diff --git a/ElvUI_SLE/modules/characterframe/communication.lua b/ElvUI_SLE/modules/characterframe/communication.lua new file mode 100644 index 0000000..f83acf5 --- /dev/null +++ b/ElvUI_SLE/modules/characterframe/communication.lua @@ -0,0 +1,891 @@ +-------------------------------------------------------------------------------- +--<< AISM : Surpport Module for Armory Inspecting >>-- +-------------------------------------------------------------------------------- +local AISM = _G['Armory_InspectSupportModule'] + +if not AISM then + local ItemSetBonusKey = ITEM_SET_BONUS:gsub('%%s', '(.+)') + local ProfessionLearnKey = ERR_LEARN_ABILITY_S:gsub('%%s', '(.+)') + local ProfessionLearnKey2 = ERR_LEARN_RECIPE_S:gsub('%%s', '(.+)') + local ProfessionUnlearnKey = ERR_SPELL_UNLEARNED_S:gsub('%%s', '(.+)') + + local playerName = UnitName('player') + local playerRealm = GetRealmName() + local _, playerClass, playerClassID = UnitClass('player') + local playerRace, playerRaceID = UnitRace('player') + local playerSex = UnitSex('player') + local isHelmDisplayed = ShowingHelm() == 1 + local isCloakDisplayed = ShowingCloak() == 1 + + --<< Create Core >>-- + AISM = CreateFrame('Frame', 'Armory_InspectSupportModule', UIParent) + AISM.Version = 1.0 + AISM.Tooltip = CreateFrame('GameTooltip', 'AISM_Tooltip', nil, 'GameTooltipTemplate') + AISM.Tooltip:SetOwner(UIParent, 'ANCHOR_NONE') + AISM.Updater = CreateFrame('Frame', 'AISM_Updater', UIParent) + + AISM.SendMessageDelay = 2 + AISM.SendDataGroupUpdated = AISM.SendMessageDelay + AISM.SendDataGuildUpdated = AISM.SendMessageDelay + + AISM.PlayerData = {} + AISM.PlayerData_ShortString = {} + AISM.GroupMemberData = {} + AISM.GuildMemberData = {} + AISM.CurrentInspectData = {} + AISM.InspectRegistered = {} + AISM.RemainMessage = {} + AISM.RegisteredFunction = {} + + --<< Define Key Table >>-- + AISM.ProfessionList = { + [GetSpellInfo(110396)] = 'BS', -- BlackSmithing + [GetSpellInfo(110400)] = 'EC', -- Enchanting + [GetSpellInfo(110403)] = 'EG', -- Engineering + [GetSpellInfo(110417)] = 'IS', -- Inscription + [GetSpellInfo(110420)] = 'JC', -- JewelCrafting + [GetSpellInfo(110423)] = 'LW', -- LeatherWorking + [GetSpellInfo(110426)] = 'TL', -- Tailoring + } + AISM.GearList = { + ['HeadSlot'] = 'HE', + ['NeckSlot'] = 'NK', + ['ShoulderSlot'] = 'SD', + ['BackSlot'] = 'BK', + ['ChestSlot'] = 'CH', + ['ShirtSlot'] = 'ST', + ['TabardSlot'] = 'TB', + ['WristSlot'] = 'WR', + ['HandsSlot'] = 'HD', + ['WaistSlot'] = 'WA', + ['LegsSlot'] = 'LE', + ['FeetSlot'] = 'FE', + ['Finger0Slot'] = 'FG0', + ['Finger1Slot'] = 'FG1', + ['Trinket0Slot'] = 'TR0', + ['Trinket1Slot'] = 'TR1', + ['MainHandSlot'] = 'MH', + ['SecondaryHandSlot'] = 'SH', + } + AISM.CanTransmogrifySlot = { + ['HeadSlot'] = true, + ['ShoulderSlot'] = true, + ['BackSlot'] = true, + ['ChestSlot'] = true, + ['WristSlot'] = true, + ['HandsSlot'] = true, + ['WaistSlot'] = true, + ['LegsSlot'] = true, + ['FeetSlot'] = true, + ['MainHandSlot'] = true, + ['SecondaryHandSlot'] = true, + } + AISM.DataTypeTable = { + ['PLI'] = 'PlayerInfo', + ['GLD'] = 'GuildInfo', + ['PF1'] = 'Profession', + ['PF2'] = 'Profession', + ['ASP'] = 'ActiveSpec', + ['SID'] = 'SetItemData', + } + + for groupNum = 1, MAX_TALENT_GROUPS do + AISM.DataTypeTable['SP'..groupNum] = 'Specialization' + AISM.DataTypeTable['GL'..groupNum] = 'Glyph' + end + + for _, keyName in pairs(AISM.GearList) do + AISM.DataTypeTable[keyName] = 'Gear' + end + + --<< Player Data Updater Core >>-- + local needUpdate, SystemMessage, isPlayer + AISM.Updater:SetScript('OnUpdate', function(self) + AISM.UpdatedData = needUpdate and AISM.UpdatedData or {} + needUpdate = nil + + if not self.ProfessionUpdated then + needUpdate = AISM:GetPlayerProfessionSetting() or needUpdate + end + + if not self.SpecUpdated then + needUpdate = AISM:GetPlayerSpecSetting() or needUpdate + end + + if not self.GlyphUpdated then + needUpdate = AISM:GetPlayerGlyphString() or needUpdate + end + + if not self.GearUpdated then + needUpdate = AISM:GetPlayerGearString() or needUpdate + end + + if not needUpdate then + self:Hide() + + if self.Initialize then + for _ in pairs(AISM.UpdatedData) do + if AISM.CurrentGroupMode and AISM.CurrentGroupMode ~= 'NoGroup' and AISM.CurrentGroupType then + AISM:SendData(AISM.UpdatedData) + end + break + end + end + end + end) + + AISM.Updater:SetScript('OnEvent', function(self, EventTag, ...) + if Event == 'COMBAT_LOG_EVENT_UNFILTERED' then + _, SystemMessage, _, _, _, _, _, _, isPlayer = ... + + if SystemMessage == 'ENCHANT_APPLIED' and isPlayer == playerName then + self.GearUpdated = nil + self:Show() + end + elseif Event == 'UNIT_INVENTORY_CHANGED' then + isPlayer = ... + + if isPlayer == 'player' then + self.GearUpdated = nil + self:Show() + end + elseif Event == 'CHAT_MSG_SYSTEM' then + SystemMessage = ... + + if SystemMessage:find(ProfessionLearnKey) or SystemMessage:find(ProfessionLearnKey2) or SystemMessage:find(ProfessionUnlearnKey) then + self.ProfessionUpdated = nil + self:Show() + end + elseif Event == 'ACTIVE_TALENT_GROUP_CHANGED' or Event == 'CHARACTER_POINTS_CHANGED' then + self.SpecUpdated = nil + self:Show() + elseif Event == 'GLYPH_ADDED' or Event == 'GLYPH_REMOVED' or Event == 'GLYPH_UPDATED' then + self.GlyphUpdated = nil + self:Show() + elseif Event == 'SOCKET_INFO_SUCCESS' or Event == 'PLAYER_EQUIPMENT_CHANGED' or Event == 'EQUIPMENT_SWAP_FINISHED' or Event == 'ITEM_UPGRADE_MASTER_UPDATE' or Event == 'TRANSMOGRIFY_UPDATE' then + self.GearUpdated = nil + self:Show() + end + end) + + AISM.UpdateHelmDisplaying = function(value) + isHelmDisplayed = value == '1' + AISM.Updater.GearUpdated = nil + AISM.Updater:Show() + end + hooksecurefunc('ShowHelm', AISM.UpdateHelmDisplaying) + + AISM.UpdateCloakDisplaying = function(value) + isCloakDisplayed = value == '1' + AISM.Updater.GearUpdated = nil + AISM.Updater:Show() + end + hooksecurefunc('ShowCloak', AISM.UpdateCloakDisplaying) + + --<< Profession String >>-- + function AISM:GetPlayerProfessionSetting() + local Profession1, Profession2 = GetProfessions() + local Profession1_Level, Profession2_Level = 0, 0 + + if Profession1 then + Profession1, _, Profession1_Level = GetProfessionInfo(Profession1) + + if self.ProfessionList[Profession1] then + Profession1 = self.ProfessionList[Profession1]..'/'..Profession1_Level + else + Profession1 = 'F' + end + end + + if Profession2 then + Profession2, _, Profession2_Level = GetProfessionInfo(Profession2) + + if self.ProfessionList[Profession2] then + Profession2 = self.ProfessionList[Profession2]..'/'..Profession2_Level + else + Profession2 = 'F' + end + end + + if self.PlayerData.Profession1 ~= Profession1 then + self.PlayerData.Profession1 = Profession1 + end + + if self.PlayerData.Profession2 ~= Profession2 then + self.PlayerData.Profession2 = Profession2 + end + + self.Updater.ProfessionUpdated = true + end + + AISM.Updater:RegisterEvent('CHAT_MSG_SYSTEM') + + --<< Specialization String >>-- + function AISM:GetPlayerSpecSetting() + local DataString, isSelected, selectedSlot + local ActiveSpec = GetActiveSpecGroup() + + for groupNum = 1, MAX_TALENT_GROUPS do + DataString = GetSpecialization(nil, nil, groupNum) + + if DataString then + DataString = GetSpecializationInfo(DataString) + else + DataString = '0' + end + + for i = 1, MAX_NUM_TALENT_TIERS do + selectedSlot = '0' + + for k = 1, NUM_TALENT_COLUMNS do + _, _, _, _, isSelected = GetTalentInfo((i - 1) * NUM_TALENT_COLUMNS + k, nil, groupNum) + + if isSelected then + selectedSlot = k + break + end + end + + DataString = DataString..'/'..selectedSlot + end + + if self.PlayerData['Spec'..groupNum] ~= DataString then + self.PlayerData['Spec'..groupNum] = DataString + end + + if groupNum == ActiveSpec and self.PlayerData_ShortString.Spec1 ~= DataString then + self.PlayerData_ShortString.Spec1 = DataString + self.UpdatedData.Spec1 = DataString + end + end + + isSelected = GetActiveSpecGroup() + + if self.PlayerData.ActiveSpec ~= ActiveSpec then + self.PlayerData.ActiveSpec = ActiveSpec + end + + self.Updater.SpecUpdated = true + end + AISM.Updater:RegisterEvent('ACTIVE_TALENT_GROUP_CHANGED') + AISM.Updater:RegisterEvent('CHARACTER_POINTS_CHANGED') + + --<< Glyph String >>-- + function AISM:GetPlayerGlyphString() + local ShortString, FullString + local ActiveSpec = GetActiveSpecGroup() + + local SpellID, GlyphID + for groupNum = 1, MAX_TALENT_GROUPS do + ShortString, FullString = '', '' + + for slotNum = 1, NUM_GLYPH_SLOTS do + _, _, _, SpellID, _, GlyphID = GetGlyphSocketInfo(slotNum, groupNum) + + ShortString = ShortString..(SpellID or '0')..(slotNum ~= NUM_GLYPH_SLOTS and '/' or '') + FullString = FullString..(SpellID or '0')..'_'..(GlyphID or '0')..(slotNum ~= NUM_GLYPH_SLOTS and '/' or '') + end + + if self.PlayerData['Glyph'..groupNum] ~= FullString then + self.PlayerData['Glyph'..groupNum] = FullString + end + + if groupNum == ActiveSpec and self.PlayerData_ShortString.Glyph1 ~= ShortString then + self.PlayerData_ShortString.Glyph1 = ShortString + self.UpdatedData.Glyph1 = ShortString + end + end + + self.Updater.GlyphUpdated = true + end + + AISM.Updater:RegisterEvent('GLYPH_ADDED') + AISM.Updater:RegisterEvent('GLYPH_REMOVED') + AISM.Updater:RegisterEvent('GLYPH_UPDATED') + + --<< Gear String >>-- + function AISM:GetPlayerGearString() + local ShortString, FullString + local CurrentSetItem = {} + + local slotID, slotLink, isTransmogrified, transmogrifiedItemID, SetName, GeatSetCount, SetItemMax, colorR, colorG, colorB, checkSpace, SetItemOptionNum, tooltipText + for slotName in pairs(self.GearList) do + slotID = GetInventorySlotInfo(slotName) + slotLink = GetInventoryItemLink('player', slotID) + + if slotLink and slotLink:find('%[%]') then -- sometimes itemLink is malformed so we need to update when crashed + self.Updater.GearUpdated = nil + + return true + end + + if slotLink and self.CanTransmogrifySlot[slotName] then + isTransmogrified, _, _, _, _, transmogrifiedItemID = GetTransmogrifySlotInfo(slotID) + else + isTransmogrified = nil + end + + if slotName == 'HeadSlot' or slotName == 'BackSlot' then + print(slotName..' : '..(slotName == 'HeadSlot' and not isHelmDisplayed and 'NotDisplayed' or slotName == 'BackSlot' and not isCloakDisplayed and 'NotDisplayed' or 'Displayed')) + end + + ShortString = slotLink and select(2, strsplit(':', slotLink)) or 'F' + FullString = (slotLink or 'F')..'/'..(slotName == 'HeadSlot' and not isHelmDisplayed and 'ND' or slotName == 'BackSlot' and not isCloakDisplayed and 'ND' or isTransmogrified and transmogrifiedItemID or '0') + + for i = 1, MAX_NUM_SOCKETS do + FullString = FullString..'/'..(select(i, GetInventoryItemGems(slotID)) or 0) + end + + if self.PlayerData[slotName] ~= FullString then + self.PlayerData[slotName] = FullString + end + + if self.PlayerData_ShortString[slotName] ~= ShortString then + self.PlayerData_ShortString[slotName] = ShortString + self.UpdatedData[slotName] = ShortString + end + + if slotLink then + self.Tooltip:ClearLines() + self.Tooltip:SetInventoryItem('player', slotID) + + checkSpace = 2 + + for i = 1, self.Tooltip:NumLines() do + SetName, SetItemCount, SetItemMax = _G['AISM_TooltipTextLeft'..i]:GetText():match('^(.+) %((%d)/(%d)%)$') -- find string likes 'SetName (0/5)' + + if SetName then + SetItemCount = tonumber(SetItemCount) + SetItemMax = tonumber(SetItemMax) + + if SetItemCount > SetItemMax or SetItemMax == 1 then + self.Updater.GearUpdated = nil + + return true + elseif CurrentSetItem[SetName] then + break + else + CurrentSetItem[SetName] = true + ShortString = 0 + FullString = '' + + for k = 1, self.Tooltip:NumLines() do + tooltipText = _G['AISM_TooltipTextLeft'..(i+k)]:GetText() + + if tooltipText == ' ' then + checkSpace = checkSpace - 1 + + if checkSpace == 0 then break end + elseif checkSpace == 2 then + colorR, colorG, colorB = _G['AISM_TooltipTextLeft'..(i+k)]:GetTextColor() + + if colorR > LIGHTYELLOW_FONT_COLOR.r - .01 and colorR < LIGHTYELLOW_FONT_COLOR.r + .01 and colorG > LIGHTYELLOW_FONT_COLOR.g - .01 and colorG < LIGHTYELLOW_FONT_COLOR.g + .01 and colorB > LIGHTYELLOW_FONT_COLOR.b - .01 and colorB < LIGHTYELLOW_FONT_COLOR.b + .01 then + ShortString = ShortString + 1 + tooltipText = LIGHTYELLOW_FONT_COLOR_CODE..tooltipText + else + tooltipText = GRAY_FONT_COLOR_CODE..tooltipText + end + --print(tooltipText..' / '..SetItemCount..' / '..SetItemMax) + + FullString = FullString..'/'..tooltipText + elseif tooltipText:find(ItemSetBonusKey) then + FullString = FullString..'/'..(tooltipText:match("^%((%d)%)%s.+:%s.+$") or 'T') + end + end + + self.PlayerData.SetItem = self.PlayerData.SetItem or {} + if self.PlayerData.SetItem[SetName] ~= FullString then + self.PlayerData.SetItem[SetName] = FullString + end + + self.PlayerData_ShortString.SetItem = self.PlayerData_ShortString.SetItem or {} + if self.PlayerData_ShortString.SetItem[SetName] ~= ShortString then + self.PlayerData_ShortString.SetItem[SetName] = ShortString + + self.UpdatedData.SetItem = self.UpdatedData.SetItem or {} + self.UpdatedData.SetItem[SetName] = ShortString + end + + break + end + end + + if checkSpace == 0 then break end + end + end + end + + -- Clear cache when there's no gear set + if self.PlayerData.SetItem then + for SetName in pairs(self.PlayerData.SetItem) do + if not CurrentSetItem[SetName] then + self.PlayerData.SetItem[SetName] = nil + + self.PlayerData_ShortString.SetItem[SetName] = nil + self.UpdatedData.SetItem = self.UpdatedData.SetItem or {} + self.UpdatedData.SetItem[SetName] = 'F' + end + end + end + + self.Updater.GearUpdated = true + + return nil + end + + AISM.Updater:RegisterEvent('SOCKET_INFO_SUCCESS') + AISM.Updater:RegisterEvent('PLAYER_EQUIPMENT_CHANGED') + --AISM.Updater:RegisterEvent('UNIT_INVENTORY_CHANGED') + --AISM.Updater:RegisterEvent('EQUIPMENT_SWAP_FINISHED') + AISM.Updater:RegisterEvent('ITEM_UPGRADE_MASTER_UPDATE') + AISM.Updater:RegisterEvent('TRANSMOGRIFY_UPDATE') + AISM.Updater:RegisterEvent('COMBAT_LOG_EVENT_UNFILTERED') + + --<< Player Info >>-- + function AISM:SettingInspectData(TableToSave) + local guildName, guildRankName = GetGuildInfo('player') + + TableToSave.PlayerInfo = playerName..'_'..UnitPVPName('player')..'/'..playerRealm..'/'..UnitLevel('player')..'/'..playerClass..'/'..playerClassID..'/'..playerRace..'/'..playerRaceID..'/'..playerSex..(guildName and '/'..guildName..'/'..guildRankName or '') + + if IsInGuild() then + TableToSave.GuildInfo = GetGuildLevel()..'/'..GetNumGuildMembers() + + for _, DataString in ipairs({ GetGuildLogoInfo('player') }) do + TableToSave.GuildInfo = TableToSave.GuildInfo..'/'..DataString + end + end + end + + + function AISM:SendData(InputData, Prefix, Channel, WhisperTarget) + Channel = Channel or IsInGroup(LE_PARTY_CATEGORY_INSTANCE) and 'INSTANCE_CHAT' or string.upper(self.CurrentGroupMode) + Prefix = Prefix or 'AISM' + + if not InputData or type(InputData) ~= 'table' or Channel == 'NOGROUP' then return end + + local Data = {} + + if InputData.Profession1 then + Data[#Data + 1] = 'PF1:'..InputData.Profession1 + end + + if InputData.Profession2 then + Data[#Data + 1] = 'PF2:'..InputData.Profession2 + end + + for groupNum = 1, MAX_TALENT_GROUPS do + if InputData['Spec'..groupNum] then + Data[#Data + 1] = 'SP'..groupNum..':'..InputData['Spec'..groupNum] + end + end + + if InputData.ActiveSpec then + Data[#Data + 1] = 'ASP:'..InputData.ActiveSpec + end + + for groupNum = 1, MAX_TALENT_GROUPS do + if InputData['Glyph'..groupNum] then + Data[#Data + 1] = 'GL'..groupNum..':'..InputData['Glyph'..groupNum] + end + end + + for slotName, keyName in pairs(self.GearList) do + if InputData[slotName] then + Data[#Data + 1] = keyName..':'..InputData[slotName] + end + end + + if InputData.SetItem then + for SetName, DataString in pairs(InputData.SetItem) do + Data[#Data + 1] = 'SID:'..SetName..(type(DataString) == 'number' and '/' or '')..DataString + end + end + + if InputData.PlayerInfo then + Data[#Data + 1] = 'PLI:'..InputData.PlayerInfo + end + + if InputData.GuildInfo then + Data[#Data + 1] = 'GLD:'..InputData.GuildInfo + end + + local DataString = '' + local stringLength = 0 + local dataLength + + for dataTag, dataText in pairs(Data) do + DataString = DataString..'{'..dataText..'}' + dataLength = strlen(dataText) + 2 + + if stringLength + dataLength <= 255 then + stringLength = stringLength + dataLength + else + while strlen(DataString) > 255 do + SendAddonMessage(Prefix, strsub(DataString, 1, 255), Channel, WhisperTarget) + + DataString = strsub(DataString, 256) + stringLength = strlen(DataString) + end + end + end + + if DataString ~= '' then + SendAddonMessage(Prefix, DataString, Channel, WhisperTarget) + end + end + + function AISM:GetPlayerCurrentGroupMode() + if not (IsInGroup() or IsInRaid()) or GetNumGroupMembers() == 1 then + self.CurrentGroupMode = 'NoGroup' + self.GroupMemberData = {} + else + if IsInRaid() then + self.CurrentGroupMode = 'raid' + else + self.CurrentGroupMode = 'party' + end + + for userName in pairs(self.GroupMemberData) do + if not UnitExists(userName) or not UnitIsConnected(userName) then + self.GroupMemberData[userName] = nil + end + end + end + + return self.CurrentGroupMode + end + + function AISM:GetCurrentInstanceType() + local _, instanceType, difficultyID = GetInstanceInfo() + + if difficultyID == 8 then + self.InstanceType = 'challenge' + else + self.InstanceType = instanceType == 'none' and 'field' or instanceType + end + end + + local LastSendGroupType = 'NoGroup' + local LastSendInstanceType = 'field' + AISM:SetScript('OnUpdate', function(self, elapsed) + if not self.Initialize then + SendAddonMessage('AISM', 'AISM_Initialize', 'WHISPER', playerName) + else + if self.CurrentGroupMode and self.InstanceType then + if LastSendGroupType ~= self.CurrentGroupMode or LastSendInstanceType ~= self.InstanceType or self.needSendDataGroup ~= nil then + LastSendGroupType = self.CurrentGroupMode + LastSendInstanceType = self.InstanceType + + if self.CurrentGroupMode ~= 'NoGroup' then + local Name, TableIndex + + for i = 1, MAX_RAID_MEMBERS do + Name = UnitName(self.CurrentGroupMode..i) + TableIndex = GetUnitName(self.CurrentGroupMode..i, true) + + if Name and not UnitIsUnit('player', self.CurrentGroupMode..i) then + if Name == UNKNOWNOBJECT or Name == COMBATLOG_UNKNOWN_UNIT then + if self.needSendDataGroup == nil then + self.needSendDataGroup = false + end + elseif not UnitIsConnected(self.CurrentGroupMode..i) then + self.GroupMemberData[TableIndex] = nil + elseif not self.GroupMemberData[TableIndex] then + self.needSendDataGroup = true + + self.GroupMemberData[TableIndex] = true + end + end + end + else + self.needSendDataGroup = nil + self.SendDataGroupUpdated = self.SendMessageDelay + end + end + + if self.needSendDataGroup and self.Updater.SpecUpdated and self.Updater.GlyphUpdated and self.Updater.GearUpdated then + self.SendDataGroupUpdated = self.SendDataGroupUpdated - elapsed + + if self.SendDataGroupUpdated < 0 then + self.SendDataGroupUpdated = self.SendMessageDelay + + self:SendData(self.PlayerData_ShortString) + self.needSendDataGroup = nil + end + end + end + + if self.needSendDataGuild then + self.SendDataGuildUpdated = self.SendDataGuildUpdated - elapsed + + if self.SendDataGuildUpdated < 0 then + self.SendDataGuildUpdated = self.SendMessageDelay + + SendAddonMessage('AISM', 'AISM_GUILD_RegistME', 'GUILD') + print('길드? AISM_GUILD_RegistME 전송') + self.needSendDataGuild = nil + end + end + + if self.needSendDataGroup == nil and self.needSendDataGuild == nil then + self:Hide() -- close function + end + end + end) + + function AISM:PrepareTableSetting(Prefix, Sender) + if Prefix == 'AISM' then + local NeedResponse + + if type(self.GroupMemberData[Sender]) ~= 'table' then + self.GroupMemberData[Sender] = {} + + NeedResponse = true + end + + return self.GroupMemberData[Sender], NeedResponse + else + return self.CurrentInspectData[Sender] + end + end + + local SenderRealm + function AISM:Receiver(Prefix, Message, Channel, Sender) + Sender, SenderRealm = strsplit('-', Sender) + Sender = Sender..(SenderRealm and SenderRealm ~= '' and SenderRealm ~= playerRealm and '-'..SenderRealm or '') + + print('|cffceff00['..Channel..']|r|cff2eb7e4['..Prefix..']|r '..Sender..' : ') + print(Message) + + if Message == 'AISM_GUILD_RegistME' then + self.GuildMemberData[Sender] = true + SendAddonMessage('AISM', 'AISM_GUILD_RegistResponse', SenderRealm == playerRealm and 'WHISPER' or 'GUILD', Sender) + elseif Message == 'AISM_GUILD_RegistResponse' then + self.GuildMemberData[Sender] = true + elseif Message == 'AISM_GUILD_UnregistME' then + self.GuildMemberData[Sender] = nil + self.CurrentInspectData[Sender] = nil + elseif Message:find('AISM_DataRequestForInspecting:') then + local needplayerName, needplayerRealm = Message:match('^.+:(.+)-(.+)$') + + if needplayerName == playerName and needplayerRealm == playerRealm then + --local DataToSend = E:CopyTable({}, self.PlayerData) + local TableToSend = {} + + for Index, Data in pairs(self.PlayerData) do + TableToSend[Index] = Data + end + + self:SettingInspectData(DataToSend) + + self:SendData(DataToSend, Prefix, Channel, Sender) + end + else + local TableToSave, NeedResponse, Group, stringTable + + TableToSave, NeedResponse = self:PrepareTableSetting(Prefix, Sender) + + if not TableToSave then + self.RemainMessage[Sender] = nil + + return + else + Message = (self.RemainMessage[Sender] or '')..Message + + for DataType, DataString in Message:gmatch('%{(.-):(.-)%}') do + if self.DataTypeTable[DataType] then + Message = string.gsub(Message, '%{'..DataType..':.-%}', '') + Group = DataType:match('^.+(%d)$') + stringTable = { strsplit('/', DataString) } + + for Index, Data in pairs(stringTable) do + if tonumber(Data) then + stringTable[Index] = tonumber(Data) + end + end + + if Group and self.DataTypeTable[DataType] ~= 'Gear' then -- Prepare group setting + Group = tonumber(Group) + TableToSave[(self.DataTypeTable[DataType])] = TableToSave[(self.DataTypeTable[DataType])] or {} + TableToSave[(self.DataTypeTable[DataType])][Group] = TableToSave[(self.DataTypeTable[DataType])][Group] or {} + end + + if self.DataTypeTable[DataType] == 'Profession' then + if stringTable[1] == 'F' then + --TableToSave.Profession[Group] = {} + TableToSave.Profession[Group].Name = EMPTY + TableToSave.Profession[Group].Level = 0 + else + for localeName, Key in pairs(self.ProfessionList) do + if Key == stringTable[1] then + TableToSave.Profession[Group].Name = localeName + break + end + end + TableToSave.Profession[Group].Level = stringTable[2] + end + elseif self.DataTypeTable[DataType] == 'Specialization' then + TableToSave.Specialization[Group].SpecializationID = stringTable[1] + + for i = 1, MAX_NUM_TALENT_TIERS do + for k = 1, NUM_TALENT_COLUMNS do + TableToSave.Specialization[Group]['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)] = k == stringTable[i + 1] and true or false + end + end + elseif self.DataTypeTable[DataType] == 'ActiveSpec' then + TableToSave.Specialization = TableToSave.Specialization or {} + TableToSave.Specialization.ActiveSpec = tonumber(DataString) + elseif self.DataTypeTable[DataType] == 'Glyph' then + local SpellID, GlyphID + for i = 1, #stringTable do + SpellID, GlyphID = strsplit('_', stringTable[i]) + + TableToSave.Glyph[Group]['Glyph'..i..'SpellID'] = tonumber(SpellID) + TableToSave.Glyph[Group]['Glyph'..i..'ID'] = tonumber(GlyphID) + end + elseif self.DataTypeTable[DataType] == 'Gear' then + TableToSave.Gear = TableToSave.Gear or {} + + for slotName, keyName in pairs(self.GearList) do + if keyName == DataType then + DataType = slotName + break + end + end + + TableToSave.Gear[DataType] = { + ['ItemLink'] = stringTable[1] ~= 'F' and stringTable[1], + ['Transmogrify'] = stringTable[2] == 'ND' and 'NotDisplayed' or stringTable[2] ~= 0 and stringTable[2], + ['Gem1'] = stringTable[3] ~= 0 and stringTable[3], + ['Gem2'] = stringTable[4] ~= 0 and stringTable[4], + ['Gem3'] = stringTable[5] ~= 0 and stringTable[5], + } + elseif self.DataTypeTable[DataType] == 'SetItemData' then + TableToSave.SetItem = TableToSave.SetItem or {} + + if stringTable[2] ~= 'F' then + if type(stringTable[2]) == 'number' then + TableToSave.SetItem[(stringTable[1])] = stringTable[2] + else + TableToSave.SetItem[(stringTable[1])] = {} + + for i = 2, #stringTable do + if strlen(stringTable[i]) > 2 then + TableToSave.SetItem[(stringTable[1])][i - 1] = stringTable[i] + else + for k = 1, #stringTable - i + 1 do + TableToSave.SetItem[(stringTable[1])]['SetOption'..k] = stringTable[i + k - 1] == 'T' or stringTable[i + k - 1] + end + break + end + end + end + else + TableToSave.SetItem[(stringTable[1])] = nil + end + elseif self.DataTypeTable[DataType] == 'PlayerInfo' then + TableToSave.Name, TableToSave.Title = strsplit('_', stringTable[1]) + TableToSave.Realm = stringTable[2] ~= '' and stringTable[2] ~= E.myrealm and stringTable[2] or nil + TableToSave.Level = stringTable[3] + TableToSave.Class = stringTable[4] + TableToSave.ClassID = stringTable[5] + TableToSave.Race = stringTable[6] + TableToSave.RaceID = stringTable[7] + TableToSave.GenderID = stringTable[8] + TableToSave.guildName = stringTable[9] + TableToSave.guildRankName = stringTable[10] + elseif self.DataTypeTable[DataType] == 'GuildInfo' then + TableToSave.guildLevel = stringTable[1] + TableToSave.guildNumMembers = stringTable[2] + + for i = 3, #stringTable do + TableToSave.guildEmblem = TableToSave.guildEmblem or {} + TableToSave.guildEmblem[i - 2] = stringTable[i] + end + end + end + end + + if Message == '' then + for funcName, func in pairs(self.RegisteredFunction) do + func(Sender, TableToSave) + end + + Message = nil + end + + self.RemainMessage[Sender] = Message + + if NeedResponse then + self:SendData(self.PlayerData_ShortString, 'AISM', SenderRealm == playerRealm and 'WHISPER' or nil, Sender) + end + end + end + end + + local prefix, message, channel, sender, needUpdate, updateData + AISM:SetScript('OnEvent', function(self, Event, ...) + if Event == 'PLAYER_LOGIN' then + self:GetPlayerCurrentGroupMode() + self:GetCurrentInstanceType() + isHelmDisplayed = ShowingHelm() == 1 + isCloakDisplayed = ShowingCloak() == 1 + elseif Event == 'PLAYER_GUILD_UPDATE' then + if IsInGuild() then + self.needSendDataGuild = true + self:Show() + self:UnregisterEvent('PLAYER_GUILD_UPDATE') + end + elseif Event == 'CHAT_MSG_ADDON' then + Prefix, Message, Channel, Sender = ... + + if (Prefix == 'AISM' or Prefix == 'AISM_Inspect') and Sender ~= playerName..'-'..playerRealm then + self:Receiver(Prefix, Message, Channel, Sender) + elseif not self.Initialize and Prefix == 'AISM' and Message == 'AISM_Initialize' and Sender == playerName..'-'..playerRealm then + self.Initialize = true + + if IsInGuild() then + self.needSendDataGuild = true + self:Show() + else + self:RegisterEvent('PLAYER_GUILD_UPDATE') + end + + end + elseif Event == 'PLAYER_LOGOUT' then + if IsInGuild() then + SendAddonMessage('AISM', 'AISM_GUILD_UnregistME', 'GUILD') + end + + elseif Event == 'GROUP_ROSTER_UPDATE' then + self:GetPlayerCurrentGroupMode() + self:Show() + elseif Event == 'PLAYER_ENTERING_WORLD' or Event == 'ZONE_CHANGED_NEW_AREA' then + self:GetCurrentInstanceType() + self:Show() + end + end) + AISM:RegisterEvent('PLAYER_LOGIN') + AISM:RegisterEvent('PLAYER_LOGOUT') + AISM:RegisterEvent('CHAT_MSG_ADDON') + AISM:RegisterEvent('GROUP_ROSTER_UPDATE') + AISM:RegisterEvent('PLAYER_ENTERING_WORLD') + AISM:RegisterEvent('ZONE_CHANGED_NEW_AREA') + + function AISM:RegisterInspectDataRequest(Func, funcName, PreserveFunction) + if type(Func) == 'function' then + funcName = funcName or #self.RegisteredFunction + 1 + + self.RegisteredFunction[funcName] = function(User, UserData) + if Func(User, UserData) then + if not PreserveFunction then + self.RegisteredFunction[funcName] = nil + end + end + end + end + end + + RegisterAddonMessagePrefix('AISM') + RegisterAddonMessagePrefix('AISM_Inspect') +end \ No newline at end of file diff --git a/ElvUI_SLE/modules/characterframe/inspectframe.lua b/ElvUI_SLE/modules/characterframe/inspectframe.lua new file mode 100644 index 0000000..69178d8 --- /dev/null +++ b/ElvUI_SLE/modules/characterframe/inspectframe.lua @@ -0,0 +1,1914 @@ +local E, L, V, P, G, _ = unpack(ElvUI) +local AISM = _G['Armory_InspectSupportModule'] +local IFO = E:NewModule('InspectFrameOptions', 'AceEvent-3.0') + +-------------------------------------------------------------------------------- +--<< KnightFrame : Upgrade Inspect Frame like Wow-Armory >>-- +-------------------------------------------------------------------------------- +local KI = CreateFrame('Frame', 'KnightInspect', E.UIParent) +local ENI = _G['EnhancedNotifyInspectFrame'] or { ['CancelInspect'] = function() end, } +local C = SLArmoryConstants + +local CoreFrameLevel = 10 +local SLOT_SIZE = 37 +local PANEL_HEIGHT = 22 +local SIDE_BUTTON_WIDTH = 16 +local SPACING = 3 +local INFO_TAB_SIZE = 22 +local TALENT_SLOT_SIZE = 26 +local GLYPH_SLOT_HEIGHT = 22 + +local HeadSlotItem = 1020 +local BackSlotItem = 102246 +local Default_NotifyInspect +local Default_InspectUnit + +--<< Key Table >>-- +KI.PageList = { ['Character'] = 'CHARACTER', ['Info'] = 'INFO', ['Spec'] = 'TALENTS' } +KI.InfoPageCategoryList = { 'Profession', 'PvP', 'Guild' } +KI.ModelList = { + ['Human'] = { ['RaceID'] = 1, [2] = { ['x'] = 0.02, ['y'] = -0.025, ['z'] = -0.6 }, [3] = { ['x'] = -0.01, ['y'] = -0.08, ['z'] = -0.6 } }, + ['Dwarf'] = { ['RaceID'] = 3, [2] = { ['x'] = -0.01, ['y'] = -0.23, ['z'] = -0.9 }, [3] = { ['x'] = -0.03, ['y'] = -0.15, ['z'] = -0.8 } }, + ['NightElf'] = { ['RaceID'] = 4, [2] = { ['z'] = -0.7 }, [3] = { ['x'] = -0.02, ['y'] = -0.04, ['z'] = -0.7 }}, + ['Gnome'] = { ['RaceID'] = 7, [2] = { ['y'] = -0.2, ['z'] = -1 }, [3] = { ['x'] = -0.01, ['y'] = -0.19, ['z'] = -0.9 } }, + ['Draenei'] = { ['RaceID'] = 11, [2] = { ['x'] = -0.04, ['y'] = -0.08, ['z'] = -0.7 }, [3] = { ['x'] = -0.02, ['y'] = -0.01, ['z'] = -0.6 }}, + ['Worgen'] = { ['RaceID'] = 22, [2] = { ['x'] = -0.09, ['y'] = -0.1, ['z'] = -0.4 }, [3] = { ['x'] = -0.01, ['y'] = 0.01, ['z'] = 0.06 }}, + ['Orc'] = { ['RaceID'] = 2, [2] = { ['y'] = -0.06, ['z'] = -1 }, [3] = { ['x'] = -0.01, ['y'] = -0.05, ['z'] = -0.7 }}, + ['Scourge'] = { ['RaceID'] = 5, [2] = { ['y'] = -0.08, ['z'] = -0.7 }, [3] = { ['y'] = -0.05, ['z'] = -0.6 }}, + ['Tauren'] = { ['RaceID'] = 6, [2] = { ['y'] = -0.09, ['z'] = -0.7 }, [3] = { ['y'] = -0.16, ['z'] = -0.6 } }, + ['Troll'] = { ['RaceID'] = 8, [2] = { ['y'] = -0.14, ['z'] = -1.1 }, [3] = { ['y'] = -0.11, ['z'] = -0.8 }}, + ['BloodElf'] = { ['RaceID'] = 10, [2] = { ['x'] = 0.02, ['y'] = -0.01, ['z'] = -0.5 }, [3] = { ['x'] = 0.04, ['y'] = -0.01, ['z'] = -0.6 }}, + ['Goblin'] = { ['RaceID'] = 9, [2] = { ['y'] = -0.23, ['z'] = -1.3 }, [3] = { ['x'] = -0.01, ['y'] = -0.25, ['z'] = -1.3 } }, + ['Pandaren'] = { ['RaceID'] = 24, [2] = { ['x'] = 0.02, ['y'] = 0.02, ['z'] = -0.6 }, [3] = { ['x'] = 0, ['y'] = -0.05, ['z'] = -1 } }, +} +KI.CurrentInspectData = {} +KI.Default_CurrentInspectData = { + ['Gear'] = { + ['HeadSlot'] = {}, ['NeckSlot'] = {}, ['ShoulderSlot'] = {}, ['BackSlot'] = {}, ['ChestSlot'] = {}, + ['ShirtSlot'] = {}, ['TabardSlot'] = {}, ['WristSlot'] = {}, ['MainHandSlot'] = {}, + + ['HandsSlot'] = {}, ['WaistSlot'] = {}, ['LegsSlot'] = {}, ['FeetSlot'] = {}, ['Finger0Slot'] = {}, + ['Finger1Slot'] = {}, ['Trinket0Slot'] = {}, ['Trinket1Slot'] = {}, ['SecondaryHandSlot'] = {} + }, + ['SetItem'] = {}, + ['Specialization'] = { [1] = {}, [2] = {} }, + ['Glyph'] = { [1] = {}, [2] = {} }, + ['Profession'] = { [1] = {}, [2] = {} } +} + +local function Button_OnEnter(self) + self:SetBackdropBorderColor(unpack(E.media.rgbvaluecolor)) + self.text:SetText(C.Toolkit.Color_Value(self.buttonString)) +end + +local function Button_OnLeave(self) + self:SetBackdropBorderColor(unpack(E.media.bordercolor)) + self.text:SetText(self.buttonString) +end + +function KI:ChangePage(buttonName) + for pageType in pairs(self.PageList) do + if self[pageType] then + if buttonName == pageType..'Button' then + self[pageType]:Show() + else + self[pageType]:Hide() + end + end + end + + self.MainHandSlot:ClearAllPoints() + self.SecondaryHandSlot:ClearAllPoints() + if buttonName == 'CharacterButton' then + for _, slotName in pairs(C.GearList) do + self[slotName].ItemLevel:Hide() + end + self.Model:Point('TOPRIGHT', self.HandsSlot) + self.MainHandSlot:Point('BOTTOMRIGHT', self.BP, 'TOP', -2, SPACING) + self.SecondaryHandSlot:Point('BOTTOMLEFT', self.BP, 'TOP', 2, SPACING) + else + for _, slotName in pairs(C.GearList) do + self[slotName].ItemLevel:Show() + end + self.Model:Point('TOPRIGHT', UIParent, 'BOTTOMLEFT') + self.MainHandSlot:Point('BOTTOMLEFT', self.BP, 'TOPLEFT', 1, SPACING) + self.SecondaryHandSlot:Point('BOTTOMRIGHT', self.BP, 'TOPRIGHT', -1, SPACING) + end +end + +KI.EquipmentSlot_OnEnter = function(self) + if self.Link then + GameTooltip:SetOwner(self, 'ANCHOR_RIGHT') + GameTooltip:SetHyperlink(self.Link) + + --ITEM_SOULBOUND + + local CurrentLineText, SetName + for i = 1, GameTooltip:NumLines() do + CurrentLineText = _G['GameTooltipTextLeft'..i]:GetText() + + SetName = CurrentLineText:match('^(.+) %((%d)/(%d)%)$') + + if SetName then + local SetCount = 0 + + if type(KI.SetItem[SetName]) == 'table' then + for dataType, Data in pairs(KI.SetItem[SetName]) do + if type(dataType) == 'string' then -- Means SetOption Data + local CurrentLineNum = i + #KI.SetItem[SetName] + 1 + dataType:match('^.+(%d)$') + local CurrentText = _G['GameTooltipTextLeft'..CurrentLineNum]:GetText() + local CurrentTextType = CurrentText:match("^%((%d)%)%s.+:%s.+$") or true + + if Data ~= CurrentTextType then + if Data == true and CurrentTextType ~= true then + _G['GameTooltipTextLeft'..CurrentLineNum]:SetText(GREEN_FONT_COLOR_CODE..(strsub(CurrentText, (strlen(CurrentTextType) + 4)))) + else + _G['GameTooltipTextLeft'..CurrentLineNum]:SetText(GRAY_FONT_COLOR_CODE..'('..Data..') '..CurrentText) + end + end + else + if Data:find(LIGHTYELLOW_FONT_COLOR_CODE) then + SetCount = SetCount + 1 + end + + _G['GameTooltipTextLeft'..(i + dataType)]:SetText(Data) + end + end + + _G['GameTooltipTextLeft'..i]:SetText(string.gsub(CurrentLineText, ' %(%d/', ' %('..SetCount..'/', 1)) + end + + break + end + end + + GameTooltip:Show() + end +end + +KI.ScrollFrame_OnMouseWheel = function(self, spinning) + local Page = self:GetScrollChild() + local PageHeight = Page:GetHeight() + local WindowHeight = self:GetHeight() + + self.Offset = self.Offset or 0 + + if PageHeight > WindowHeight then + self.Offset = self.Offset - spinning * 5 + + Page:ClearAllPoints() + if self.Offset > PageHeight - WindowHeight then + self.Offset = PageHeight - WindowHeight + + Page:Point('BOTTOMLEFT', self) + Page:Point('BOTTOMRIGHT', self) + return + elseif self.Offset < 0 then + self.Offset = 0 + end + else + self.Offset = 0 + end + + Page:Point('TOPLEFT', self, 0, self.Offset) + Page:Point('TOPRIGHT', self, 0, self.Offset) +end + +KI.Category_OnClick = function(self) + self = self:GetParent() + self.Closed = not self.Closed + + KI:ReArrangeCategory() +end + +KI.GemSocket_OnEnter = function(self) + GameTooltip:SetOwner(self, 'ANCHOR_RIGHT') + + self = self:GetParent() + + if self.GemItemID then + if type(self.GemItemID) == 'number' then + GameTooltip:SetHyperlink(select(2, GetItemInfo(self.GemItemID))) + else + GameTooltip:ClearLines() + GameTooltip:AddLine(self.GemItemID) + end + elseif self.GemType then + GameTooltip:ClearLines() + GameTooltip:AddLine(_G['EMPTY_SOCKET_'..self.GemType]) + end + + GameTooltip:Show() +end + +KI.GemSocket_OnClick = function(self, button) + self = self:GetParent() + + if self.GemItemID and type(self.GemItemID) == 'number' then + local itemName, itemLink = GetItemInfo(self.GemItemID) + + if not IsShiftKeyDown() then + SetItemRef(itemLink, itemLink, 'LeftButton') + else + if HandleModifiedItemClick(itemLink) then + elseif BrowseName and BrowseName:IsVisible() then + AuctionFrameBrowse_Reset(BrowseResetButton) + BrowseName:SetText(itemName) + BrowseName:SetFocus() + end + end + end +end + +KI.OnClick = function(self) + if self.Link then + if HandleModifiedItemClick(self.Link) then + elseif self.EnableAuctionSearch and BrowseName and BrowseName:IsVisible() then + AuctionFrameBrowse_Reset(BrowseResetButton) + BrowseName:SetText(self:GetParent().text:GetText()) + BrowseName:SetFocus() + end + end +end + +function KI:CreateInspectFrame() + do --<< Core >>-- + self:Size(450, 480) + self:CreateBackdrop('Transparent') + self:SetFrameStrata('DIALOG') + self:SetFrameLevel(CoreFrameLevel) + self:SetMovable(true) + self:SetClampedToScreen(true) + self:SetScript('OnHide', function() + PlaySound('igCharacterInfoClose') + + if self.CurrentInspectData.Name then + local TableIndex = self.CurrentInspectData.Name..(KI.CurrentInspectData.Realm and '-'..KI.CurrentInspectData.Realm or '') + if AISM then + if self.LastDataSetting then + AISM.RegisteredFunction[TableIndex] = nil + end + end + + ENI.CancelInspect(TableIndex) + KI:UnregisterEvent('INSPECT_READY', 'KnightInspect') + end + + self.LastDataSetting = nil + self.Model:Point('TOPRIGHT', UIParent, 'BOTTOMLEFT') + end) + self:SetScript('OnShow', function() self.Model:Point('TOPRIGHT', self.HandsSlot) end) + self:SetScript('OnEvent', function(self, Event, ...) if self[Event] then self[Event](...) end end) + UIPanelWindows['KnightInspect'] = { area = 'left', pushable = 1, } + end + + do --<< Tab >>-- + self.Tab = CreateFrame('Frame', nil, self) + self.Tab:Point('TOPLEFT', self, SPACING, -SPACING) + self.Tab:Point('BOTTOMRIGHT', self, 'TOPRIGHT', -SPACING, -(SPACING + PANEL_HEIGHT)) + self.Tab:SetBackdrop({ + bgFile = E.media.normTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Tab:SetBackdropBorderColor(unpack(E.media.bordercolor)) + C.Toolkit.TextSetting(self.Tab, ' |cff2eb7e4Knight Inspect', { ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE', }, 'LEFT', 6, 1) + self.Tab:SetScript('OnMouseDown', function() self:StartMoving() end) + self.Tab:SetScript('OnMouseUp', function() self:StopMovingOrSizing() end) + end + + do --<< Close Button >>-- + self.Close = CreateFrame('Button', nil, self.Tab) + self.Close:Size(PANEL_HEIGHT - 8) + self.Close:SetTemplate() + self.Close.backdropTexture:SetVertexColor(0.1, 0.1, 0.1) + self.Close:Point('RIGHT', -4, 0) + C.Toolkit.TextSetting(self.Close, 'X', { ['FontSize'] = 13, }, 'CENTER', 1, 0) + self.Close:SetScript('OnEnter', Button_OnEnter) + self.Close:SetScript('OnLeave', Button_OnLeave) + self.Close:SetScript('OnClick', function() HideUIPanel(self) end) + self.Close.buttonString = 'X' + end + + do --<< Bottom Panel >>-- + self.BP = CreateFrame('Frame', nil, self) + self.BP:Point('TOPLEFT', self, 'BOTTOMLEFT', SPACING, SPACING + PANEL_HEIGHT) + self.BP:Point('BOTTOMRIGHT', self, -SPACING, SPACING) + self.BP:SetBackdrop({ + bgFile = E.media.normTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.BP:SetBackdropColor(0.09, 0.3, 0.45) + self.BP:SetBackdropBorderColor(unpack(E.media.bordercolor)) + self.BP:SetFrameLevel(CoreFrameLevel + 2) + C.Toolkit.TextSetting(self.BP, '', { ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE', }, 'LEFT', 4, 1) + self.Message = self.BP.text + end + + do --<< Background >>-- + self.BG = self:CreateTexture(nil, 'OVERLAY') + self.BG:Point('TOPLEFT', self.Tab, 'BOTTOMLEFT', 0, -38) + self.BG:Point('BOTTOMRIGHT', self.BP, 'TOPRIGHT') + self.BG:SetTexture('Interface\\AddOns\\ElvUI_SLE\\Media\\textures\\Space') + end + + do --<< Buttons >>-- + for buttonName, buttonString in pairs(self.PageList) do + buttonName = buttonName..'Button' + + self[buttonName] = CreateFrame('Button', nil, self.BP) + self[buttonName]:Size(70, 20) + self[buttonName]:SetBackdrop({ + bgFile = E.media.normTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self[buttonName]:SetBackdropBorderColor(unpack(E.media.bordercolor)) + self[buttonName]:SetFrameLevel(CoreFrameLevel + 1) + C.Toolkit.TextSetting(self[buttonName], _G[buttonString], { ['FontSize'] = 9, ['FontOutline'] = 'OUTLINE' }) + self[buttonName]:SetScript('OnEnter', Button_OnEnter) + self[buttonName]:SetScript('OnLeave', Button_OnLeave) + self[buttonName]:SetScript('OnClick', function() KI:ChangePage(buttonName) end) + self[buttonName]['buttonString'] = _G[buttonString] + end + self.CharacterButton:Point('TOPLEFT', self.BP, 'BOTTOMLEFT', SPACING + 1, 2) + self.InfoButton:Point('TOPLEFT', self.CharacterButton, 'TOPRIGHT', SPACING, 0) + self.SpecButton:Point('TOPLEFT', self.InfoButton, 'TOPRIGHT', SPACING, 0) + end + + do --<< Bookmark Star >>-- + self.Bookmark = CreateFrame('CheckButton', nil, self) + self.Bookmark:Size(24) + self.Bookmark:EnableMouse(true) + self.Bookmark.NormalTexture = self.Bookmark:CreateTexture(nil, 'OVERLAY') + self.Bookmark.NormalTexture:SetTexCoord(0.5, 1, 0, 0.5) + self.Bookmark.NormalTexture:SetTexture('Interface\\Common\\ReputationStar.tga') + self.Bookmark.NormalTexture:SetInside() + self.Bookmark:SetNormalTexture(self.Bookmark.NormalTexture) + self.Bookmark.HighlightTexture = self.Bookmark:CreateTexture(nil, 'OVERLAY') + self.Bookmark.HighlightTexture:SetTexCoord(0, 0.5, 0.5, 1) + self.Bookmark.HighlightTexture:SetTexture('Interface\\Common\\ReputationStar.tga') + self.Bookmark.HighlightTexture:SetInside() + self.Bookmark:SetHighlightTexture(self.Bookmark.HighlightTexture) + self.Bookmark.CheckedTexture = self.Bookmark:CreateTexture(nil, 'OVERLAY') + self.Bookmark.CheckedTexture:SetTexCoord(0, 0.5, 0, 0.5) + self.Bookmark.CheckedTexture:SetTexture('Interface\\Common\\ReputationStar.tga') + self.Bookmark.CheckedTexture:SetInside() + self.Bookmark:SetCheckedTexture(self.Bookmark.CheckedTexture) + self.Bookmark:Point('LEFT', self.Tab, 'BOTTOMLEFT', 7, -35) + end + + do --<< Texts >>-- + C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'Name', ['FontSize'] = 22, ['FontOutline'] = 'OUTLINE', }, 'LEFT', self.Bookmark, 'RIGHT', 9, 0) + C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'Title', ['FontSize'] = 9, ['FontOutline'] = 'OUTLINE', }, 'BOTTOMLEFT', self.Name, 'TOPLEFT', 2, 5) + C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'LevelRace', ['FontSize'] = 10, ['directionH'] = 'LEFT', }, 'BOTTOMLEFT', self.Name, 'BOTTOMRIGHT', 5, 2) + C.Toolkit.TextSetting(self, nil, { ['Tag'] = 'Guild', ['FontSize'] = 10, ['directionH'] = 'LEFT', }, 'TOPLEFT', self.Name, 'BOTTOMLEFT', 4, -5) + self.Guild:Point('RIGHT', self, -44, 0) + end + + do --<< Class, Specialization Icon >>-- + for _, frameName in pairs({ 'SpecIcon', 'ClassIcon', }) do + self[frameName..'Slot'] = CreateFrame('Frame', nil, self) + self[frameName..'Slot']:Size(24) + self[frameName..'Slot']:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self[frameName] = self[frameName..'Slot']:CreateTexture(nil, 'OVERLAY') + self[frameName]:SetTexCoord(unpack(E.TexCoords)) + self[frameName]:SetInside() + end + self.ClassIconSlot:Point('RIGHT', self.Tab, 'BOTTOMRIGHT', -44, -35) + self.SpecIconSlot:Point('RIGHT', self.ClassIconSlot, 'LEFT', -SPACING, 0) + end + + do --<< Player Model >>-- + self.Model = CreateFrame('DressUpModel', nil, UIParent) + self.Model:SetFrameStrata('DIALOG') + self.Model:SetFrameLevel(CoreFrameLevel + 1) + self.Model:EnableMouse(1) + self.Model:EnableMouseWheel(1) + self.Model:SetUnit('player') + self.Model:TryOn(HeadSlotItem) + self.Model:TryOn(BackSlotItem) + self.Model:Undress() + self.Model:SetScript('OnMouseDown', function(self, button) + self.startx, self.starty = GetCursorPosition() + + local endx, endy, z, x, y + if button == 'LeftButton' then + KI.Model:SetScript('OnUpdate', function(self) + endx, endy = GetCursorPosition() + + self.rotation = (endx - self.startx) / 34 + self:GetFacing() + self:SetFacing(self.rotation) + self.startx, self.starty = GetCursorPosition() + end) + elseif button == 'RightButton' then + KI.Model:SetScript('OnUpdate', function(self) + endx, endy = GetCursorPosition() + + z, x, y = self:GetPosition(z, x, y) + x = (endx - self.startx) / 45 + x + y = (endy - self.starty) / 45 + y + + self:SetPosition(z, x, y) + self.startx, self.starty = GetCursorPosition() + end) + end + end) + self.Model:SetScript('OnMouseUp', function(self) + self:SetScript('OnUpdate', nil) + end) + self.Model:SetScript('OnMouseWheel', function(self, spining) + local z, x, y = self:GetPosition() + + z = (spining > 0 and z + 0.1 or z - 0.1) + + self:SetPosition(z, x, y) + end) + end + + do --<< Equipment Slots >>-- + self.Character = CreateFrame('Frame', nil, self) + + local Slot + for i, slotName in pairs(C.GearList) do + -- Slot + Slot = CreateFrame('Button', nil, self) + Slot:Size(SLOT_SIZE) + Slot:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + Slot:SetFrameLevel(CoreFrameLevel + 3) + Slot:SetScript('OnEnter', self.EquipmentSlot_OnEnter) + Slot:SetScript('OnLeave', C.CommonScript.OnLeave) + Slot:SetScript('OnClick', self.OnClick) + C.Toolkit.TextSetting(Slot, '', { ['FontSize'] = 12, ['FontOutline'] = 'OUTLINE' }) + + Slot.SlotName = slotName + Slot.Direction = i%2 == 1 and 'LEFT' or 'RIGHT' + Slot.ID, Slot.EmptyTexture = GetInventorySlotInfo(slotName) + + Slot.Texture = Slot:CreateTexture(nil, 'OVERLAY') + Slot.Texture:SetTexCoord(unpack(E.TexCoords)) + Slot.Texture:SetInside() + Slot.Texture:SetTexture(Slot.EmptyTexture) + + Slot.Highlight = Slot:CreateTexture('Frame', nil, self) + Slot.Highlight:SetInside() + Slot.Highlight:SetTexture(1, 1, 1, 0.3) + Slot:SetHighlightTexture(Slot.Highlight) + + C.Toolkit.TextSetting(Slot, nil, { ['Tag'] = 'ItemLevel', ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE', }, 'TOP', Slot, 0, -3) + + -- Gradation + Slot.Gradation = CreateFrame('Frame', nil, self.Character) + Slot.Gradation:Size(130, SLOT_SIZE + 4) + Slot.Gradation:Point(Slot.Direction, Slot, Slot.Direction == 'LEFT' and -1 or 1, 0) + Slot.Gradation:SetFrameLevel(CoreFrameLevel + 2) + Slot.Gradation.Texture = Slot.Gradation:CreateTexture(nil, 'OVERLAY') + Slot.Gradation.Texture:SetInside() + Slot.Gradation.Texture:SetTexture('Interface\\AddOns\\ElvUI_SLE\\media\\textures\\Gradation') + if Slot.Direction == 'LEFT' then + Slot.Gradation.Texture:SetTexCoord(0, .5, 0, .5) + else + Slot.Gradation.Texture:SetTexCoord(.5, 1, 0, .5) + end + + if not (slotName == 'ShirtSlot' or slotName == 'TabardSlot') then + -- Item Level + C.Toolkit.TextSetting(Slot.Gradation, nil, { ['Tag'] = 'ItemLevel', ['FontSize'] = 10, ['directionH'] = Slot.Direction, }, 'TOP'..Slot.Direction, Slot, 'TOP'..(Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT'), Slot.Direction == 'LEFT' and 2 or -2, -1) + + -- Enchantment + C.Toolkit.TextSetting(Slot.Gradation, nil, { ['Tag'] = 'ItemEnchant', ['FontSize'] = 8, ['directionH'] = Slot.Direction, }, Slot.Direction, Slot, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 2 or -2, 2) + Slot.EnchantWarning = CreateFrame('Button', nil, Slot.Gradation) + Slot.EnchantWarning:Size(12) + Slot.EnchantWarning.Texture = Slot.EnchantWarning:CreateTexture(nil, 'OVERLAY') + Slot.EnchantWarning.Texture:SetInside() + Slot.EnchantWarning.Texture:SetTexture('Interface\\AddOns\\ElvUI_SLE\\media\\textures\\Warning-Small') + Slot.EnchantWarning:Point(Slot.Direction, Slot.Gradation.ItemEnchant, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 3 or -3, 0) + Slot.EnchantWarning:SetScript('OnEnter', C.CommonScript.OnEnter) + Slot.EnchantWarning:SetScript('OnLeave', C.CommonScript.OnLeave) + + -- Gem Socket + for i = 1, MAX_NUM_SOCKETS do + Slot['Socket'..i] = CreateFrame('Frame', nil, Slot.Gradation) + Slot['Socket'..i]:Size(12) + Slot['Socket'..i]:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + Slot['Socket'..i]:SetBackdropColor(0, 0, 0, 1) + Slot['Socket'..i]:SetBackdropBorderColor(0, 0, 0) + Slot['Socket'..i]:SetFrameLevel(CoreFrameLevel + 3) + + Slot['Socket'..i].Socket = CreateFrame('Button', nil, Slot['Socket'..i]) + Slot['Socket'..i].Socket:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + Slot['Socket'..i].Socket:SetInside() + Slot['Socket'..i].Socket:SetFrameLevel(CoreFrameLevel + 4) + Slot['Socket'..i].Socket:SetScript('OnEnter', C.CommonScript.GemSocket_OnEnter) + Slot['Socket'..i].Socket:SetScript('OnLeave', C.CommonScript.OnLeave) + Slot['Socket'..i].Socket:SetScript('OnClick', self.GemSocket_OnClick) + + Slot['Socket'..i].Texture = Slot['Socket'..i].Socket:CreateTexture(nil, 'OVERLAY') + Slot['Socket'..i].Texture:SetTexCoord(.1, .9, .1, .9) + Slot['Socket'..i].Texture:SetInside() + end + Slot.Socket1:Point('BOTTOM'..Slot.Direction, Slot, 'BOTTOM'..(Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT'), Slot.Direction == 'LEFT' and 3 or -3, 2) + Slot.Socket2:Point(Slot.Direction, Slot.Socket1, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 1 or -1, 0) + Slot.Socket3:Point(Slot.Direction, Slot.Socket2, Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT', Slot.Direction == 'LEFT' and 1 or -1, 0) + + Slot.SocketWarning = CreateFrame('Button', nil, Slot.Gradation) + Slot.SocketWarning:Size(12) + Slot.SocketWarning.Texture = Slot.SocketWarning:CreateTexture(nil, 'OVERLAY') + Slot.SocketWarning.Texture:SetInside() + Slot.SocketWarning.Texture:SetTexture('Interface\\AddOns\\ElvUI_SLE\\media\\textures\\Warning-Small') + Slot.SocketWarning:SetScript('OnEnter', C.CommonScript.OnEnter) + Slot.SocketWarning:SetScript('OnLeave', C.CommonScript.OnLeave) + end + + self[slotName] = Slot + end + + -- Slot Location : Left + self.HeadSlot:Point('BOTTOMLEFT', self.NeckSlot, 'TOPLEFT', 0, SPACING) + self.NeckSlot:Point('BOTTOMLEFT', self.ShoulderSlot, 'TOPLEFT', 0, SPACING) + self.ShoulderSlot:Point('BOTTOMLEFT', self.BackSlot, 'TOPLEFT', 0, SPACING) + self.BackSlot:Point('BOTTOMLEFT', self.ChestSlot, 'TOPLEFT', 0, SPACING) + self.ChestSlot:Point('BOTTOMLEFT', self.ShirtSlot, 'TOPLEFT', 0, SPACING) + self.ShirtSlot:Point('BOTTOMLEFT', self.TabardSlot, 'TOPLEFT', 0, SPACING) + self.TabardSlot:Point('BOTTOMLEFT', self.WristSlot, 'TOPLEFT', 0, SPACING) + self.WristSlot:Point('LEFT', self.BP, 1, 0) + self.WristSlot:Point('BOTTOM', self.MainHandSlot, 'TOP', 0, SPACING) + + -- Slot Location : Right + self.HandsSlot:Point('BOTTOMRIGHT', self.WaistSlot, 'TOPRIGHT', 0, SPACING) + self.WaistSlot:Point('BOTTOMRIGHT', self.LegsSlot, 'TOPRIGHT', 0, SPACING) + self.LegsSlot:Point('BOTTOMRIGHT', self.FeetSlot, 'TOPRIGHT', 0, SPACING) + self.FeetSlot:Point('BOTTOMRIGHT', self.Finger0Slot, 'TOPRIGHT', 0, SPACING) + self.Finger0Slot:Point('BOTTOMRIGHT', self.Finger1Slot, 'TOPRIGHT', 0, SPACING) + self.Finger1Slot:Point('BOTTOMRIGHT', self.Trinket0Slot, 'TOPRIGHT', 0, SPACING) + self.Trinket0Slot:Point('BOTTOMRIGHT', self.Trinket1Slot, 'TOPRIGHT', 0, SPACING) + self.Trinket1Slot:Point('RIGHT', self.BP, -1, 0) + self.Trinket1Slot:Point('BOTTOM', self.SecondaryHandSlot, 'TOP', 0, SPACING) + + -- ItemLevel + C.Toolkit.TextSetting(self.Character, nil, { ['Tag'] = 'AverageItemLevel', ['FontSize'] = 12, }, 'TOP', self.Model) + end + + self.Model:Point('TOPLEFT', self.HeadSlot) + self.Model:Point('BOTTOM', self.BP, 'TOP', 0, SPACING) + + do --<< Information Page >>-- + self.Info = CreateFrame('ScrollFrame', nil, self) + self.Info:SetFrameLevel(CoreFrameLevel + 4) + self.Info:EnableMouseWheel(1) + self.Info:SetScript('OnMouseWheel', self.ScrollFrame_OnMouseWheel) + + self.Info.BG = CreateFrame('Frame', nil, self.Info) + self.Info.BG:SetFrameLevel(CoreFrameLevel + 1) + self.Info.BG:Point('TOPLEFT', self.HeadSlot, 'TOPRIGHT', SPACING, 0) + self.Info.BG:Point('RIGHT', self.Trinket1Slot, 'BOTTOMLEFT', -SPACING, 0) + self.Info.BG:Point('BOTTOM', self.BP, 'TOP', 0, SPACING) + self.Info.BG:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Info.BG:SetBackdropColor(0, 0, 0, .7) + + self.Info:Point('TOPLEFT', self.Info.BG, 4, -7) + self.Info:Point('BOTTOMRIGHT', self.Info.BG, -4, 7) + + self.Info.Page = CreateFrame('Frame', nil, self.Info) + self.Info:SetScrollChild(self.Info.Page) + self.Info.Page:SetFrameLevel(CoreFrameLevel + 2) + self.Info.Page:Point('TOPLEFT', self.Info) + self.Info.Page:Point('TOPRIGHT', self.Info, -1, 0) + + for _, CategoryType in pairs(KI.InfoPageCategoryList) do + self.Info[CategoryType] = CreateFrame('ScrollFrame', nil, self.Info.Page) + self.Info[CategoryType]:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Info[CategoryType]:SetBackdropColor(.08, .08, .08, .8) + self.Info[CategoryType]:SetBackdropBorderColor(0, 0, 0) + self.Info[CategoryType]:Point('LEFT', self.Info.Page) + self.Info[CategoryType]:Point('RIGHT', self.Info.Page) + self.Info[CategoryType]:Height(INFO_TAB_SIZE + SPACING * 2) + + self.Info[CategoryType].IconSlot = CreateFrame('Frame', nil, self.Info[CategoryType]) + self.Info[CategoryType].IconSlot:Size(INFO_TAB_SIZE) + self.Info[CategoryType].IconSlot:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Info[CategoryType].IconSlot:Point('TOPLEFT', self.Info[CategoryType], SPACING, -SPACING) + self.Info[CategoryType].Icon = self.Info[CategoryType].IconSlot:CreateTexture(nil, 'OVERLAY') + self.Info[CategoryType].Icon:SetTexCoord(unpack(E.TexCoords)) + self.Info[CategoryType].Icon:SetInside() + + self.Info[CategoryType].Tab = CreateFrame('Frame', nil, self.Info[CategoryType]) + self.Info[CategoryType].Tab:Point('TOPLEFT', self.Info[CategoryType].IconSlot, 'TOPRIGHT', 1, 0) + self.Info[CategoryType].Tab:Point('BOTTOMRIGHT', self.Info[CategoryType], 'TOPRIGHT', -SPACING, -(SPACING + INFO_TAB_SIZE)) + self.Info[CategoryType].Tab:SetBackdrop({ + bgFile = E.media.normTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + + self.Info[CategoryType].Tooltip = CreateFrame('Button', nil, self.Info[CategoryType]) + self.Info[CategoryType].Tooltip:Point('TOPLEFT', self.Info[CategoryType].Icon) + self.Info[CategoryType].Tooltip:Point('BOTTOMRIGHT', self.Info[CategoryType].Tab) + self.Info[CategoryType].Tooltip:SetFrameLevel(CoreFrameLevel + 4) + self.Info[CategoryType].Tooltip:SetScript('OnClick', KI.Category_OnClick) + + C.Toolkit.TextSetting(self.Info[CategoryType].Tab, CategoryType, { ['FontSize'] = 10 }, 'LEFT', 6, 1) + + self.Info[CategoryType].Page = CreateFrame('Frame', nil, self.Info[CategoryType]) + self.Info[CategoryType]:SetScrollChild(self.Info[CategoryType].Page) + self.Info[CategoryType].Page:SetFrameLevel(CoreFrameLevel + 2) + self.Info[CategoryType].Page:Point('TOPLEFT', self.Info[CategoryType].Icon, 'BOTTOMLEFT', 0, -SPACING) + self.Info[CategoryType].Page:Point('BOTTOMRIGHT', self.Info[CategoryType], -SPACING, SPACING) + end + + do -- Profession Part + self.Info.Profession.CategoryHeight = INFO_TAB_SIZE + 34 + SPACING * 3 + self.Info.Profession.Icon:SetTexture(GetSpellTexture(110396)) + + for i = 1, 2 do + self.Info.Profession['Prof'..i] = CreateFrame('Frame', nil, self.Info.Profession.Page) + self.Info.Profession['Prof'..i]:Size(20) + self.Info.Profession['Prof'..i]:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Info.Profession['Prof'..i]:SetBackdropBorderColor(0, 0, 0) + + self.Info.Profession['Prof'..i].Icon = self.Info.Profession['Prof'..i]:CreateTexture(nil, 'OVERLAY') + self.Info.Profession['Prof'..i].Icon:SetTexCoord(unpack(E.TexCoords)) + self.Info.Profession['Prof'..i].Icon:SetInside() + self.Info.Profession['Prof'..i].Icon:SetTexture(GetSpellTexture(110396)) + + self.Info.Profession['Prof'..i].BarFrame = CreateFrame('Frame', nil, self.Info.Profession['Prof'..i]) + self.Info.Profession['Prof'..i].BarFrame:Size(136, 5) + self.Info.Profession['Prof'..i].BarFrame:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Info.Profession['Prof'..i].BarFrame:SetBackdropColor(0, 0, 0) + self.Info.Profession['Prof'..i].BarFrame:SetBackdropBorderColor(0, 0, 0) + self.Info.Profession['Prof'..i].BarFrame:Point('BOTTOMLEFT', self.Info.Profession['Prof'..i], 'BOTTOMRIGHT', SPACING, 0) + + self.Info.Profession['Prof'..i].Bar = CreateFrame('StatusBar', nil, self.Info.Profession['Prof'..i].BarFrame) + self.Info.Profession['Prof'..i].Bar:SetInside() + self.Info.Profession['Prof'..i].Bar:SetStatusBarTexture(E.media.normTex) + self.Info.Profession['Prof'..i].Bar:SetMinMaxValues(0, 600) + + C.Toolkit.TextSetting(self.Info.Profession['Prof'..i], '257', { ['Tag'] = 'Level', ['FontSize'] = 10 }, 'TOP', self.Info.Profession['Prof'..i].Icon) + self.Info.Profession['Prof'..i].Level:Point('RIGHT', self.Info.Profession['Prof'..i].Bar) + + C.Toolkit.TextSetting(self.Info.Profession['Prof'..i], 'JewelCrafting', { ['Tag'] = 'Name', ['FontSize'] = 10, ['directionH'] = 'LEFT' }, 'TOP', self.Info.Profession['Prof'..i].Icon) + self.Info.Profession['Prof'..i].Name:Point('LEFT', self.Info.Profession['Prof'..i].Bar) + self.Info.Profession['Prof'..i].Name:Point('RIGHT', self.Info.Profession['Prof'..i].Level, 'LEFT', -SPACING, 0) + end + + self.Info.Profession.Prof1:Point('TOPLEFT', self.Info.Profession.Page, 6, -8) + self.Info.Profession.Prof2:Point('TOPLEFT', self.Info.Profession.Page, 'TOP', 6, -8) + end + + do -- PvP Category + self.Info.PvP.CategoryHeight = 100 + self.Info.PvP.Icon:SetTexture('Interface\\Icons\\achievement_bg_killxenemies_generalsroom') + end + + do -- Guild Category + self.Info.Guild.CategoryHeight = INFO_TAB_SIZE + 66 + SPACING * 3 + self.Info.Guild.Icon:SetTexture(GetSpellTexture(83968)) + + self.Info.Guild.Banner = CreateFrame('Frame', nil, self.Info.Guild.Page) + self.Info.Guild.Banner:SetInside() + self.Info.Guild.Banner:SetFrameLevel(CoreFrameLevel + 3) + + self.Info.Guild.BG = self.Info.Guild.Banner:CreateTexture(nil, 'BACKGROUND') + self.Info.Guild.BG:Size(33, 44) + self.Info.Guild.BG:SetTexCoord(.00781250, .32812500, .01562500, .84375000) + self.Info.Guild.BG:SetTexture('Interface\\GuildFrame\\GuildDifficulty') + self.Info.Guild.BG:Point('TOP', self.Info.Guild.Page, 0, -1) + + self.Info.Guild.Border = self.Info.Guild.Banner:CreateTexture(nil, 'ARTWORK') + self.Info.Guild.Border:Size(33, 44) + self.Info.Guild.Border:SetTexCoord(.34375000, .66406250, .01562500, .84375000) + self.Info.Guild.Border:SetTexture('Interface\\GuildFrame\\GuildDifficulty') + self.Info.Guild.Border:Point('CENTER', self.Info.Guild.BG) + + self.Info.Guild.Emblem = self.Info.Guild.Banner:CreateTexture(nil, 'OVERLAY') + self.Info.Guild.Emblem:Size(16) + self.Info.Guild.Emblem:SetTexture('Interface\\GuildFrame\\GuildEmblems_01') + self.Info.Guild.Emblem:Point('CENTER', self.Info.Guild.BG, 0, 2) + + C.Toolkit.TextSetting(self.Info.Guild.Banner, nil, { ['Tag'] = 'Name', ['FontSize'] = 14 }, 'TOP', self.Info.Guild.BG, 'BOTTOM', 0, 7) + C.Toolkit.TextSetting(self.Info.Guild.Banner, nil, { ['Tag'] = 'LevelMembers', ['FontSize'] = 9 }, 'TOP', self.Info.Guild.Banner.Name, 'BOTTOM', 0, -2) + end + end + + do --<< Specialization Page >>-- + self.Spec = CreateFrame('ScrollFrame', nil, self) + self.Spec:SetFrameLevel(CoreFrameLevel + 5) + self.Spec:EnableMouseWheel(1) + self.Spec:SetScript('OnMouseWheel', self.ScrollFrame_OnMouseWheel) + + self.Spec.BGFrame = CreateFrame('Frame', nil, self.Spec) + self.Spec.BGFrame:SetFrameLevel(CoreFrameLevel + 1) + self.Spec.BG = self.Spec.BGFrame:CreateTexture(nil, 'BACKGROUND') + self.Spec.BG:Point('TOP', self.HeadSlot, 'TOPRIGHT', 0, -30) + self.Spec.BG:Point('LEFT', self.WristSlot, 'TOPRIGHT', SPACING, 0) + self.Spec.BG:Point('RIGHT', self.Trinket1Slot, 'BOTTOMLEFT', -SPACING, 0) + self.Spec.BG:Point('BOTTOM', self.BP, 'TOP', 0, SPACING) + self.Spec.BG:SetTexture(0, 0, 0, .7) + + self.Spec:Point('TOPLEFT', self.Spec.BG, 4, -7) + self.Spec:Point('BOTTOMRIGHT', self.Spec.BG, -4, 7) + + self.Spec.Page = CreateFrame('Frame', nil, self.Spec) + self.Spec:SetScrollChild(self.Spec.Page) + self.Spec.Page:SetFrameLevel(CoreFrameLevel + 2) + self.Spec.Page:Point('TOPLEFT', self.Spec) + self.Spec.Page:Point('TOPRIGHT', self.Spec) + self.Spec.Page:Height((TALENT_SLOT_SIZE + SPACING * 3) * MAX_NUM_TALENT_TIERS + (SPACING + GLYPH_SLOT_HEIGHT) * 3 + 22) + + self.Spec.BottomBorder = self.Spec:CreateTexture(nil, 'OVERLAY') + self.Spec.BottomBorder:Point('TOPLEFT', self.Spec.BG, 'BOTTOMLEFT', 0, E.mult) + self.Spec.BottomBorder:Point('BOTTOMRIGHT', self.Spec.BG) + self.Spec.LeftBorder = self.Spec:CreateTexture(nil, 'OVERLAY') + self.Spec.LeftBorder:Point('TOPLEFT', self.Spec.BG) + self.Spec.LeftBorder:Point('BOTTOMLEFT', self.Spec.BottomBorder, 'TOPLEFT') + self.Spec.LeftBorder:Width(E.mult) + self.Spec.RightBorder = self.Spec:CreateTexture(nil, 'OVERLAY') + self.Spec.RightBorder:Point('TOPRIGHT', self.Spec.BG) + self.Spec.RightBorder:Point('BOTTOMRIGHT', self.Spec.BottomBorder, 'TOPRIGHT') + self.Spec.RightBorder:Width(E.mult) + + do -- Specialization Tab + for i = 1, MAX_TALENT_GROUPS do + self.Spec['Spec'..i] = CreateFrame('Button', nil, self.Spec) + self.Spec['Spec'..i]:Size(150, 30) + self.Spec['Spec'..i]:SetScript('OnClick', function() self:ToggleSpecializationTab(i, self.CurrentInspectData) end) + + self.Spec['Spec'..i].Tab = CreateFrame('Frame', nil, self.Spec['Spec'..i]) + self.Spec['Spec'..i].Tab:Size(120, 30) + self.Spec['Spec'..i].Tab:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = 0, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['Spec'..i].Tab:SetBackdropColor(0, 0, 0, .7) + self.Spec['Spec'..i].Tab:SetBackdropBorderColor(0, 0, 0, 0) + self.Spec['Spec'..i].Tab:Point('TOPRIGHT', self.Spec['Spec'..i]) + C.Toolkit.TextSetting(self.Spec['Spec'..i].Tab, nil, { ['FontSize'] = 10, ['FontOutline'] = 'OUTLINE' }, 'TOPLEFT', 0, 0) + self.Spec['Spec'..i].Tab.text:Point('BOTTOMRIGHT', 0, -4) + + self.Spec['Spec'..i].Icon = CreateFrame('Frame', nil, self.Spec['Spec'..i].Tab) + self.Spec['Spec'..i].Icon:Size(27, 26) + self.Spec['Spec'..i].Icon:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['Spec'..i].Icon:SetBackdropColor(0, 0, 0, .7) + self.Spec['Spec'..i].Icon:Point('TOPLEFT', self.Spec['Spec'..i]) + + self.Spec['Spec'..i].Texture = self.Spec['Spec'..i].Icon:CreateTexture(nil, 'OVERLAY') + self.Spec['Spec'..i].Texture:SetTexCoord(unpack(E.TexCoords)) + self.Spec['Spec'..i].Texture:SetInside() + + self.Spec['Spec'..i].TopBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY') + self.Spec['Spec'..i].TopBorder:Point('TOPLEFT', self.Spec['Spec'..i].Tab) + self.Spec['Spec'..i].TopBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].Tab, 'TOPRIGHT', 0, -E.mult) + + self.Spec['Spec'..i].LeftBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY') + self.Spec['Spec'..i].LeftBorder:Point('TOPLEFT', self.Spec['Spec'..i].TopBorder, 'BOTTOMLEFT') + self.Spec['Spec'..i].LeftBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].Tab, 'BOTTOMLEFT', E.mult, 0) + + self.Spec['Spec'..i].RightBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY') + self.Spec['Spec'..i].RightBorder:Point('TOPLEFT', self.Spec['Spec'..i].TopBorder, 'BOTTOMRIGHT', -E.mult, 0) + self.Spec['Spec'..i].RightBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].Tab) + + self.Spec['Spec'..i].BottomLeftBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY') + self.Spec['Spec'..i].BottomLeftBorder:Point('TOPLEFT', self.Spec.BG, 0, E.mult) + self.Spec['Spec'..i].BottomLeftBorder:Point('BOTTOMRIGHT', self.Spec['Spec'..i].LeftBorder, 'BOTTOMLEFT') + + self.Spec['Spec'..i].BottomRightBorder = self.Spec['Spec'..i].Tab:CreateTexture(nil, 'OVERLAY') + self.Spec['Spec'..i].BottomRightBorder:Point('TOPRIGHT', self.Spec.BG, 0, E.mult) + self.Spec['Spec'..i].BottomRightBorder:Point('BOTTOMLEFT', self.Spec['Spec'..i].RightBorder, 'BOTTOMRIGHT') + end + self.Spec.Spec1:Point('BOTTOMLEFT', self.Spec.BG, 'TOPLEFT', 20, 0) + self.Spec.Spec2:Point('BOTTOMRIGHT', self.Spec.BG, 'TOPRIGHT', -20, 0) + end + + for i = 1, MAX_NUM_TALENT_TIERS do + self.Spec['TalentTier'..i] = CreateFrame('Frame', nil, self.Spec.Page) + self.Spec['TalentTier'..i]:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['TalentTier'..i]:SetBackdropColor(.08, .08, .08) + self.Spec['TalentTier'..i]:SetBackdropBorderColor(0, 0, 0) + self.Spec['TalentTier'..i]:SetFrameLevel(CoreFrameLevel + 2) + self.Spec['TalentTier'..i]:Size(352, TALENT_SLOT_SIZE + SPACING * 2) + + for k = 1, NUM_TALENT_COLUMNS do + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)] = CreateFrame('Frame', nil, self.Spec['TalentTier'..i]) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetFrameLevel(CoreFrameLevel + 3) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:Size(114, TALENT_SLOT_SIZE) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon = CreateFrame('Frame', nil, self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:Size(20) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture = self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:CreateTexture(nil, 'OVERLAY') + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetTexCoord(unpack(E.TexCoords)) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetInside() + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:Point('LEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)], SPACING, 0) + C.Toolkit.TextSetting(self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)], nil, { ['FontSize'] = 9, ['directionH'] = 'LEFT' }, 'TOPLEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon, 'TOPRIGHT', SPACING, SPACING) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:Point('BOTTOMLEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon, 'BOTTOMRIGHT', SPACING, -SPACING) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:Point('RIGHT', -SPACING, 0) + + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip = CreateFrame('Button', nil, self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetFrameLevel(CoreFrameLevel + 4) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetInside() + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetScript('OnClick', self.OnClick) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetScript('OnEnter', C.CommonScript.OnEnter) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Tooltip:SetScript('OnLeave', C.CommonScript.OnLeave) + end + + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 1)]:Point('RIGHT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 2)], 'LEFT', -2, 0) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 2)]:Point('CENTER', self.Spec['TalentTier'..i]) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 3)]:Point('LEFT', self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + 2)], 'RIGHT', 2, 0) + end + + self.Spec.TalentTier1:Point('TOP', self.Spec.Page, 0, -2) + self.Spec.TalentTier2:Point('TOP', self.Spec.TalentTier1, 'BOTTOM', 0, -SPACING) + self.Spec.TalentTier3:Point('TOP', self.Spec.TalentTier2, 'BOTTOM', 0, -SPACING) + self.Spec.TalentTier4:Point('TOP', self.Spec.TalentTier3, 'BOTTOM', 0, -SPACING) + self.Spec.TalentTier5:Point('TOP', self.Spec.TalentTier4, 'BOTTOM', 0, -SPACING) + self.Spec.TalentTier6:Point('TOP', self.Spec.TalentTier5, 'BOTTOM', 0, -SPACING) + + for _, groupName in pairs({ 'MAJOR_GLYPH', 'MINOR_GLYPH' }) do + self.Spec['GLYPH_'..groupName] = CreateFrame('Frame', nil, self.Spec.Page) + self.Spec['GLYPH_'..groupName]:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['GLYPH_'..groupName]:SetBackdropColor(.08, .08, .08) + self.Spec['GLYPH_'..groupName]:SetBackdropBorderColor(0, 0, 0) + self.Spec['GLYPH_'..groupName]:Height(GLYPH_SLOT_HEIGHT * 3 + SPACING * 3 + 22) + C.Toolkit.TextSetting(self.Spec['GLYPH_'..groupName], '|cffceff00<|r '.._G[groupName]..' |cffceff00>|r', { ['FontSize'] = 10 }, 'TOP', self.Spec['GLYPH_'..groupName], 0, -5) + end + + for i = 1, NUM_GLYPH_SLOTS do + self.Spec['Glyph'..i] = CreateFrame('Button', nil, self.Spec.Page) + self.Spec['Glyph'..i]:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['Glyph'..i]:SetFrameLevel(CoreFrameLevel + 2) + self.Spec['Glyph'..i]:Height(GLYPH_SLOT_HEIGHT) + + self.Spec['Glyph'..i].NeedLevel = (i == 1 or i == 2) and 25 or (i == 3 or i == 4) and 50 or 75 + + self.Spec['Glyph'..i].Icon = CreateFrame('Frame', nil, self.Spec['Glyph'..i]) + self.Spec['Glyph'..i].Icon:Size(16) + self.Spec['Glyph'..i].Icon:SetBackdrop({ + bgFile = E.media.blankTex, + edgeFile = E.media.blankTex, + tile = false, tileSize = 0, edgeSize = E.mult, + insets = { left = 0, right = 0, top = 0, bottom = 0} + }) + self.Spec['Glyph'..i].Icon:SetBackdropColor(.15, .15, .15) + self.Spec['Glyph'..i].Icon:SetFrameLevel(CoreFrameLevel + 3) + self.Spec['Glyph'..i].Icon.Texture = self.Spec['Glyph'..i].Icon:CreateTexture(nil, 'OVERLAY') + self.Spec['Glyph'..i].Icon.Texture:SetTexCoord(unpack(E.TexCoords)) + self.Spec['Glyph'..i].Icon.Texture:SetInside() + self.Spec['Glyph'..i].Icon:Point('LEFT', self.Spec['Glyph'..i], SPACING, 0) + + self.Spec['Glyph'..i].Tooltip = CreateFrame('Button', nil, self.Spec['Glyph'..i]) + self.Spec['Glyph'..i].Tooltip:SetFrameLevel(CoreFrameLevel + 4) + self.Spec['Glyph'..i].Tooltip:SetInside() + self.Spec['Glyph'..i].Tooltip:SetScript('OnClick', self.OnClick) + self.Spec['Glyph'..i].Tooltip:SetScript('OnEnter', C.CommonScript.OnEnter) + self.Spec['Glyph'..i].Tooltip:SetScript('OnLeave', C.CommonScript.OnLeave) + self.Spec['Glyph'..i].Tooltip.EnableAuctionSearch = true + + C.Toolkit.TextSetting(self.Spec['Glyph'..i], nil, { ['FontSize'] = 9, ['directionH'] = 'LEFT' }, 'LEFT', self.Spec['Glyph'..i].Icon, 'RIGHT', SPACING, 0) + self.Spec['Glyph'..i].text:Point('RIGHT', self.Spec['Glyph'..i], -SPACING, 0) + end + + self.Spec.Glyph2:Point('TOP', self.Spec.GLYPH_MAJOR_GLYPH.text, 'BOTTOM', 0, -7) + self.Spec.Glyph2:Point('LEFT', self.Spec.GLYPH_MAJOR_GLYPH, SPACING, 0) + self.Spec.Glyph2:Point('RIGHT', self.Spec.GLYPH_MAJOR_GLYPH, -SPACING, 0) + self.Spec.Glyph4:Point('TOPLEFT', self.Spec.Glyph2, 'BOTTOMLEFT', 0, -SPACING) + self.Spec.Glyph4:Point('TOPRIGHT', self.Spec.Glyph2, 'BOTTOMRIGHT', 0, -SPACING) + self.Spec.Glyph6:Point('TOPLEFT', self.Spec.Glyph4, 'BOTTOMLEFT', 0, -SPACING) + self.Spec.Glyph6:Point('TOPRIGHT', self.Spec.Glyph4, 'BOTTOMRIGHT', 0, -SPACING) + + self.Spec.Glyph1:Point('TOP', self.Spec.GLYPH_MINOR_GLYPH.text, 'BOTTOM', 0, -7) + self.Spec.Glyph1:Point('LEFT', self.Spec.GLYPH_MINOR_GLYPH, SPACING, 0) + self.Spec.Glyph1:Point('RIGHT', self.Spec.GLYPH_MINOR_GLYPH, -SPACING, 0) + self.Spec.Glyph3:Point('TOPLEFT', self.Spec.Glyph1, 'BOTTOMLEFT', 0, -SPACING) + self.Spec.Glyph3:Point('TOPRIGHT', self.Spec.Glyph1, 'BOTTOMRIGHT', 0, -SPACING) + self.Spec.Glyph5:Point('TOPLEFT', self.Spec.Glyph3, 'BOTTOMLEFT', 0, -SPACING) + self.Spec.Glyph5:Point('TOPRIGHT', self.Spec.Glyph3, 'BOTTOMRIGHT', 0, -SPACING) + + self.Spec.GLYPH_MAJOR_GLYPH:Point('TOPLEFT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOMLEFT', 0, -SPACING) + self.Spec.GLYPH_MAJOR_GLYPH:Point('TOPRIGHT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOM', -2, -SPACING) + self.Spec.GLYPH_MINOR_GLYPH:Point('TOPLEFT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOM', 2, -SPACING) + self.Spec.GLYPH_MINOR_GLYPH:Point('TOPRIGHT', self.Spec['TalentTier'..MAX_NUM_TALENT_TIERS], 'BOTTOMRIGHT', 0, -SPACING) + end + + do --<< Scanning Tooltip >>-- + self.ScanTTForInspecting = CreateFrame('GameTooltip', 'KnightInspectScanTT_I', nil, 'GameTooltipTemplate') + self.ScanTTForInspecting:SetOwner(UIParent, 'ANCHOR_NONE') + self.ScanTT = CreateFrame('GameTooltip', 'KnightInspectScanTT', nil, 'GameTooltipTemplate') + self.ScanTT:SetOwner(UIParent, 'ANCHOR_NONE') + end + + do --<< UnitPopup Setting >>-- + hooksecurefunc('UnitPopup_HideButtons', function() + if KI.Activate then + local Unit = UIDROPDOWNMENU_INIT_MENU.unit + local Name = UIDROPDOWNMENU_INIT_MENU.name + + if Name then + Name = Name..(UIDROPDOWNMENU_INIT_MENU.server and UIDROPDOWNMENU_INIT_MENU.server ~= '' and UIDROPDOWNMENU_INIT_MENU.server ~= E.myrealm and '-'..UIDROPDOWNMENU_INIT_MENU.server or '') + Unit = UnitExists(Name) and Name or Unit + + for index, value in ipairs(UnitPopupMenus[UIDROPDOWNMENU_MENU_VALUE] or UnitPopupMenus[UIDROPDOWNMENU_INIT_MENU.which]) do + if value == 'KnightInspect' then + if not (Unit and not UnitCanAttack('player', Unit) and UnitIsConnected(Unit)) then + if AISM then + AISM.GroupMemberData[Name] = nil + end + + UnitPopupShown[UIDROPDOWNMENU_MENU_LEVEL][index] = 0 + end + + if AISM and (AISM.GroupMemberData[Name] or AISM.GuildMemberData[Name]) then + UnitPopupShown[UIDROPDOWNMENU_MENU_LEVEL][index] = 1 + end + + return + end + end + end + end + end) + + local Count, tempCount + hooksecurefunc('UnitPopup_OnUpdate', function() + if not DropDownList1:IsShown() or not KI.Activate then return end + + for level, dropdownFrame in pairs(OPEN_DROPDOWNMENUS) do + if dropdownFrame then + Count = 0 + + for index, value in ipairs(UnitPopupMenus[dropdownFrame.which]) do + if UnitPopupShown[level][index] == 1 then + Count = Count + 1 + + if level > 1 then + tempCount = Count + else + tempCount = Count + 1 + end + + if value == 'KnightInspect' then + --local Type = dropdownFrame.which + local Unit = UIDROPDOWNMENU_INIT_MENU.unit + local Name = UIDROPDOWNMENU_INIT_MENU.name + + Name = Name..(UIDROPDOWNMENU_INIT_MENU.server and UIDROPDOWNMENU_INIT_MENU.server ~= '' and UIDROPDOWNMENU_INIT_MENU.server ~= E.myrealm and '-'..UIDROPDOWNMENU_INIT_MENU.server or '') + Unit = UnitExists(Name) and Name or Unit + + if AISM and (type(AISM.GroupMemberData[Name]) == 'table' or AISM.GuildMemberData[Name]) or Unit and UnitIsVisible(Unit) then + UIDropDownMenu_EnableButton(level, tempCount) + else + UIDropDownMenu_DisableButton(level, tempCount) + end + end + end + end + end + end + end) + + hooksecurefunc('UnitPopup_OnClick', function(self) + if KI.Activate and self.value == 'KnightInspect' then + --local Type = UIDROPDOWNMENU_INIT_MENU.which + local Name = UIDROPDOWNMENU_INIT_MENU.name + local Realm = UIDROPDOWNMENU_INIT_MENU.server + Realm = Realm ~= '' and Realm or E.myrealm + + local TableIndex = Name..(Realm ~= E.myrealm and '-'..Realm or '') + local Unit = UnitExists(TableIndex) and TableIndex or UIDROPDOWNMENU_INIT_MENU.unit + + local SendChannel + + if AISM and AISM.GuildMemberData[TableIndex] then + if Realm == E.myrealm then + SendChannel = 'WHISPER' + else + SendChannel = 'GUILD' + end + elseif KI.CurrentGroupMode ~= 'NoGroup' and AISM and type(AISM.GroupMemberData[TableIndex]) == 'table' then + if Realm == E.myrealm then + SendChannel = 'WHISPER' + else + SendChannel = KI.InstanceType == 'pvp' and 'BATTLEGROUND' or IsInGroup(LE_PARTY_CATEGORY_INSTANCE) and 'INSTANCE_CHAT' or string.upper(KI.CurrentGroupMode) + end + end + + if AISM and SendChannel then + AISM.CurrentInspectData[TableIndex] = { + ['UnitID'] = Unit, + } + AISM:RegisterInspectDataRequest(function(User, UserData) + if User == TableIndex then + KI.CurrentInspectData = E:CopyTable({}, KI.Default_CurrentInspectData) + E:CopyTable(KI.CurrentInspectData, UserData) + KI:ShowFrame(KI.CurrentInspectData) + + return true + end + end, TableIndex, true) + SendAddonMessage('AISM_Inspect', 'AISM_DataRequestForInspecting:'..Name..'-'..Realm, SendChannel, TableIndex) + elseif Unit then + KI.InspectUnit(Unit) + end + end + end) + end + + do --<< Updater >>-- + self.Updater = CreateFrame('Frame') + self.Updater:Hide() + end + + HideUIPanel(self) + + self.CreateInspectFrame = nil +end + +KI.INSPECT_READY = function(InspectedUnitGUID) + local UnitID = KI.CurrentInspectData.Name..(KI.CurrentInspectData.Realm and '-'..KI.CurrentInspectData.Realm or '') + local GUIDByUnitName = UnitGUID(UnitID) + local Name, Realm = UnitFullName(UnitID) + + if not GUIDByUnitName then + UnitID = KI.CurrentInspectData.UnitID + GUIDByUnitName = UnitGUID(UnitID) + Name, Realm = UnitFullName(UnitID) + end + + if not Name then + _, _, _, _, _, Name, Realm = GetPlayerInfoByGUID(InspectedUnitGUID) + end + + local TableIndex = Name..(Realm and Realm ~= '' and Realm ~= E.myrealm and '-'..E.myrealm or '') + + if InspectedUnitGUID ~= GUIDByUnitName then + if GUIDByUnitName and KI.CurrentInspectData.Name == Name and KI.CurrentInspectData.Realm == Realm then + KI.CurrentInspectData.UnitGUID = GUIDByUnitName + return + else + ENI.CancelInspect(TableIndex) + KI:UnregisterEvent('INSPECT_READY', 'KnightInspect') + + return + end + end + + _, _, KI.CurrentInspectData.Race, KI.CurrentInspectData.RaceID, KI.CurrentInspectData.GenderID = GetPlayerInfoByGUID(InspectedUnitGUID) + + local needReinspect + local CurrentSetItem = {} + local Slot, SlotTexture, SlotLink, CheckSpace, colorR, colorG, colorB, tooltipText, TransmogrifiedItem, SetName, SetItemCount, SetItemMax, SetOptionCount + for _, SlotName in pairs(C.GearList) do + Slot = KI[SlotName] + KI.CurrentInspectData.Gear[SlotName] = {} + + SlotTexture = GetInventoryItemTexture(UnitID, Slot.ID) + + if SlotTexture and SlotTexture..'.blp' ~= Slot.EmptyTexture then + SlotLink = GetInventoryItemLink(UnitID, Slot.ID) + + if not SlotLink then + needReinspect = true + else + KI.CurrentInspectData.Gear[SlotName].ItemLink = SlotLink + + KI.ScanTTForInspecting:ClearLines() + for i = 1, 10 do + _G['KnightInspectScanTT_ITexture'..i]:SetTexture(nil) + end + KI.ScanTTForInspecting:SetInventoryItem(UnitID, Slot.ID) + + TransmogrifiedItem = nil + checkSpace = 2 + SetOptionCount = 1 + + for i = 1, KI.ScanTTForInspecting:NumLines() do + tooltipText = _G['KnightInspectScanTT_ITextLeft'..i]:GetText() + + if not TransmogrifiedItem and tooltipText:match(C.TransmogrifiedKey) then + if type(KI.CurrentInspectData.Gear[SlotName].Transmogrify) ~= 'number' then + KI.CurrentInspectData.Gear[SlotName].Transmogrify = tooltipText:match(C.TransmogrifiedKey) + end + + TransmogrifiedItem = true + end + + SetName, SetItemCount, SetItemMax = tooltipText:match('^(.+) %((%d)/(%d)%)$') -- find string likes 'SetName (0/5)' + if SetName then + SetItemCount = tonumber(SetItemCount) + SetItemMax = tonumber(SetItemMax) + + if SetItemCount > SetItemMax or SetItemMax == 1 then + needReinspect = true + break + elseif CurrentSetItem[SetName] then + break + else + CurrentSetItem[SetName] = {} + + for k = 1, KI.ScanTTForInspecting:NumLines() do + tooltipText = _G['KnightInspectScanTT_ITextLeft'..(i+k)]:GetText() + + if tooltipText == ' ' then + checkSpace = checkSpace - 1 + + if checkSpace == 0 then break end + elseif checkSpace == 2 then + colorR, colorG, colorB = _G['KnightInspectScanTT_ITextLeft'..(i+k)]:GetTextColor() + + if colorR > LIGHTYELLOW_FONT_COLOR.r - 0.01 and colorR < LIGHTYELLOW_FONT_COLOR.r + 0.01 and colorG > LIGHTYELLOW_FONT_COLOR.g - 0.01 and colorG < LIGHTYELLOW_FONT_COLOR.g + 0.01 and colorB > LIGHTYELLOW_FONT_COLOR.b - 0.01 and colorB < LIGHTYELLOW_FONT_COLOR.b + 0.01 then + CurrentSetItem[SetName][#CurrentSetItem[SetName] + 1] = LIGHTYELLOW_FONT_COLOR_CODE..tooltipText + else + CurrentSetItem[SetName][#CurrentSetItem[SetName] + 1] = GRAY_FONT_COLOR_CODE..tooltipText + end + elseif tooltipText:find(C.ItemSetBonusKey) then + CurrentSetItem[SetName]['SetOption'..SetOptionCount] = tooltipText:match("^%((%d)%)%s.+:%s.+$") or true + + SetOptionCount = SetOptionCount + 1 + end + end + + KI.CurrentInspectData.SetItem[SetName] = CurrentSetItem[SetName] + + break + end + end + + if checkSpace == 0 then break end + end + end + end + end + + if KI.CurrentInspectData.SetItem then + for SetName in pairs(KI.CurrentInspectData.SetItem) do + if not CurrentSetItem[SetName] then + KI.CurrentInspectData.SetItem[SetName] = nil + end + end + end + + -- Specialization + KI.CurrentInspectData.Specialization[1].SpecializationID = GetInspectSpecialization(UnitID) + for i = 1, NUM_TALENT_COLUMNS * MAX_NUM_TALENT_TIERS do + KI.CurrentInspectData.Specialization[1]['Talent'..i] = select(5, GetTalentInfo(i, true, nil, UnitID, KI.CurrentInspectData.ClassID)) + end + + -- Glyph + local SpellID, GlyphID + for i = 1, NUM_GLYPH_SLOTS do + _, _, _, SpellID, _, GlyphID = GetGlyphSocketInfo(i, nil, true, UnitID) + + KI.CurrentInspectData.Glyph[1]['Glyph'..i..'SpellID'] = SpellID or 0 + KI.CurrentInspectData.Glyph[1]['Glyph'..i..'ID'] = GlyphID or 0 + end + + -- Guild + KI.CurrentInspectData.guildLevel, _, KI.CurrentInspectData.guildNumMembers = GetInspectGuildInfo(UnitID) + KI.CurrentInspectData.guildEmblem = { GetGuildLogoInfo(UnitID) } + + if needReinspect then + return + end + + ENI.CancelInspect(TableIndex) + KI:ShowFrame(KI.CurrentInspectData) + KI:UnregisterEvent('INSPECT_READY') +end + +KI.InspectUnit = function(UnitID) + if not UnitExists('mouseover') and UnitExists('target') then + UnitID = 'target' + end + + if not UnitIsPlayer(UnitID) then + return + elseif UnitIsDeadOrGhost('player') then + print('|cff2eb7e4[S&L]|r : '..L["You can't inspect while dead."]) + + return + elseif not UnitIsVisible(UnitID) then + + return + else + UnitID = NotifyInspect(UnitID, true) or UnitID + + KI.CurrentInspectData = E:CopyTable({}, KI.Default_CurrentInspectData) + + KI.CurrentInspectData.UnitID = UnitID + KI.CurrentInspectData.UnitGUID = UnitGUID(UnitID) + KI.CurrentInspectData.Title = UnitPVPName(UnitID) + KI.CurrentInspectData.Level = UnitLevel(UnitID) + KI.CurrentInspectData.Name, KI.CurrentInspectData.Realm = UnitFullName(UnitID) + _, KI.CurrentInspectData.Class, KI.CurrentInspectData.ClassID = UnitClass(UnitID) + KI.CurrentInspectData.guildName, KI.CurrentInspectData.guildRankName = GetGuildInfo(UnitID) + + KI.CurrentInspectData.Realm = KI.CurrentInspectData.Realm ~= '' and KI.CurrentInspectData.Realm ~= E.myrealm and KI.CurrentInspectData.Realm or nil + + KI:RegisterEvent('INSPECT_READY') + end +end + +function KI:ShowFrame(DataTable) + local needUpdate, CheckItemInfoReceived + + for _, slotName in pairs(C.GearList) do + if DataTable.Gear[slotName] and DataTable.Gear[slotName].ItemLink then + _, CheckItemInfoReceived = GetItemInfo(DataTable.Gear[slotName].ItemLink) + + if not CheckItemInfoReceived then + needUpdate = true + + if not self.GET_ITEM_INFO_RECEIVED then + self.GET_ITEM_INFO_RECEIVED = function() + self:ShowFrame(DataTable) + end + self:RegisterEvent('GET_ITEM_INFO_RECEIVED') + end + end + end + end + + if needUpdate then + return + end + + self.GET_ITEM_INFO_RECEIVED = nil + self:UnregisterEvent('GET_ITEM_INFO_RECEIVED') + + self.Updater:Show() + self.Updater:SetScript('OnUpdate', function() + if not self:InspectFrame_DataSetting(DataTable) then + self.Updater:SetScript('OnUpdate', nil) + self.Updater:Hide() + + ShowUIPanel(KnightInspect) + end + end) +end + +function KI:InspectFrame_DataSetting(DataTable) + local needUpdate + local r, g, b + + do --<< Equipment Slot and Enchant, Gem Setting >>-- + local ErrorDetected + local ItemCount, ItemTotal = 0, 0 + local Slot, ItemRarity, BasicItemLevel, TrueItemLevel, ItemUpgradeID, ItemTexture, IsEnchanted, CurrentLineText, GemCount_Default, GemCount_Enable, GemCount_Now, GemCount + local arg1, itemID, enchantID, _, _, _, _, arg2, arg3, arg4, arg5, arg6 + + -- Setting except shirt and tabard + for _, slotName in pairs(self.GearUpdated or C.GearList) do + if slotName ~= 'ShirtSlot' and slotName ~= 'TabardSlot' then + Slot = self[slotName] + + do --<< Clear Setting >>-- + ErrorDetected, TrueItemLevel, IsEnchanted, ItemUpgradeID, ItemTexture, r, g, b = nil, nil, nil, nil, nil, 0, 0, 0 + + Slot.Link = nil + Slot.ItemLevel:SetText(nil) + Slot.Gradation.ItemLevel:SetText(nil) + Slot.Gradation.ItemEnchant:SetText(nil) + for i = 1, MAX_NUM_SOCKETS do + Slot['Socket'..i].Texture:SetTexture(nil) + Slot['Socket'..i].GemItemID = nil + Slot['Socket'..i].GemType = nil + Slot['Socket'..i]:Hide() + end + Slot.EnchantWarning:Hide() + Slot.EnchantWarning.Message = nil + Slot.SocketWarning:Point(Slot.Direction, Slot.Socket1) + Slot.SocketWarning:Hide() + Slot.SocketWarning.Link = nil + Slot.SocketWarning.Message = nil + end + + if DataTable.Gear[slotName].ItemLink then + _, Slot.Link = GetItemInfo(DataTable.Gear[slotName].ItemLink) + + do --<< Gem Parts >>-- + arg1, itemID, enchantID, _, _, _, _, arg2, arg3, arg4, arg5, arg6 = strsplit(':', Slot.Link) + + self.ScanTT:ClearLines() + for i = 1, 10 do + _G['KnightInspectScanTTTexture'..i]:SetTexture(nil) + end + self.ScanTT:SetHyperlink(format('%s:%s:%d:0:0:0:0:%s:%s:%s:%s:%s', arg1, itemID, enchantID, arg2, arg3, arg4, arg5, arg6)) + + GemCount_Default, GemCount_Now, GemCount = 0, 0, 0 + + -- First, Counting default gem sockets + for i = 1, MAX_NUM_SOCKETS do + ItemTexture = _G['KnightInspectScanTTTexture'..i]:GetTexture() + + if ItemTexture and ItemTexture:find('Interface\\ItemSocketingFrame\\') then + GemCount_Default = GemCount_Default + 1 + Slot['Socket'..GemCount_Default].GemType = strupper(gsub(ItemTexture, 'Interface\\ItemSocketingFrame\\UI--EmptySocket--', '')) + end + end + + -- Second, Check if slot's item enable to adding a socket + GemCount_Enable = GemCount_Default + if (slotName == 'WaistSlot' and DataTable.Level >= 70) or -- buckle + ((slotName == 'WristSlot' or slotName == 'HandsSlot') and (DataTable.Profession[1].Name == GetSpellInfo(110396) and DataTable.Profession[1].Level >= 550 or DataTable.Profession[2].Name == GetSpellInfo(110396) and DataTable.Profession[2].Level >= 550)) then -- BlackSmith + + GemCount_Enable = GemCount_Enable + 1 + Slot['Socket'..GemCount_Enable].GemType = 'PRISMATIC' + end + + self.ScanTT:ClearLines() + for i = 1, 10 do + _G['KnightInspectScanTTTexture'..i]:SetTexture(nil) + end + self.ScanTT:SetHyperlink(Slot.Link) + + -- Apply current item's gem setting + for i = 1, MAX_NUM_SOCKETS do + ItemTexture = _G['KnightInspectScanTTTexture'..i]:GetTexture() + + if Slot['Socket'..i].GemType and C.GemColor[Slot['Socket'..i].GemType] then + r, g, b = unpack(C.GemColor[Slot['Socket'..i].GemType]) + Slot['Socket'..i].Socket:SetBackdropColor(r, g, b, 0.5) + Slot['Socket'..i].Socket:SetBackdropBorderColor(r, g, b) + else + Slot['Socket'..i].Socket:SetBackdropColor(1, 1, 1, 0.5) + Slot['Socket'..i].Socket:SetBackdropBorderColor(1, 1, 1) + end + + if ItemTexture then + Slot['Socket'..i]:Show() + GemCount_Now = GemCount_Now + 1 + Slot.SocketWarning:Point(Slot.Direction, Slot['Socket'..i], (Slot.Direction == 'LEFT' and 'RIGHT' or 'LEFT'), Slot.Direction == 'LEFT' and 3 or -3, 0) + + if DataTable.Gear[slotName]['Gem'..i] then + GemCount = GemCount + 1 + Slot['Socket'..i].Texture:SetTexture(ItemTexture) + Slot['Socket'..i].GemItemID = DataTable.Gear[slotName]['Gem'..i] + else + CurrentLineText = select(2, _G['KnightInspectScanTTTexture'..i]:GetPoint()):GetText() + + if not C.EmptySocketString[CurrentLineText] then + GemCount = GemCount + 1 + Slot['Socket'..i].Texture:SetTexture(ItemTexture) + Slot['Socket'..i].GemItemID = CurrentLineText + end + end + end + end + + if GemCount_Now < GemCount_Default then -- ItemInfo not loaded + needUpdate = needUpdate or {} + needUpdate[#needUpdate + 1] = slotName + end + end + + _, _, ItemRarity, BasicItemLevel, _, _, _, _, _, ItemTexture = GetItemInfo(Slot.Link) + r, g, b = GetItemQualityColor(ItemRarity) + + ItemUpgradeID = Slot.Link:match(':(%d+)\124h%[') + + --<< Enchant Parts >>-- + for i = 1, self.ScanTT:NumLines() do + CurrentLineText = _G['KnightInspectScanTTTextLeft'..i]:GetText() + + if CurrentLineText:find(C.ItemLevelKey_Alt) then + TrueItemLevel = tonumber(CurrentLineText:match(C.ItemLevelKey_Alt)) + elseif CurrentLineText:find(C.ItemLevelKey) then + TrueItemLevel = tonumber(CurrentLineText:match(C.ItemLevelKey)) + elseif CurrentLineText:find(C.EnchantKey) then + CurrentLineText = CurrentLineText:match(C.EnchantKey) -- Get enchant string + CurrentLineText = gsub(CurrentLineText, ITEM_MOD_AGILITY_SHORT, AGI) + CurrentLineText = gsub(CurrentLineText, ITEM_MOD_SPIRIT_SHORT, SPI) + CurrentLineText = gsub(CurrentLineText, ITEM_MOD_STAMINA_SHORT, STA) + CurrentLineText = gsub(CurrentLineText, ITEM_MOD_STRENGTH_SHORT, STR) + CurrentLineText = gsub(CurrentLineText, ITEM_MOD_INTELLECT_SHORT, INT) + CurrentLineText = gsub(CurrentLineText, ITEM_MOD_CRIT_RATING_SHORT, CRIT_ABBR) -- Critical is too long + CurrentLineText = gsub(CurrentLineText, ' + ', '+') -- Remove space + + Slot.Gradation.ItemEnchant:SetText('|cffceff00'..CurrentLineText) + + IsEnchanted = true + end + end + + --<< ItemLevel Parts >>-- + if BasicItemLevel then + ItemCount = ItemCount + 1 + + if ItemUpgradeID then + if ItemUpgradeID == '0' then + ItemUpgradeID = nil + else + ItemUpgradeID = TrueItemLevel - BasicItemLevel + end + end + + ItemTotal = ItemTotal + TrueItemLevel + + Slot.ItemLevel:SetText((ItemUpgradeID and (C.UpgradeColor[ItemUpgradeID] or '|cffffffff') or '')..TrueItemLevel) + Slot.Gradation.ItemLevel:SetText((Slot.Direction == 'LEFT' and TrueItemLevel or '')..(ItemUpgradeID and (Slot.Direction == 'LEFT' and ' ' or '')..(C.UpgradeColor[ItemUpgradeID] or '|cffaaaaaa')..'(+'..ItemUpgradeID..')|r'..(Slot.Direction == 'RIGHT' and ' ' or '') or '')..(Slot.Direction == 'RIGHT' and TrueItemLevel or '')) + end + + -- Check Error + if (not IsEnchanted and C.EnchantableSlots[slotName]) or ((slotName == 'Finger0Slot' or slotName == 'Finger1Slot') and (DataTable.Profession[1].Name == GetSpellInfo(110400) and DataTable.Profession[1].Level >= 550 or DataTable.Profession[2].Name == GetSpellInfo(110400) and DataTable.Profession[2].Level >= 550) and not IsEnchanted) then + ErrorDetected = true + Slot.EnchantWarning:Show() + Slot.Gradation.ItemEnchant:SetText('|cffff0000'..L['Not Enchanted']) + elseif slotName == 'ShoulderSlot' and C.ItemEnchant_Profession_Inscription and (DataTable.Profession[1].Name == GetSpellInfo(110417) and DataTable.Profession[1].Level >= C.ItemEnchant_Profession_Inscription.NeedLevel or DataTable.Profession[2].Name == GetSpellInfo(110417) and DataTable.Profession[2].Level >= C.ItemEnchant_Profession_Inscription.NeedLevel) and not C.ItemEnchant_Profession_Inscription[enchantID] then + ErrorDetected = true + Slot.EnchantWarning:Show() + Slot.EnchantWarning.Message = '|cff71d5ff'..GetSpellInfo(110400)..'|r : '..L['This is not profession only.'] + elseif slotName == 'WristSlot' and C.ItemEnchant_Profession_LeatherWorking and (DataTable.Profession[1].Name == GetSpellInfo(110423) and DataTable.Profession[1].Level >= C.ItemEnchant_Profession_LeatherWorking.NeedLevel or DataTable.Profession[2].Name == GetSpellInfo(110423) and DataTable.Profession[2].Level >= C.ItemEnchant_Profession_LeatherWorking.NeedLevel) and not C.ItemEnchant_Profession_LeatherWorking[enchantID] then + ErrorDetected = true + Slot.EnchantWarning:Show() + Slot.EnchantWarning.Message = '|cff71d5ff'..GetSpellInfo(110423)..'|r : '..L['This is not profession only.'] + elseif slotName == 'BackSlot' and C.ItemEnchant_Profession_Tailoring and (DataTable.Profession[1].Name == GetSpellInfo(110426) and DataTable.Profession[1].Level >= C.ItemEnchant_Profession_Tailoring.NeedLevel or DataTable.Profession[2].Name == GetSpellInfo(110426) and DataTable.Profession[2].Level >= C.ItemEnchant_Profession_Tailoring.NeedLevel) and not C.ItemEnchant_Profession_Tailoring[enchantID] then + ErrorDetected = true + Slot.EnchantWarning:Show() + Slot.EnchantWarning.Message = '|cff71d5ff'..GetSpellInfo(110426)..'|r : '..L['This is not profession only.'] + end + + if GemCount_Enable > GemCount_Now or GemCount_Enable > GemCount or GemCount_Now > GemCount then + ErrorDetected = true + + Slot.SocketWarning:Show() + + if GemCount_Enable > GemCount_Now then + if slotName == 'WaistSlot' then + if TrueItemLevel < 300 then + _, Slot.SocketWarning.Link = GetItemInfo(41611) + elseif TrueItemLevel < 417 then + _, Slot.SocketWarning.Link = GetItemInfo(55054) + else + _, Slot.SocketWarning.Link = GetItemInfo(90046) + end + + Slot.SocketWarning.Message = L['Missing Buckle'] + + Slot.SocketWarning:SetScript('OnClick', function(self) + local itemName, itemLink + + if TrueItemLevel < 300 then + itemName, itemLink = GetItemInfo(41611) + elseif TrueItemLevel < 417 then + itemName, itemLink = GetItemInfo(55054) + else + itemName, itemLink = GetItemInfo(90046) + end + + if HandleModifiedItemClick(itemLink) then + elseif IsShiftKeyDown() and BrowseName and BrowseName:IsVisible() then + AuctionFrameBrowse_Reset(BrowseResetButton) + BrowseName:SetText(itemName) + BrowseName:SetFocus() + end + end) + elseif slotName == 'HandsSlot' then + Slot.SocketWarning.Link = GetSpellLink(114112) + Slot.SocketWarning.Message = '|cff71d5ff'..GetSpellInfo(110396)..'|r : '..L['Missing Socket'] + elseif slotName == 'WristSlot' then + Slot.SocketWarning.Link = GetSpellLink(113263) + Slot.SocketWarning.Message = '|cff71d5ff'..GetSpellInfo(110396)..'|r : '..L['Missing Socket'] + end + else + Slot.SocketWarning.Message = '|cffff5678'..(GemCount_Now - GemCount)..'|r '..L['Empty Socket'] + end + end + end + + -- Change Gradation + if ErrorDetected then + if Slot.Direction == 'LEFT' then + Slot.Gradation.Texture:SetTexCoord(0, .5, .5, 1) + else + Slot.Gradation.Texture:SetTexCoord(.5, 1, .5, 1) + end + else + if Slot.Direction == 'LEFT' then + Slot.Gradation.Texture:SetTexCoord(0, .5, 0, .5) + else + Slot.Gradation.Texture:SetTexCoord(.5, 1, 0, .5) + end + end + + Slot.Texture:SetTexture(ItemTexture or Slot.EmptyTexture) + Slot:SetBackdropBorderColor(r, g, b) + end + end + + for _, slotName in pairs({ 'ShirtSlot', 'TabardSlot' }) do + Slot = self[slotName] + ItemRarity, ItemTexture, r, g, b = nil, nil, 0, 0, 0 + + Slot.Link = DataTable.Gear[slotName].ItemLink + + if Slot.Link then + _, _, ItemRarity, _, _, _, _, _, _, ItemTexture = GetItemInfo(Slot.Link) + r, g, b = GetItemQualityColor(ItemRarity) + end + + Slot.Texture:SetTexture(ItemTexture or self[slotName].EmptyTexture) + Slot:SetBackdropBorderColor(r, g, b) + end + + self.SetItem = E:CopyTable({}, KI.CurrentInspectData.SetItem) + self.Character.AverageItemLevel:SetText(C.Toolkit.Color_Value(STAT_AVERAGE_ITEM_LEVEL)..' : '..format('%.2f', ItemTotal / ItemCount)) + end + + if needUpdate then + self.GearUpdated = needUpdate + + return true + end + self.GearUpdated = nil + + r, g, b = RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b + + do --<< Basic Information >>-- + self.Name:SetText('|c'..RAID_CLASS_COLORS[DataTable.Class].colorStr..DataTable.Name) + self.Title:SetText((DataTable.Realm and DataTable.Realm ~= E.myrealm and DataTable.Realm..L[" Server's "] or '')..'|cff93daff'..(DataTable.Title and string.gsub(DataTable.Title, DataTable.Name, '') or '')) + self.LevelRace:SetText(format('|cff%02x%02x%02x%s|r '..LEVEL..'|n%s', GetQuestDifficultyColor(DataTable.Level).r * 255, GetQuestDifficultyColor(DataTable.Level).g * 255, GetQuestDifficultyColor(DataTable.Level).b * 255, DataTable.Level, DataTable.Race)) + self.Guild:SetText(DataTable.guildName and '<|cff2eb7e4'..DataTable.guildName..'|r> [|cff2eb7e4'..DataTable.guildRankName..'|r]' or '') + self.ClassIcon:SetTexture('Interface\\ICONS\\ClassIcon_'..DataTable.Class..'.blp') + end + + do --<< Color Setting >>-- + self.Info.BG:SetBackdropBorderColor(r, g, b) + + self.Info.Profession.IconSlot:SetBackdropBorderColor(r, g, b) + self.Info.Profession.Tab:SetBackdropColor(r, g, b, .3) + self.Info.Profession.Tab:SetBackdropBorderColor(r, g, b) + self.Info.Profession.Prof1.Bar:SetStatusBarColor(r, g, b) + self.Info.Profession.Prof2.Bar:SetStatusBarColor(r, g, b) + + self.Info.Guild.IconSlot:SetBackdropBorderColor(r, g, b) + self.Info.Guild.Tab:SetBackdropColor(r, g, b, .3) + self.Info.Guild.Tab:SetBackdropBorderColor(r, g, b) + + self.Info.PvP.IconSlot:SetBackdropBorderColor(r, g, b) + self.Info.PvP.Tab:SetBackdropColor(r, g, b, .3) + self.Info.PvP.Tab:SetBackdropBorderColor(r, g, b) + end + + do --<< Information Page Setting >>-- + do -- Profession + for i = 1, 2 do + if DataTable.Profession[i].Name then + self.Info.Profession:Show() + self.Info.Profession['Prof'..i].Name:SetText(DataTable.Profession[i].Name) + self.Info.Profession['Prof'..i].Level:SetText(DataTable.Profession[i].Level) + self.Info.Profession['Prof'..i].Bar:SetValue(DataTable.Profession[i].Level) + else + self.Info.Profession:Hide() + break + end + end + end + + do -- Guild + if DataTable.guildName and DataTable.guildLevel and DataTable.guildNumMembers then + self.Info.Guild:Show() + self.Info.Guild.Banner.Name:SetText('|cff2eb7e4'..DataTable.guildName) + self.Info.Guild.Banner.LevelMembers:SetText('|cff77c0ff'..DataTable.guildLevel..'|r '..LEVEL..(DataTable.guildNumMembers > 0 and ' / '..format(INSPECT_GUILD_NUM_MEMBERS:gsub('%%d', '%%s'), '|cff77c0ff'..DataTable.guildNumMembers..'|r ') or '')) + SetSmallGuildTabardTextures('player', self.Info.Guild.Emblem, self.Info.Guild.BG, self.Info.Guild.Border, DataTable.guildEmblem) + else + self.Info.Guild:Hide() + end + end + + KI:ReArrangeCategory() + end + + do --<< Specialization Page Setting >>-- + local SpecGroup, Name, Color, Texture, SpecRole + + if DataTable.Specialization.ActiveSpec then + SpecGroup = DataTable.Specialization.ActiveSpec + + for i = 2, MAX_TALENT_GROUPS do + self.Spec['Spec'..i]:Show() + end + else + SpecGroup = 1 + + for i = 2, MAX_TALENT_GROUPS do + self.Spec['Spec'..i]:Hide() + end + end + + self.SpecIcon:SetTexture('Interface\\ICONS\\INV_Misc_QuestionMark.blp') + for i = 1, MAX_TALENT_GROUPS do + Color = '|cff808080' + + Name = nil + + if DataTable.Specialization[i].SpecializationID then + _, Name, _, Texture = GetSpecializationInfoByID(DataTable.Specialization[i].SpecializationID) + + if Name then + SpecRole = C.ClassRole[DataTable.Class][Name].Role + + if i == SpecGroup then + Color = C.ClassRole[DataTable.Class][Name].Color + self.SpecIcon:SetTexture(Texture) + end + + Name = (SpecRole == 'Tank' and '|TInterface\\AddOns\\ElvUI\\media\\textures\\tank.tga:16:16:-3:0|t' or SpecRole == 'Healer' and '|TInterface\\AddOns\\ElvUI\\media\\textures\\healer.tga:16:16:-3:-1|t' or '|TInterface\\AddOns\\ElvUI\\media\\textures\\dps.tga:16:16:-2:-1|t')..Name + end + end + + if not Name then + Texture, SpecRole = 'Interface\\ICONS\\INV_Misc_QuestionMark.blp', nil + Name = '|cff808080'..L['No Specialization'] + end + + self.Spec['Spec'..i].Tab.text:SetText(Color..Name) + self.Spec['Spec'..i].Texture:SetTexture(Texture) + self.Spec['Spec'..i].Texture:SetDesaturated(i ~= SpecGroup) + end + + -- Talents + for i = 1, NUM_TALENT_COLUMNS * MAX_NUM_TALENT_TIERS do + Name, Texture = GetTalentInfo(i, true, nil, nil, DataTable.ClassID) + + self.Spec['Talent'..i].Icon.Texture:SetTexture(Texture) + self.Spec['Talent'..i].text:SetText(Name) + self.Spec['Talent'..i].Tooltip.Link = GetTalentLink(i, true, DataTable.ClassID) + end + end + + do --<< Model and Frame Setting When InspectUnit Changed >>-- + if DataTable.UnitID and UnitIsVisible(DataTable.UnitID) then + self.Model:SetUnit(DataTable.UnitID) + else + self.Model:SetCustomRace(self.ModelList[DataTable.RaceID].RaceID, DataTable.GenderID - 2) + self.Model:TryOn(HeadSlotItem) + self.Model:TryOn(BackSlotItem) + self.Model:UndressSlot(self.HeadSlot.ID) + self.Model:UndressSlot(self.BackSlot.ID) + self.Model:Undress() + + for _, slotName in pairs(C.GearList) do + if DataTable.Gear[slotName].ItemLink then + if type(DataTable.Gear[slotName].Transmogrify) == 'number' then + self.Model:TryOn(DataTable.Gear[slotName].Transmogrify) + elseif not (DataTable.Gear[slotName].Transmogrify and DataTable.Gear[slotName].Transmogrify == 'NotDisplayed') then + self.Model:TryOn(DataTable.Gear[slotName].ItemLink) + end + end + end + end + + if not (self.LastDataSetting and self.LastDataSetting == DataTable.Name..(DataTable.Realm and '-'..DataTable.Realm or '')) then + self.Model:SetPosition(self.ModelList[DataTable.RaceID][DataTable.GenderID] and self.ModelList[DataTable.RaceID][DataTable.GenderID].z or 0, self.ModelList[DataTable.RaceID][DataTable.GenderID] and self.ModelList[DataTable.RaceID][DataTable.GenderID].x or 0, self.ModelList[DataTable.RaceID][DataTable.GenderID] and self.ModelList[DataTable.RaceID][DataTable.GenderID].y or 0) + self.Model:SetFacing(-5.67) + self.Model:SetPortraitZoom(1) + self.Model:SetPortraitZoom(0) + + self:ChangePage('CharacterButton') + self.ClassIconSlot:SetBackdropBorderColor(RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b) + self.SpecIconSlot:SetBackdropBorderColor(RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b) + + self:ToggleSpecializationTab(DataTable.Specialization.ActiveSpec or 1, DataTable) + elseif not (self.LastActiveSpec and self.LastActiveSpec == (DataTable.Specialization.ActiveSpec or 1)) then + self:ToggleSpecializationTab(DataTable.Specialization.ActiveSpec or 1, DataTable) + end + end + + self.LastDataSetting = DataTable.Name..(DataTable.Realm and '-'..DataTable.Realm or '') +end + +function KI:ReArrangeCategory() + local InfoPage_Height = 0 + local PrevCategory + + for _, CategoryType in pairs(self.InfoPageCategoryList) do + if self.Info[CategoryType]:IsShown() then + if self.Info[CategoryType].Closed then + InfoPage_Height = InfoPage_Height + INFO_TAB_SIZE + SPACING * 2 + self.Info[CategoryType]:Height(INFO_TAB_SIZE + SPACING * 2) + else + InfoPage_Height = InfoPage_Height + self.Info[CategoryType].CategoryHeight + self.Info[CategoryType]:Height(self.Info[CategoryType].CategoryHeight) + end + + if PrevCategory then + InfoPage_Height = InfoPage_Height + SPACING * 2 + self.Info[CategoryType]:Point('TOP', PrevCategory, 'BOTTOM', 0, -SPACING * 2) + else + self.Info[CategoryType]:Point('TOP', self.Info.Page) + end + + PrevCategory = self.Info[CategoryType] + end + end + + self.Info.Page:Height(InfoPage_Height) + self.ScrollFrame_OnMouseWheel(self.Info, 0) +end + + +function KI:ToggleSpecializationTab(Group, DataTable) + local r, g, b + self.LastActiveSpec = DataTable.Specialization.ActiveSpec or 1 + + for i = 1, MAX_TALENT_GROUPS do + if i == Group then + self.Spec['Spec'..i].BottomLeftBorder:Show() + self.Spec['Spec'..i].BottomRightBorder:Show() + self.Spec['Spec'..i].Tab:SetFrameLevel(CoreFrameLevel + 3) + self.Spec['Spec'..i].Tab.text:Point('BOTTOMRIGHT', 0, -10) + else + self.Spec['Spec'..i].BottomLeftBorder:Hide() + self.Spec['Spec'..i].BottomRightBorder:Hide() + self.Spec['Spec'..i].Tab:SetFrameLevel(CoreFrameLevel + 2) + self.Spec['Spec'..i].Tab.text:Point('BOTTOMRIGHT', 0, 0) + end + end + + if Group == self.LastActiveSpec then + r, g, b = RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b + else + r, g, b = .4, .4, .4 + end + + self.Spec.BottomBorder:SetTexture(r, g, b) + self.Spec.LeftBorder:SetTexture(r, g, b) + self.Spec.RightBorder:SetTexture(r, g, b) + + local LevelTable = CLASS_TALENT_LEVELS[DataTable.Class] or CLASS_TALENT_LEVELS.DEFAULT + for i = 1, MAX_NUM_TALENT_TIERS do + for k = 1, NUM_TALENT_COLUMNS do + if DataTable.Specialization[Group]['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)] then + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropColor(r, g, b, .3) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropBorderColor(r, g, b) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:SetBackdropBorderColor(r, g, b) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetDesaturated(0) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:SetTextColor(1, 1, 1) + else + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropColor(.1, .1, .1) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)]:SetBackdropBorderColor(0, 0, 0) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon:SetBackdropBorderColor(0, 0, 0) + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].Icon.Texture:SetDesaturated(1) + + if DataTable.Level < LevelTable[i] then + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:SetTextColor(.7, .3, .3) + else + self.Spec['Talent'..((i - 1) * NUM_TALENT_COLUMNS + k)].text:SetTextColor(.5, .5, .5) + end + end + end + end + + local Name, Texture + for i = 1, NUM_GLYPH_SLOTS do + Name, _, Texture = GetSpellInfo(DataTable.Glyph[Group]['Glyph'..i..'SpellID']) + + self.Spec['Glyph'..i].text:SetJustifyH('LEFT') + self.Spec['Glyph'..i].text:SetText(Name) + self.Spec['Glyph'..i].Icon.Texture:SetTexture(Texture) + self.Spec['Glyph'..i].Tooltip.Link = DataTable.Glyph[Group]['Glyph'..i..'ID'] ~= 0 and GetGlyphLinkByID(DataTable.Glyph[Group]['Glyph'..i..'ID']) + + if DataTable.Glyph[Group]['Glyph'..i..'SpellID'] ~= 0 then + self.Spec['Glyph'..i]:SetBackdropColor(r, g, b, .3) + self.Spec['Glyph'..i]:SetBackdropBorderColor(r, g, b) + self.Spec['Glyph'..i].Icon:SetBackdropBorderColor(r, g, b) + else + self.Spec['Glyph'..i]:SetBackdropColor(.1, .1, .1) + self.Spec['Glyph'..i]:SetBackdropBorderColor(0, 0, 0) + self.Spec['Glyph'..i].Icon:SetBackdropBorderColor(0, 0, 0) + + if self.Spec['Glyph'..i].NeedLevel > DataTable.Level then + self.Spec['Glyph'..i].text:SetJustifyH('CENTER') + self.Spec['Glyph'..i].text:SetText(E:RGBToHex(.7, .3, .3)..self.Spec['Glyph'..i].NeedLevel..' '..LEVEL) + end + end + end + + for i = 1, MAX_TALENT_GROUPS do + if i == self.LastActiveSpec then + r, g, b = RAID_CLASS_COLORS[DataTable.Class].r, RAID_CLASS_COLORS[DataTable.Class].g, RAID_CLASS_COLORS[DataTable.Class].b + else + r, g, b = .3, .3, .3 + end + + self.Spec['Spec'..i].TopBorder:SetTexture(r, g, b) + self.Spec['Spec'..i].LeftBorder:SetTexture(r, g, b) + self.Spec['Spec'..i].RightBorder:SetTexture(r, g, b) + self.Spec['Spec'..i].BottomLeftBorder:SetTexture(r, g, b) + self.Spec['Spec'..i].BottomRightBorder:SetTexture(r, g, b) + self.Spec['Spec'..i].Icon:SetBackdropBorderColor(r, g, b) + end +end + +UnitPopupButtons.KnightInspect = { ['text'] = L['KnightInspect'], ['dist'] = 0, } + +function IFO:Initialize() + -- if not E.private.sle.Armory.Inspect.Enable then return end + + Default_NotifyInspect = _G['NotifyInspect'] + Default_InspectUnit = _G['InspectUnit'] + + if KI.CreateInspectFrame then + KI:CreateInspectFrame() + end + + _G['NotifyInspect'] = ENI.NotifyInspect or _G['NotifyInspect'] + _G['InspectUnit'] = KI.InspectUnit + + tinsert(UnitPopupMenus.FRIEND, 5, 'KnightInspect') + tinsert(UnitPopupMenus.GUILD, 5, 'KnightInspect') + tinsert(UnitPopupMenus.RAID, 12, 'KnightInspect') + tinsert(UnitPopupMenus.FOCUS, 5, 'KnightInspect') + for _, GroupType in pairs({ 'PLAYER', 'PARTY' }) do + for Index, MenuType in pairs(UnitPopupMenus[GroupType]) do + if MenuType == 'INSPECT' then + UnitPopupMenus[GroupType][Index] = 'KnightInspect' + break + end + end + end + + KI.Activate = true +end +E:RegisterModule(IFO:GetName()) \ No newline at end of file diff --git a/ElvUI_SLE/modules/characterframe/load_characterframe.xml b/ElvUI_SLE/modules/characterframe/load_characterframe.xml index b0a0edd..1d836d4 100755 --- a/ElvUI_SLE/modules/characterframe/load_characterframe.xml +++ b/ElvUI_SLE/modules/characterframe/load_characterframe.xml @@ -1,8 +1,8 @@ <Ui xmlns="http://www.blizzard.com/wow/ui/"> <Script file='core.lua'/> + <Script file='communication.lua'/> + <Script file='notifyinspect.lua'/> <Script file='characterframe.lua'/> - <Script file='durability.lua'/> - <Script file='itemlevel.lua'/> - <Script file='enchant.lua'/> + <Script file='inspectframe.lua'/> <Script file='options.lua'/> </Ui> \ No newline at end of file diff --git a/ElvUI_SLE/modules/characterframe/notifyinspect.lua b/ElvUI_SLE/modules/characterframe/notifyinspect.lua new file mode 100644 index 0000000..3b1d1d7 --- /dev/null +++ b/ElvUI_SLE/modules/characterframe/notifyinspect.lua @@ -0,0 +1,121 @@ +local type, tinsert = type, tinsert +local ENI = _G['EnhancedNotifyInspectFrame'] + +if not ENI then + local BlizzardNotifyInspect = _G['NotifyInspect'] + local playerRealm = GetRealmName() + + ENI = CreateFrame('Frame', 'EnhancedNotifyInspectFrame', UIParent) + ENI.UpdatedTime = 0 + ENI.UpdateInterval = 1 + ENI.InspectList = {} + ENI:SetScript('OnEvent', function(self, Event, ...) + if self[Event] then + self[Event](...) + end + end) + ENI:Hide() + + ENI.TryInspect = function() + if ENI.InspectList[1] and ENI.InspectList[(ENI.InspectList[1])] then + local CurrentUnitGUID = UnitGUID(ENI.InspectList[(ENI.InspectList[1])].UnitID) + + if CurrentUnitGUID and not (ENI.CurrentInspectUnitGUID and CurrentUnitGUID ~= ENI.CurrentInspectUnitGUID) then + ENI.CurrentInspectUnitGUID = CurrentUnitGUID + BlizzardNotifyInspect(ENI.InspectList[(ENI.InspectList[1])].UnitID) + else + ENI.CancelInspect(ENI.InspectList[1]) + end + return + end + + ENI.UpdatedTime = 0 + ENI:Hide() + end + + ENI.NotifyInspect = function(Unit, InspectFirst) + if Unit ~= 'target' and UnitIsUnit(Unit, 'target') then + Unit = 'target' + end + + if Unit ~= 'focus' and UnitIsUnit(Unit, 'focus') then + Unit = 'focus' + end + + if UnitInParty(Unit) or UnitInRaid(Unit) then + Unit = GetUnitName(Unit, true) + end + + if UnitIsPlayer(Unit) and CanInspect(Unit) then + local TableIndex = GetUnitName(Unit, true) + + if not ENI.InspectList[TableIndex] then + if InspectFirst then + tinsert(ENI.InspectList, 1, TableIndex) + else + tinsert(ENI.InspectList, TableIndex) + end + + ENI.InspectList[TableIndex] = { + ['Index'] = InspectFirst and 1 or #ENI.InspectList, + ['UnitID'] = Unit, + ['CancelInspectByManual'] = InspectFirst, + } + ENI.CurrentInspectUnitGUID = UnitGUID(Unit) + --ENI.TryInspect() + ENI:Show() + elseif InspectFirst and ENI.InspectList[TableIndex] then + ENI.CancelInspect(TableIndex) + ENI.NotifyInspect(Unit, InspectFirst) + end + end + + return Unit + end + + ENI.CancelInspect = function(Unit) + if ENI.InspectList[Unit] then + if ENI.InspectList[Unit].Index == 1 then + ENI.CurrentInspectUnitGUID = nil + end + + tremove(ENI.InspectList, ENI.InspectList[Unit].Index) + ENI.CurrentInspectUnitGUID = nil + ENI.InspectList[Unit] = nil + end + end + + ENI.INSPECT_READY = function(InspectedUnitGUID) + if InspectedUnitGUID == ENI.CurrentInspectUnitGUID then + local Name, Realm + _, _, _, _, _, Name, Realm = GetPlayerInfoByGUID(InspectedUnitGUID) + Name = Name..(Realm and Realm ~= '' and Realm ~= playerRealm and '-'..Realm or '') + + if ENI.InspectList[Name] then + if ENI.InspectList[Name].CancelInspectByManual then + return + end + + ENI.CancelInspect(Name) + ENI.UpdatedTime = 0 + end + + ENI.CurrentInspectUnitGUID = nil + end + end + ENI:RegisterEvent('INSPECT_READY') + + ENI.Updater = function(_, elapsed) + ENI.UpdatedTime = ENI.UpdatedTime + elapsed + + if ENI.UpdatedTime < 0 then + return + else + ENI.UpdatedTime = -ENI.UpdateInterval + end + + ENI.TryInspect() + end + + ENI:SetScript('OnUpdate', ENI.Updater) +end \ No newline at end of file