInspect(Unit) then
+			local TableIndex = GetUnitName(Unit, true)
+
+			if not ENI.InspectList[TableIndex] then
+				if InspectFirst then
+					tinsert(ENI.InspectList, 1, TableIndex)
+				else
+					tinsert(ENI.InspectList, TableIndex)
+				end
+
+				ENI.InspectList[TableIndex] = {
+					['Index'] = InspectFirst and 1 or #ENI.InspectList,
+					['UnitID'] = Unit,
+					['CancelInspectByManual'] = InspectFirst,
+				}
+				ENI.CurrentInspectUnitGUID = UnitGUID(Unit)
+				--ENI.TryInspect()
+				ENI:Show()
+			elseif InspectFirst and ENI.InspectList[TableIndex] then
+				ENI.CancelInspect(TableIndex)
+				ENI.NotifyInspect(Unit, InspectFirst)
+			end
+		end
+
+		return Unit
+	end
+
+	ENI.CancelInspect = function(Unit)
+		if ENI.InspectList[Unit] then
+			if ENI.InspectList[Unit].Index == 1 then
+				ENI.CurrentInspectUnitGUID = nil
+			end
+
+			tremove(ENI.InspectList, ENI.InspectList[Unit].Index)
+			ENI.CurrentInspectUnitGUID = nil
+			ENI.InspectList[Unit] = nil
+		end
+	end
+
+	ENI.INSPECT_READY = function(InspectedUnitGUID)
+		if InspectedUnitGUID == ENI.CurrentInspectUnitGUID then
+			local Name, Realm
+			_, _, _, _, _, Name, Realm = GetPlayerInfoByGUID(InspectedUnitGUID)
+			Name = Name..(Realm and Realm ~= '' and Realm ~= playerRealm and '-'..Realm or '')
+
+			if ENI.InspectList[Name] then
+				if ENI.InspectList[Name].CancelInspectByManual then
+					return
+				end
+
+				ENI.CancelInspect(Name)
+				ENI.UpdatedTime = 0
+			end
+
+			ENI.CurrentInspectUnitGUID = nil
+		end
+	end
+	ENI:RegisterEvent('INSPECT_READY')
+
+	ENI.Updater = function(_, elapsed)
+		ENI.UpdatedTime = ENI.UpdatedTime + elapsed
+
+		if ENI.UpdatedTime < 0 then
+			return
+		else
+			ENI.UpdatedTime = -ENI.UpdateInterval
+		end
+
+		ENI.TryInspect()
+	end
+
+	ENI:SetScript('OnUpdate', ENI.Updater)
+end
\ No newline at end of file